Added logging, changed some directory structure

goTorrentWebUI/node_modules/superagent/.travis.yml

@@ -0,0 +1,16 @@
+sudo: false
+language: node_js
+node_js:
+  - "8"
+  - "6"
+  - "4"
+
+env:
+  global:
+    - SAUCE_USERNAME='shtylman-superagent'
+    - SAUCE_ACCESS_KEY='39a45464-cb1d-4b8d-aa1f-83c7c04fa673'
+
+matrix:
+  include:
+    - node_js: "8"
+      env: BROWSER=1

goTorrentWebUI/node_modules/superagent/.zuul.yml

@@ -0,0 +1,14 @@
+ui: mocha-bdd
+server: ./test/support/server.js
+tunnel_host: http://focusaurus.com
+browsers:
+  - name: chrome
+    version: latest
+  - name: firefox
+    version: latest
+  - name: safari
+    version: latest
+  - name: iphone
+    version: latest
+  - name: ie
+    version: 9..latest

goTorrentWebUI/node_modules/superagent/Contributing.md

@@ -0,0 +1,7 @@
+When submitting a PR, your chance of acceptance increases if you do the following:
+
+* Code style is consistent with existing in the file.
+* Tests are passing (client and server).
+* You add a test for the failing issue you are fixing.
+* Code changes are focused on the area of discussion.
+* Do not rebuild the distribution files or increment version numbers.

goTorrentWebUI/node_modules/superagent/History.md

@@ -0,0 +1,706 @@
+# 3.8.1 (2017-11-08)
+
+ * Clear authorization header on cross-domain redirect
+
+# 3.8.0
+
+ * Added support for "globally" defined headers and event handlers via `superagent.agent()`. It now remembers default settings for all its requests.
+ * Added optional callback to `.retry()` (Alexander Murphy)
+ * Unified auth args handling in node/browser (Edmundo Alvarez)
+ * Fixed error handling in zlib pipes (Kornel)
+ * Documented that 3xx status codes are errors (Mickey Reiss)
+
+# 3.7.0 (2017-10-17)
+
+ * Limit maximum response size. Prevents zip bombs (Kornel)
+ * Catch and pass along errors in `.ok()` callback (Jeremy Ruppel)
+ * Fixed parsing of XHR headers without a newline (nsf)
+
+# 3.6.2 (2017-10-02)
+
+ * Upgrade MIME type dependency to a newer, secure version
+ * Recognize PDF MIME as binary
+ * Fix for error in subsequent require() calls (Steven de Salas)
+
+# 3.6.0 (2017-08-20)
+
+ * Support disabling TCP_NODELAY option (#1240) (xiamengyu)
+ * Send payload in query string for GET and HEAD shorthand API (Peter Lyons)
+ * Support passphrase with pfx certificate (Paul Westerdale (ABRS Limited))
+ * Documentation improvements (Peter Lyons)
+ * Fixed duplicated query string params (#1200) (Kornel)
+
+# 3.5.1 (2017-03-18)
+
+ * Allow crossDomain errors to be retried (#1194) (Michael Olson)
+ * Read responseType property from the correct object (Julien Dupouy)
+ * Check for ownProperty before adding header (Lucas Vieira)
+
+# 3.5.0 (2017-02-23)
+
+ * Add errno to distinguish between request timeout and body download timeout (#1184) (Kornel Lesiński)
+ * Warn about bogus timeout options (#1185) (Kornel Lesiński)
+
+# 3.4.4 (2017-02-17)
+
+ * Treat videos like images (Kornel Lesiński)
+ * Avoid renaming module (Kornel Lesiński)
+
+# 3.4.3 (2017-02-14)
+
+ * Fixed being able to define own parsers when their mime type starts with `text/` (Damien Clark)
+ * `withCredentials(false)` (Andy Woods)
+ * Use `formData.on` instead of `.once` (Kornel Lesiński)
+ * Ignore `attach("file",null)` (Kornel Lesiński)
+
+# 3.4.1 (2017-01-29)
+
+ * Allow `retry()` and `retry(0)` (Alexander Pope)
+ * Allow optional body/data in DELETE requests (Alpha Shuro)
+ * Fixed query string on retried requests (Kornel Lesiński)
+
+# 3.4.0 (2017-01-25)
+
+ * New `.retry(n)` method and `err.retries` (Alexander Pope)
+ * Docs for HTTPS request (Jun Wan Goh)
+
+# 3.3.1 (2016-12-17)
+
+  * Fixed "double callback bug" warning on timeouts of gzipped responses
+
+# 3.3.0 (2016-12-14)
+
+ * Added `.ok(callback)` that allows customizing which responses are errors (Kornel Lesiński)
+ * Added `.responseType()` to Node version (Kornel Lesiński)
+ * Added `.parse()` to browser version (jakepearson)
+ * Fixed parse error when using `responseType('blob')` (Kornel Lesiński)
+
+# 3.2.0 (2016-12-11)
+
+ * Added `.timeout({response:ms})`, which allows limiting maximum response time independently from total download time (Kornel Lesiński)
+ * Added warnings when `.end()` is called more than once (Kornel Lesiński)
+ * Added `response.links` to browser version (Lukas Eipert)
+ * `btoa` is no longer required in IE9 (Kornel Lesiński)
+ * Fixed `.sortQuery()` on URLs without query strings (Kornel Lesiński)
+ * Refactored common response code into `ResponseBase` (Lukas Eipert)
+
+# 3.1.0 (2016-11-28)
+
+ * Added `.sortQuery()` (vicanso)
+ * Added support for arrays and bools in `.field()` (Kornel Lesiński)
+ * Made `superagent.Request` subclassable without need to patch all static methods (Kornel Lesiński)
+
+# 3.0.0 (2016-11-19)
+
+ * Dropped support for Node 0.x. Please upgrade to at least Node 4.
+ * Dropped support for componentjs (Damien Caselli)
+ * Removed deprecated `.part()`/`superagent.Part` APIs.
+ * Removed unreliable `.body` property on internal response object used by unbuffered parsers.
+   Note: the normal `response.body` is unaffected.
+ * Multiple `.send()` calls mixing `Buffer`/`Blob` and JSON data are not possible and will now throw instead of messing up the data.
+ * Improved `.send()` data object type check (Fernando Mendes)
+ * Added common prototype for Node and browser versions (Andreas Helmberger)
+ * Added `http+unix:` schema to support Unix sockets (Yuki KAN)
+ * Added full `attach` options parameter in the Node version (Lapo Luchini)
+ * Added `pfx` TLS option with new `pfx()` method. (Reid Burke)
+ * Internally changed `.on` to `.once` to prevent possible memory leaks (Matt Blair)
+ * Made all errors reported as an event (Kornel Lesiński)
+
+# 2.3.0 (2016-09-20)
+
+ * Enabled `.field()` to handle objects (Affan Shahid)
+ * Added authentication with client certificates (terusus)
+ * Added `.catch()` for more Promise-like interface (Maxim Samoilov, Kornel Lesiński)
+ * Silenced errors from incomplete gzip streams for compatibility with web browsers (Kornel Lesiński)
+ * Fixed `event.direction` in uploads (Kornel Lesiński)
+ * Fixed returned value of overwritten response object's `on()` method (Juan Dopazo)
+
+# 2.2.0 (2016-08-13)
+
+ * Added `timedout` property to node Request instance (Alexander Pope)
+ * Unified `null` querystring values in node and browser environments. (George Chung)
+
+# 2.1.0 (2016-06-14)
+
+ * Refactored async parsers. Now the `end` callback waits for async parsers to finish (Kornel Lesiński)
+ * Errors thrown in `.end()` callback don't cause the callback to be called twice (Kornel Lesiński)
+ * Added `headers` to `toJSON()` (Tao)
+
+# 2.0.0 (2016-05-29)
+
+## Breaking changes
+
+Breaking changes are in rarely used functionality, so we hope upgrade will be smooth for most users.
+
+  * Browser: The `.parse()` method has been renamed to `.serialize()` for consistency with NodeJS version.
+  * Browser: Query string keys without a value used to be parsed as `'undefined'`, now their value is `''` (empty string) (shura, Kornel Lesiński).
+  * NodeJS: The `redirect` event is called after new query string and headers have been set and is allowed to override the request URL (Kornel Lesiński)
+  * `.then()` returns a real `Promise`. Note that use of superagent with promises now requires a global `Promise` object.
+    If you target Internet Explorer or Node 0.10, you'll need `require('es6-promise').polyfill()` or similar.
+  * Upgraded all dependencies (Peter Lyons)
+  * Renamed properties documented as `@api private` to have `_prefixed` names (Kornel Lesiński)
+
+## Probably not breaking changes:
+
+  * Extracted common functions to request-base (Peter Lyons)
+  * Fixed race condition in pipe tests (Peter Lyons)
+  * Handle `FormData` error events (scriptype)
+  * Fixed wrong jsdoc of Request#attach (George Chung)
+  * Updated and improved tests (Peter Lyons)
+  * `request.head()` supports `.redirects(5)` call (Kornel Lesiński)
+  * `response` event is also emitted when using `.pipe()`
+
+# 1.8.2 (2016-03-20)
+
+  * Fixed handling of HTTP status 204 with content-encoding: gzip (Andrew Shelton)
+  * Handling of FormData error events (scriptype)
+  * Fixed parsing of `vnd+json` MIME types (Kornel Lesiński)
+  * Aliased browser implementation of `.parse()` as `.serialize()` for forward compatibility
+
+# 1.8.1 (2016-03-14)
+
+  * Fixed form-data incompatibility with IE9
+
+# 1.8.0 (2016-03-09)
+
+ * Extracted common code into request-base class (Peter Lyons)
+   * It does not affect the public API, but please let us know if you notice any plugins/subclasses breaking!
+ * Added option `{type:'auto'}` to `auth` method, which enables browser-native auth types (Jungle, Askar Yusupov)
+ * Added `responseType()` to set XHR `responseType` (chris)
+ * Switched to form-data for browserify-compatible `FormData` (Peter Lyons)
+ * Added `statusCode` to error response when JSON response is malformed (mattdell)
+ * Prevented TCP port conflicts in all tests (Peter Lyons)
+ * Updated form-data dependency
+
+# 1.7.2 (2016-01-26)
+
+ * Fix case-sensitivity of header fields introduced by a4ddd6a. (Edward J. Jinotti)
+ * bump extend dependency, as former version did not contain any license information (Lukas Eipert)
+
+# 1.7.1 (2016-01-21)
+
+ * Fixed a conflict with express when using npm 3.x (Glenn)
+ * Fixed redirects after a multipart/form-data POST request (cyclist2)
+
+# 1.7.0 (2016-01-18)
+
+ * When attaching files, read default filename from the `File` object (JD Isaacks)
+ * Add `direction` property to `progress` events (Joseph Dykstra)
+ * Update component-emitter & formidable (Kornel Lesiński)
+ * Don't re-encode query string needlessly (Ruben Verborgh)
+ * ensure querystring is appended when doing `stream.pipe(request)` (Keith Grennan)
+ * change set header function, not call `this.request()` until call `this.end()` (vicanso)
+ * Add no-op `withCredentials` to Node API (markdalgleish)
+ * fix `delete` breaking on ie8 (kenjiokabe)
+ * Don't let request error override responses (Clay Reimann)
+ * Increased number of tests shared between node and client (Kornel Lesiński)
+
+# 1.6.0/1.6.1 (2015-12-09)
+
+ * avoid misleading CORS error message
+ * added 'progress' event on file/form upload in Node (Olivier Lalonde)
+ * return raw response if the response parsing fails (Rei Colina)
+ * parse content-types ending with `+json` as JSON (Eiryyy)
+ * fix to avoid throwing errors on aborted requests (gjurgens)
+ * retain cookies on redirect when hosts match (Tom Conroy)
+ * added Bower manifest (Johnny Freeman)
+ * upgrade to latest cookiejar (Andy Burke)
+
+# 1.5.0 (2015-11-30)
+
+ * encode array values as `key=1&key=2&key=3` etc... (aalpern, Davis Kim)
+ * avoid the error which is omitted from 'socket hang up'
+ * faster JSON parsing, handling of zlib errors (jbellenger)
+ * fix IE11 sends 'undefined' string if data was undefined (Vadim Goncharov)
+ * alias `del()` method as `delete()` (Aaron Krause)
+ * revert Request#parse since it was actually Response#parse
+
+# 1.4.0 (2015-09-14)
+
+ * add Request#parse method to client library
+ * add missing statusCode in client response
+ * don't apply JSON heuristics if a valid parser is found
+ * fix detection of root object for webworkers
+
+# 1.3.0 (2015-08-05)
+
+ * fix incorrect content-length of data set to buffer
+ * serialize request data takes into account charsets
+ * add basic promise support via a `then` function
+
+# 1.2.0 (2015-04-13)
+
+ * add progress events to downlodas
+ * make usable in webworkers
+ * add support for 308 redirects
+ * update node-form-data dependency
+ * update to work in react native
+ * update node-mime dependency
+
+# 1.1.0 (2015-03-13)
+
+ * Fix responseType checks without xhr2 and ie9 tests (rase-)
+ * errors have .status and .response fields if applicable (defunctzombie)
+ * fix end callback called before saving cookies (rase-)
+
+1.0.0 / 2015-03-08
+==================
+
+ * All non-200 responses are treated as errors now. (The callback is called with an error when the response has a status < 200 or >= 300 now. In previous versions this would not have raised an error and the client would have to check the `res` object. See [#283](https://github.com/visionmedia/superagent/issues/283).
+ * keep timeouts intact across redirects (hopkinsth)
+ * handle falsy json values (themaarten)
+ * fire response events in browser version (Schoonology)
+ * getXHR exported in client version (KidsKilla)
+ * remove arity check on `.end()` callbacks (defunctzombie)
+ * avoid setting content-type for host objects (rexxars)
+ * don't index array strings in querystring (travisjeffery)
+ * fix pipe() with redirects (cyrilis)
+ * add xhr2 file download (vstirbu)
+ * set default response type to text/plain if not specified (warrenseine)
+
+0.21.0 / 2014-11-11
+==================
+
+ * Trim text before parsing json (gjohnson)
+ * Update tests to express 4 (gaastonsr)
+ * Prevent double callback when error is thrown (pgn-vole)
+ * Fix missing clearTimeout (nickdima)
+ * Update debug (TooTallNate)
+
+0.20.0 / 2014-10-02
+==================
+
+ * Add toJSON() to request and response instances. (yields)
+ * Prevent HEAD requests from getting parsed. (gjohnson)
+ * Update debug. (TooTallNate)
+
+0.19.1 / 2014-09-24
+==================
+
+ * Fix basic auth issue when password is falsey value. (gjohnson)
+
+0.19.0 / 2014-09-24
+==================
+
+ * Add unset() to browser. (shesek)
+ * Prefer XHR over ActiveX. (omeid)
+ * Catch parse errors. (jacwright)
+ * Update qs dependency. (wercker)
+ * Add use() to node. (Financial-Times)
+ * Add response text to errors. (yields)
+ * Don't send empty cookie headers. (undoZen)
+ * Don't parse empty response bodies. (DveMac)
+ * Use hostname when setting cookie host. (prasunsultania)
+
+0.18.2 / 2014-07-12
+==================
+
+ * Handle parser errors. (kof)
+ * Ensure not to use default parsers when there is a user defined one. (kof)
+
+0.18.1 / 2014-07-05
+==================
+
+ * Upgrade cookiejar dependency (juanpin)
+ * Support image mime types (nebulade)
+ * Make .agent chainable (kof)
+ * Upgrade debug (TooTallNate)
+ * Fix docs (aheckmann)
+
+0.18.0 / 2014-04-29
+===================
+
+* Use "form-data" module for the multipart/form-data implementation. (TooTallNate)
+* Add basic `field()` and `attach()` functions for HTML5 FormData. (TooTallNate)
+* Deprecate `part()`. (TooTallNate)
+* Set default user-agent header. (bevacqua)
+* Add `unset()` method for removing headers. (bevacqua)
+* Update cookiejar. (missinglink)
+* Fix response error formatting. (shesek)
+
+0.17.0 / 2014-03-06
+===================
+
+ * supply uri malformed error to the callback (yields)
+ * add request event (yields)
+ * allow simple auth (yields)
+ * add request event (yields)
+ * switch to component/reduce (visionmedia)
+ * fix part content-disposition (mscdex)
+ * add browser testing via zuul (defunctzombie)
+ * adds request.use() (johntron)
+
+0.16.0 / 2014-01-07
+==================
+
+ * remove support for 0.6 (superjoe30)
+ * fix CORS withCredentials (wejendorp)
+ * add "test" script (superjoe30)
+ * add request .accept() method (nickl-)
+ * add xml to mime types mappings (nickl-)
+ * fix parse body error on HEAD requests (gjohnson)
+ * fix documentation typos (matteofigus)
+ * fix content-type + charset (bengourley)
+ * fix null values on query parameters (cristiandouce)
+
+0.15.7 / 2013-10-19
+==================
+
+ * pin should.js to 1.3.0 due to breaking change in 2.0.x
+ * fix browserify regression
+
+0.15.5 / 2013-10-09
+==================
+
+ * add browser field to support browserify
+ * fix .field() value number support
+
+0.15.4 / 2013-07-09
+==================
+
+ * node: add a Request#agent() function to set the http Agent to use
+
+0.15.3 / 2013-07-05
+==================
+
+ * fix .pipe() unzipping on more recent nodes. Closes #240
+ * fix passing an empty object to .query() no longer appends "?"
+ * fix formidable error handling
+ * update formidable
+
+0.15.2 / 2013-07-02
+==================
+
+ * fix: emit 'end' when piping.
+
+0.15.1 / 2013-06-26
+==================
+
+ * add try/catch around parseLinks
+
+0.15.0 / 2013-06-25
+==================
+
+ * make `Response#toError()` have a more meaningful `message`
+
+0.14.9 / 2013-06-15
+==================
+
+ * add debug()s to the node client
+ * add .abort() method to node client
+
+0.14.8 / 2013-06-13
+==================
+
+ * set .agent = false always
+ * remove X-Requested-With. Closes #189
+
+0.14.7 / 2013-06-06
+==================
+
+ * fix unzip error handling
+
+0.14.6 / 2013-05-23
+==================
+
+ * fix HEAD unzip bug
+
+0.14.5 / 2013-05-23
+==================
+
+ * add flag to ensure the callback is __never__ invoked twice
+
+0.14.4 / 2013-05-22
+==================
+
+ * add superagent.js build output
+ * update qs
+ * update emitter-component
+ * revert "add browser field to support browserify" see GH-221
+
+0.14.3 / 2013-05-18
+==================
+
+ * add browser field to support browserify
+
+0.14.2/ 2013-05-07
+==================
+
+  * add host object check to fix serialization of File/Blobs etc as json
+
+0.14.1 / 2013-04-09
+==================
+
+  * update qs
+
+0.14.0 / 2013-04-02
+==================
+
+  * add client-side basic auth
+  * fix retaining of .set() header field case
+
+0.13.0 / 2013-03-13
+==================
+
+  * add progress events to client
+  * add simple example
+  * add res.headers as alias of res.header for browser client
+  * add res.get(field) to node/client
+
+0.12.4 / 2013-02-11
+==================
+
+  * fix get content-type even if can't get other headers in firefox. fixes #181
+
+0.12.3 / 2013-02-11
+==================
+
+  * add quick "progress" event support
+
+0.12.2 / 2013-02-04
+==================
+
+  * add test to check if response acts as a readable stream
+  * add ReadableStream in the Response prototype.
+  * add test to assert correct redirection when the host changes in the location header.
+  * add default Accept-Encoding. Closes #155
+  * fix req.pipe() return value of original stream for node parity. Closes #171
+  * remove the host header when cleaning headers to properly follow the redirection.
+
+0.12.1 / 2013-01-10
+==================
+
+  * add x-domain error handling
+
+0.12.0 / 2013-01-04
+==================
+
+  * add header persistence on redirects
+
+0.11.0 / 2013-01-02
+==================
+
+  * add .error Error object. Closes #156
+  * add forcing of res.text removal for FF HEAD responses. Closes #162
+  * add reduce component usage. Closes #90
+  * move better-assert dep to development deps
+
+0.10.0 / 2012-11-14
+==================
+
+  * add req.timeout(ms) support for the client
+
+0.9.10 / 2012-11-14
+==================
+
+  * fix client-side .query(str) support
+
+0.9.9 / 2012-11-14
+==================
+
+  * add .parse(fn) support
+  * fix socket hangup with dates in querystring. Closes #146
+  * fix socket hangup "error" event when a callback of arity 2 is provided
+
+0.9.8 / 2012-11-03
+==================
+
+  * add emission of error from `Request#callback()`
+  * add a better fix for nodes weird socket hang up error
+  * add PUT/POST/PATCH data support to client short-hand functions
+  * add .license property to component.json
+  * change client portion to build using component(1)
+  * fix GET body support [guille]
+
+0.9.7 / 2012-10-19
+==================
+
+  * fix `.buffer()` `res.text` when no parser matches
+
+0.9.6 / 2012-10-17
+==================
+
+  * change: use `this` when `window` is undefined
+  * update to new component spec [juliangruber]
+  * fix emission of "data" events for compressed responses without encoding. Closes #125
+
+0.9.5 / 2012-10-01
+==================
+
+  * add field name to .attach()
+  * add text "parser"
+  * refactor isObject()
+  * remove wtf isFunction() helper
+
+0.9.4 / 2012-09-20
+==================
+
+  * fix `Buffer` responses [TooTallNate]
+  * fix `res.type` when a "type" param is present [TooTallNate]
+
+0.9.3 / 2012-09-18
+==================
+
+  * remove __GET__ `.send()` == `.query()` special-case (__API__ change !!!)
+
+0.9.2 / 2012-09-17
+==================
+
+  * add `.aborted` prop
+  * add `.abort()`. Closes #115
+
+0.9.1 / 2012-09-07
+==================
+
+  * add `.forbidden` response property
+  * add component.json
+  * change emitter-component to 0.0.5
+  * fix client-side tests
+
+0.9.0 / 2012-08-28
+==================
+
+  * add `.timeout(ms)`. Closes #17
+
+0.8.2 / 2012-08-28
+==================
+
+  * fix pathname relative redirects. Closes #112
+
+0.8.1 / 2012-08-21
+==================
+
+  * fix redirects when schema is specified
+
+0.8.0 / 2012-08-19
+==================
+
+  * add `res.buffered` flag
+  * add buffering of text/*, json and forms only by default. Closes #61
+  * add `.buffer(false)` cancellation
+  * add cookie jar support [hunterloftis]
+  * add agent functionality [hunterloftis]
+
+0.7.0 / 2012-08-03
+==================
+
+  * allow `query()` to be called after the internal `req` has been created [tootallnate]
+
+0.6.0 / 2012-07-17
+==================
+
+  * add `res.send('foo=bar')` default of "application/x-www-form-urlencoded"
+
+0.5.1 / 2012-07-16
+==================
+
+  * add "methods" dep
+  * add `.end()` arity check to node callbacks
+  * fix unzip support due to weird node internals
+
+0.5.0 / 2012-06-16
+==================
+
+  * Added "Link" response header field parsing, exposing `res.links`
+
+0.4.3 / 2012-06-15
+==================
+
+  * Added 303, 305 and 307 as redirect status codes [slaskis]
+  * Fixed passing an object as the url
+
+0.4.2 / 2012-06-02
+==================
+
+  * Added component support
+  * Fixed redirect data
+
+0.4.1 / 2012-04-13
+==================
+
+  * Added HTTP PATCH support
+  * Fixed: GET / HEAD when following redirects. Closes #86
+  * Fixed Content-Length detection for multibyte chars
+
+0.4.0 / 2012-03-04
+==================
+
+  * Added `.head()` method [browser]. Closes #78
+  * Added `make test-cov` support
+  * Added multipart request support. Closes #11
+  * Added all methods that node supports. Closes #71
+  * Added "response" event providing a Response object. Closes #28
+  * Added `.query(obj)`. Closes #59
+  * Added `res.type` (browser). Closes #54
+  * Changed: default `res.body` and `res.files` to {}
+  * Fixed: port existing query-string fix (browser). Closes #57
+
+0.3.0 / 2012-01-24
+==================
+
+  * Added deflate/gzip support [guillermo]
+  * Added `res.type` (Content-Type void of params)
+  * Added `res.statusCode` to mirror node
+  * Added `res.headers` to mirror node
+  * Changed: parsers take callbacks
+  * Fixed optional schema support. Closes #49
+
+0.2.0 / 2012-01-05
+==================
+
+  * Added url auth support
+  * Added `.auth(username, password)`
+  * Added basic auth support [node]. Closes #41
+  * Added `make test-docs`
+  * Added guillermo's EventEmitter. Closes #16
+  * Removed `Request#data()` for SS, renamed to `send()`
+  * Removed `Request#data()` from client, renamed to `send()`
+  * Fixed array support. [browser]
+  * Fixed array support. Closes #35 [node]
+  * Fixed `EventEmitter#emit()`
+
+0.1.3 / 2011-10-25
+==================
+
+  * Added error to callback
+  * Bumped node dep for 0.5.x
+
+0.1.2 / 2011-09-24
+==================
+
+  * Added markdown documentation
+  * Added `request(url[, fn])` support to the client
+  * Added `qs` dependency to package.json
+  * Added options for `Request#pipe()`
+  * Added support for `request(url, callback)`
+  * Added `request(url)` as shortcut for `request.get(url)`
+  * Added `Request#pipe(stream)`
+  * Added inherit from `Stream`
+  * Added multipart support
+  * Added ssl support (node)
+  * Removed Content-Length field from client
+  * Fixed buffering, `setEncoding()` to utf8 [reported by stagas]
+  * Fixed "end" event when piping
+
+0.1.1 / 2011-08-20
+==================
+
+  * Added `res.redirect` flag (node)
+  * Added redirect support (node)
+  * Added `Request#redirects(n)` (node)
+  * Added `.set(object)` header field support
+  * Fixed `Content-Length` support
+
+0.1.0 / 2011-08-09
+==================
+
+  * Added support for multiple calls to `.data()`
+  * Added support for `.get(uri, obj)`
+  * Added GET `.data()` querystring support
+  * Added IE{6,7,8} support [alexyoung]
+
+0.0.1 / 2011-08-05
+==================
+
+  * Initial commit
+

goTorrentWebUI/node_modules/superagent/LICENSE

@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

goTorrentWebUI/node_modules/superagent/Makefile

@@ -0,0 +1,57 @@
+
+NODETESTS ?= test/*.js test/node/*.js
+BROWSERTESTS ?= test/*.js test/client/*.js
+REPORTER = spec
+
+all: superagent.js
+
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then make test-node; else make test-browser; fi
+
+test-node:
+	@NODE_ENV=test NODE_TLS_REJECT_UNAUTHORIZED=0 ./node_modules/.bin/mocha \
+		--require should \
+		--reporter $(REPORTER) \
+		--timeout 5000 \
+		--growl \
+		$(NODETESTS)
+
+test-cov: lib-cov
+	SUPERAGENT_COV=1 $(MAKE) test REPORTER=html-cov > coverage.html
+
+test-browser:
+	SAUCE_APPIUM_VERSION=1.7 ./node_modules/.bin/zuul -- $(BROWSERTESTS)
+
+test-browser-local:
+	./node_modules/.bin/zuul --no-coverage --local 4000 -- $(BROWSERTESTS)
+
+lib-cov:
+	jscoverage lib lib-cov
+
+superagent.js: lib/node/*.js lib/node/parsers/*.js
+	@./node_modules/.bin/browserify \
+		--standalone superagent \
+		--outfile superagent.js .
+
+test-server:
+	@node test/server
+
+docs: index.html test-docs docs/index.md
+
+index.html: docs/index.md docs/head.html docs/tail.html
+	marked < $< \
+		| cat docs/head.html - docs/tail.html \
+		> $@
+
+docclean:
+	rm -f index.html docs/test.html
+
+test-docs: docs/head.html docs/tail.html
+	make test REPORTER=doc \
+		| cat docs/head.html - docs/tail.html \
+		> docs/test.html
+
+clean:
+	rm -fr superagent.js components
+
+.PHONY: test-cov test docs test-docs clean test-browser-local

goTorrentWebUI/node_modules/superagent/Readme.md

@@ -0,0 +1,136 @@
+# SuperAgent [![Build Status](https://travis-ci.org/visionmedia/superagent.svg?branch=master)](https://travis-ci.org/visionmedia/superagent)
+
+[![Sauce Test Status](https://saucelabs.com/browser-matrix/shtylman-superagent.svg)](https://saucelabs.com/u/shtylman-superagent)
+
+SuperAgent is a small progressive __client-side__ HTTP request library, and __Node.js__ module with the same API, sporting many high-level HTTP client features. View the [docs](http://visionmedia.github.io/superagent/).
+
+![super agent](http://f.cl.ly/items/3d282n3A0h0Z0K2w0q2a/Screenshot.png)
+
+## Installation
+
+node:
+
+```
+$ npm install superagent
+```
+
+Works with [browserify](https://github.com/substack/node-browserify) and [webpack](https://github.com/visionmedia/superagent/wiki/SuperAgent-for-Webpack).
+
+```js
+request
+  .post('/api/pet')
+  .send({ name: 'Manny', species: 'cat' }) // sends a JSON post body
+  .set('X-API-Key', 'foobar')
+  .set('accept', 'json')
+  .end((err, res) => {
+    // Calling the end function will send the request
+  });
+```
+
+## Supported browsers and Node versions
+
+Tested browsers:
+
+- Latest Firefox, Chrome, Safari
+- Latest Android, iPhone
+- IE10 through latest. IE9 with polyfills. Even though IE9 is supported, a polyfill for `window.FormData` is required for `.field()`.
+
+Node 4 or later is required.
+
+## Plugins
+
+SuperAgent is easily extended via plugins.
+
+```js
+const nocache = require('superagent-no-cache');
+const request = require('superagent');
+const prefix = require('superagent-prefix')('/static');
+
+request
+  .get('/some-url')
+  .query({ action: 'edit', city: 'London' }) // query string
+  .use(prefix) // Prefixes *only* this request
+  .use(nocache) // Prevents caching of *only* this request
+  .end((err, res) => {
+    // Do something
+  });
+```
+
+Existing plugins:
+ * [superagent-no-cache](https://github.com/johntron/superagent-no-cache) - prevents caching by including Cache-Control header
+ * [superagent-prefix](https://github.com/johntron/superagent-prefix) - prefixes absolute URLs (useful in test environment)
+ * [superagent-suffix](https://github.com/timneutkens1/superagent-suffix) - suffix URLs with a given path
+ * [superagent-mock](https://github.com/M6Web/superagent-mock) - simulate HTTP calls by returning data fixtures based on the requested URL
+ * [superagent-mocker](https://github.com/shuvalov-anton/superagent-mocker) — simulate REST API
+ * [superagent-cache](https://github.com/jpodwys/superagent-cache) - A global SuperAgent patch with built-in, flexible caching
+  * [superagent-cache-plugin](https://github.com/jpodwys/superagent-cache-plugin) - A SuperAgent plugin with built-in, flexible caching
+ * [superagent-jsonapify](https://github.com/alex94puchades/superagent-jsonapify) - A lightweight [json-api](http://jsonapi.org/format/) client addon for superagent
+ * [superagent-serializer](https://github.com/zzarcon/superagent-serializer) - Converts server payload into different cases
+ * [superagent-use](https://github.com/koenpunt/superagent-use) - A client addon to apply plugins to all requests.
+ * [superagent-httpbackend](https://www.npmjs.com/package/superagent-httpbackend) - stub out requests using AngularJS' $httpBackend syntax
+ * [superagent-throttle](https://github.com/leviwheatcroft/superagent-throttle) - queues and intelligently throttles requests
+ * [superagent-charset](https://github.com/magicdawn/superagent-charset) - add charset support for node's SuperAgent
+
+Please prefix your plugin with `superagent-*` so that it can easily be found by others.
+
+For SuperAgent extensions such as couchdb and oauth visit the [wiki](https://github.com/visionmedia/superagent/wiki).
+
+## Upgrading from previous versions:
+
+Our breaking changes are mostly in rarely used functionality and from stricter error handling.
+
+* [2.x to 3.x](https://github.com/visionmedia/superagent/releases/tag/v3.0.0):
+  - Ensure you're running Node 4 or later. We dropped support for Node 0.x.
+  - Test code that calls `.send()` multiple times. Invalid calls to `.send()` will now throw instead of sending garbage.
+* [1.x to 2.x](https://github.com/visionmedia/superagent/releases/tag/v2.0.0):
+  - If you use `.parse()` in the *browser* version, rename it to `.serialize()`.
+  - If you rely on `undefined` in query-string values being sent literally as the text "undefined", switch to checking for missing value instead. `?key=undefined` is now `?key` (without a value).
+  - If you use `.then()` in Internet Explorer, ensure that you have a polyfill that adds a global `Promise` object.
+* 0.x to 1.x:
+  - Use `.end(function(err, res){})`. 1-argument version is no longer supported.
+
+## Running node tests
+
+Install dependencies:
+
+```shell
+$ npm install
+```
+Run em!
+
+```shell
+$ make test
+```
+
+## Running browser tests
+
+Install dependencies:
+
+```shell
+$ npm install
+```
+
+Start the test runner:
+
+```shell
+$ make test-browser-local
+```
+
+Visit `http://localhost:4000/__zuul` in your browser.
+
+Edit tests and refresh your browser. You do not have to restart the test runner.
+
+
+## Packaging Notes for Developers
+
+**npm (for node)** is configured via the `package.json` file and the `.npmignore` file. Key metadata in the `package.json` file is the `version` field which should be changed according to semantic versioning and have a 1-1 correspondence with git tags. So for example, if you were to `git show v1.5.0:package.json | grep version`, you should see `"version": "1.5.0",` and this should hold true for every release. This can be handled via the `npm version` command. Be aware that when publishing, npm will presume the version being published should also be tagged in npm as `latest`, which is OK for normal incremental releases. For betas and minor/patch releases to older versions, be sure to include `--tag` appropriately to avoid an older release getting tagged as `latest`.
+
+**npm (for browser standalone)** When we publish versions to npm, we run `make superagent.js` which generates the standalone `superagent.js` file via `browserify`, and this file is included in the package published to npm (but this file is never checked into the git repository). If users want to install via npm but serve a single `.js` file directly to the browser, the `node_modules/superagent/superagent.js` is a standalone browserified file ready to go for that purpose. It is not minified.
+
+**npm (for browserify)** is handled via the `package.json` `browser` field which allows users to install SuperAgent via npm, reference it from their browser code with `require('superagent')`, and then build their own application bundle via `browserify`, which will use `lib/client.js` as the SuperAgent entrypoint.
+
+**bower** is configured via the `bower.json` file. Bower installs files directly from git/github without any transformation, so you *must* use Browserify or Webpack (or use npm).
+
+## License
+
+MIT

goTorrentWebUI/node_modules/superagent/changelog.sh

@@ -0,0 +1,7 @@
+#!/bin/bash
+VER=$(git tag -l v[0-9].[0-9]*.[0-9]* | tail -n 1)
+echo "# ($(date +%Y-%m-%d))"
+echo
+git log $VER...HEAD --no-merges --topo-order --format=' * %s (%an)'
+echo
+echo "# $VER"

goTorrentWebUI/node_modules/superagent/docs/head.html

@@ -0,0 +1,11 @@
+<!DOCTYPE html>
+<html>
+  <head>
+    <meta charset="utf8">
+    <title>SuperAgent — elegant API for AJAX in Node and browsers</title>
+    <link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/tocbot/3.0.0/tocbot.css">
+    <link rel="stylesheet" href="docs/style.css">
+  </head>
+  <body>
+    <ul id="menu"></ul>
+    <div id="content">

goTorrentWebUI/node_modules/superagent/docs/index.md

@@ -0,0 +1,635 @@
+
+# SuperAgent
+
+SuperAgent is light-weight progressive ajax API crafted for flexibility, readability, and a low learning curve after being frustrated with many of the existing request APIs. It also works with Node.js!
+
+     request
+       .post('/api/pet')
+       .send({ name: 'Manny', species: 'cat' })
+       .set('X-API-Key', 'foobar')
+       .set('Accept', 'application/json')
+       .end(function(err, res){
+         if (err || !res.ok) {
+           alert('Oh no! error');
+         } else {
+           alert('yay got ' + JSON.stringify(res.body));
+         }
+       });
+
+## Test documentation
+
+The following [test documentation](docs/test.html) was generated with [Mocha's](http://mochajs.org/) "doc" reporter, and directly reflects the test suite. This provides an additional source of documentation.
+
+## Request basics
+
+A request can be initiated by invoking the appropriate method on the `request` object, then calling `.end()` to send the request. For example a simple __GET__ request:
+
+     request
+       .get('/search')
+       .end(function(err, res){
+
+       });
+
+A method string may also be passed:
+
+    request('GET', '/search').end(callback);
+
+ES6 promises are supported. *Instead* of `.end()` you can call `.then()`:
+
+    request('GET', '/search').then(success, failure);
+
+The __Node__ client may also provide absolute URLs. In browsers absolute URLs won't work unless the server implements [CORS](#cors).
+
+     request
+       .get('http://example.com/search')
+       .end(function(err, res){
+
+       });
+
+The __Node__ client supports making requests to [Unix Domain Sockets](http://en.wikipedia.org/wiki/Unix_domain_socket):
+
+     // pattern: https?+unix://SOCKET_PATH/REQUEST_PATH
+     //          Use `%2F` as `/` in SOCKET_PATH
+     request
+       .get('http+unix://%2Fabsolute%2Fpath%2Fto%2Funix.sock/search')
+       .end(function(err, res){
+
+       });
+
+__DELETE__, __HEAD__, __PATCH__, __POST__, and __PUT__ requests can also be used, simply change the method name:
+
+    request
+      .head('/favicon.ico')
+      .end(function(err, res){
+
+      });
+
+__DELETE__ can be also called as `.del()` for compatibility with old IE where `delete` is a reserved word.
+
+  The HTTP method defaults to __GET__, so if you wish, the following is valid:
+
+     request('/search', function(err, res){
+
+     });
+
+## Setting header fields
+
+Setting header fields is simple, invoke `.set()` with a field name and value:
+
+     request
+       .get('/search')
+       .set('API-Key', 'foobar')
+       .set('Accept', 'application/json')
+       .end(callback);
+
+You may also pass an object to set several fields in a single call:
+
+     request
+       .get('/search')
+       .set({ 'API-Key': 'foobar', Accept: 'application/json' })
+       .end(callback);
+
+## `GET` requests
+
+The `.query()` method accepts objects, which when used with the __GET__ method will form a query-string. The following will produce the path `/search?query=Manny&range=1..5&order=desc`.
+
+     request
+       .get('/search')
+       .query({ query: 'Manny' })
+       .query({ range: '1..5' })
+       .query({ order: 'desc' })
+       .end(function(err, res){
+
+       });
+
+Or as a single object:
+
+    request
+      .get('/search')
+      .query({ query: 'Manny', range: '1..5', order: 'desc' })
+      .end(function(err, res){
+
+      });
+
+The `.query()` method accepts strings as well:
+
+      request
+        .get('/querystring')
+        .query('search=Manny&range=1..5')
+        .end(function(err, res){
+
+        });
+
+Or joined:
+
+      request
+        .get('/querystring')
+        .query('search=Manny')
+        .query('range=1..5')
+        .end(function(err, res){
+
+        });
+
+## `HEAD` requests
+
+You can also use the `.query()` method for HEAD requests. The following will produce the path `/users?email=joe@smith.com`.
+
+      request
+        .head('/users')
+        .query({ email: 'joe@smith.com' })
+        .end(function(err, res){
+
+        });
+
+## `POST` / `PUT` requests
+
+A typical JSON __POST__ request might look a little like the following, where we set the Content-Type header field appropriately, and "write" some data, in this case just a JSON string.
+
+      request.post('/user')
+        .set('Content-Type', 'application/json')
+        .send('{"name":"tj","pet":"tobi"}')
+        .end(callback)
+
+Since JSON is undoubtedly the most common, it's the _default_! The following example is equivalent to the previous.
+
+      request.post('/user')
+        .send({ name: 'tj', pet: 'tobi' })
+        .end(callback)
+
+Or using multiple `.send()` calls:
+
+      request.post('/user')
+        .send({ name: 'tj' })
+        .send({ pet: 'tobi' })
+        .end(callback)
+
+By default sending strings will set the `Content-Type` to `application/x-www-form-urlencoded`,
+  multiple calls will be concatenated with `&`, here resulting in `name=tj&pet=tobi`:
+
+      request.post('/user')
+        .send('name=tj')
+        .send('pet=tobi')
+        .end(callback);
+
+SuperAgent formats are extensible, however by default "json" and "form" are supported. To send the data as `application/x-www-form-urlencoded` simply invoke `.type()` with "form", where the default is "json". This request will __POST__ the body "name=tj&pet=tobi".
+
+      request.post('/user')
+        .type('form')
+        .send({ name: 'tj' })
+        .send({ pet: 'tobi' })
+        .end(callback)
+
+Sending a [`FormData`](https://developer.mozilla.org/en-US/docs/Web/API/FormData/FormData) object is also supported. The following example will __POST__ the content of the HTML form identified by id="myForm":
+
+      request.post('/user')
+        .send(new FormData(document.getElementById('myForm')))
+        .end(callback)
+
+## Setting the `Content-Type`
+
+The obvious solution is to use the `.set()` method:
+
+     request.post('/user')
+       .set('Content-Type', 'application/json')
+
+As a short-hand the `.type()` method is also available, accepting
+the canonicalized MIME type name complete with type/subtype, or
+simply the extension name such as "xml", "json", "png", etc:
+
+     request.post('/user')
+       .type('application/json')
+
+     request.post('/user')
+       .type('json')
+
+     request.post('/user')
+       .type('png')
+
+## Serializing request body
+
+SuperAgent will automatically serialize JSON and forms. If you want to send the payload in a custom format, you can replace the built-in serialization with `.serialize()` method.
+
+## Retrying requests
+
+When given the `.retry()` method, SuperAgent will automatically retry requests, if they fail in a way that is transient or could be due to a flaky Internet connection.
+
+This method has two optional arguments: number of retries (default 3) and a callback. It calls `callback(err, res)` before each retry. The callback may return `true`/`false` to control whether the request sould be retried (but the maximum number of retries is always applied).
+
+     request
+       .get('http://example.com/search')
+       .retry(2)
+       .end(callback);
+
+Use `.retry()` only with requests that are *idempotent* (i.e. multiple requests reaching the server won't cause undesirable side effects like duplicate purchases).
+
+## Setting Accept
+
+In a similar fashion to the `.type()` method it is also possible to set the `Accept` header via the short hand method `.accept()`. Which references `request.types` as well allowing you to specify either the full canonicalized MIME type name as `type/subtype`, or the extension suffix form as "xml", "json", "png", etc. for convenience:
+
+     request.get('/user')
+       .accept('application/json')
+
+     request.get('/user')
+       .accept('json')
+
+     request.post('/user')
+       .accept('png')
+
+### Facebook and Accept JSON
+
+If you are calling Facebook's API, be sure to send an `Accept: application/json` header in your request. If you don't do this, Facebook will respond with `Content-Type: text/javascript; charset=UTF-8`, which SuperAgent will not parse and thus `res.body` will be undefined. You can do this with either `req.accept('json')` or `req.header('Accept', 'application/json')`. See [issue 1078](https://github.com/visionmedia/superagent/issues/1078) for details.
+
+## Query strings
+
+  `req.query(obj)` is a method which may be used to build up a query-string. For example populating `?format=json&dest=/login` on a __POST__:
+
+    request
+      .post('/')
+      .query({ format: 'json' })
+      .query({ dest: '/login' })
+      .send({ post: 'data', here: 'wahoo' })
+      .end(callback);
+
+By default the query string is not assembled in any particular order. An asciibetically-sorted query string can be enabled with `req.sortQuery()`. You may also provide a custom sorting comparison function with `req.sortQuery(myComparisonFn)`. The comparison function should take 2 arguments and return a negative/zero/positive integer.
+
+```js
+ // default order
+ request.get('/user')
+   .query('name=Nick')
+   .query('search=Manny')
+   .sortQuery()
+   .end(callback)
+
+ // customized sort function
+ request.get('/user')
+   .query('name=Nick')
+   .query('search=Manny')
+   .sortQuery(function(a, b){
+     return a.length - b.length;
+   })
+   .end(callback)
+```
+
+## TLS options
+
+In Node.js SuperAgent supports methods to configure HTTPS requests:
+
+- `.ca()`: Set the CA certificate(s) to trust
+- `.cert()`: Set the client certificate chain(s)
+- `.key()`: Set the client private key(s)
+- `.pfx()`: Set the client PFX or PKCS12 encoded private key and certificate chain
+
+For more information, see Node.js [https.request docs](https://nodejs.org/api/https.html#https_https_request_options_callback).
+
+```js
+var key = fs.readFileSync('key.pem'),
+    cert = fs.readFileSync('cert.pem');
+
+request
+  .post('/client-auth')
+  .key(key)
+  .cert(cert)
+  .end(callback);
+```
+
+```js
+var ca = fs.readFileSync('ca.cert.pem');
+
+request
+  .post('https://localhost/private-ca-server')
+  .ca(ca)
+  .end(callback);
+```
+
+## Parsing response bodies
+
+SuperAgent will parse known response-body data for you, currently supporting `application/x-www-form-urlencoded`, `application/json`, and `multipart/form-data`.
+
+You can set a custom parser (that takes precedence over built-in parsers) with the `.buffer(true).parse(fn)` method. If response buffering is not enabled (`.buffer(false)`) then the `response` event will be emitted without waiting for the body parser to finish, so `response.body` won't be available.
+
+### JSON / Urlencoded
+
+The property `res.body` is the parsed object, for example if a request responded with the JSON string '{"user":{"name":"tobi"}}', `res.body.user.name` would be "tobi". Likewise the x-www-form-urlencoded value of "user[name]=tobi" would yield the same result. Only one level of nesting is supported. If you need more complex data, send JSON instead.
+
+Arrays are sent by repeating the key. `.send({color: ['red','blue']})` sends `color=red&color=blue`. If you want the array keys to contain `[]` in their name, you must add it yourself, as SuperAgent doesn't add it automatically.
+
+### Multipart
+
+The Node client supports _multipart/form-data_ via the [Formidable](https://github.com/felixge/node-formidable) module. When parsing multipart responses, the object `res.files` is also available to you. Suppose for example a request responds with the following multipart body:
+
+    --whoop
+    Content-Disposition: attachment; name="image"; filename="tobi.png"
+    Content-Type: image/png
+
+    ... data here ...
+    --whoop
+    Content-Disposition: form-data; name="name"
+    Content-Type: text/plain
+
+    Tobi
+    --whoop--
+
+You would have the values `res.body.name` provided as "Tobi", and `res.files.image` as a `File` object containing the path on disk, filename, and other properties.
+
+### Binary
+
+In browsers, you may use `.responseType('blob')` to request handling of binary response bodies. This API is unnecessary when running in node.js. The supported argument values for this method are
+
+- `'blob'` passed through to the XmlHTTPRequest `responseType` property
+- `'arraybuffer'` passed through to the XmlHTTPRequest `responseType` property
+
+```js
+req.get('/binary.data')
+  .responseType('blob')
+  .end(function (error, res) {
+    // res.body will be a browser native Blob type here
+  });
+```
+
+For more information, see the Mozilla Developer Network [xhr.responseType docs](https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest/responseType).
+
+## Response properties
+
+Many helpful flags and properties are set on the `Response` object, ranging from the response text, parsed response body, header fields, status flags and more.
+
+### Response text
+
+The `res.text` property contains the unparsed response body string. This property is always present for the client API, and only when the mime type matches "text/*", "*/json", or "x-www-form-urlencoded" by default for node. The reasoning is to conserve memory, as buffering text of large bodies such as multipart files or images is extremely inefficient. To force buffering see the "Buffering responses" section.
+
+### Response body
+
+Much like SuperAgent can auto-serialize request data, it can also automatically parse it. When a parser is defined for the Content-Type, it is parsed, which by default includes "application/json" and "application/x-www-form-urlencoded". The parsed object is then available via `res.body`.
+
+### Response header fields
+
+The `res.header` contains an object of parsed header fields, lowercasing field names much like node does. For example `res.header['content-length']`.
+
+### Response Content-Type
+
+The Content-Type response header is special-cased, providing `res.type`, which is void of the charset (if any). For example the Content-Type of "text/html; charset=utf8" will provide "text/html" as `res.type`, and the `res.charset` property would then contain "utf8".
+
+### Response status
+
+The response status flags help determine if the request was a success, among other useful information, making SuperAgent ideal for interacting with RESTful web services. These flags are currently defined as:
+
+     var type = status / 100 | 0;
+
+     // status / class
+     res.status = status;
+     res.statusType = type;
+
+     // basics
+     res.info = 1 == type;
+     res.ok = 2 == type;
+     res.clientError = 4 == type;
+     res.serverError = 5 == type;
+     res.error = 4 == type || 5 == type;
+
+     // sugar
+     res.accepted = 202 == status;
+     res.noContent = 204 == status || 1223 == status;
+     res.badRequest = 400 == status;
+     res.unauthorized = 401 == status;
+     res.notAcceptable = 406 == status;
+     res.notFound = 404 == status;
+     res.forbidden = 403 == status;
+
+## Aborting requests
+
+To abort requests simply invoke the `req.abort()` method.
+
+## Timeouts
+
+Sometimes networks and servers get "stuck" and never respond after accepting a request. Set timeouts to avoid requests waiting forever.
+
+  * `req.timeout({deadline:ms})` or `req.timeout(ms)` (where `ms` is a number of milliseconds > 0) sets a deadline for the entire request (including all redirects) to complete. If the response isn't fully downloaded within that time, the request will be aborted.
+
+  * `req.timeout({response:ms})` sets maximum time to wait for the first byte to arrive from the server, but it does not limit how long the entire download can take. Response timeout should be a few seconds longer than just the time it takes server to respond, because it also includes time to make DNS lookup, TCP/IP and TLS connections.
+
+You should use both `deadline` and `response` timeouts. This way you can use a short response timeout to detect unresponsive networks quickly, and a long deadline to give time for downloads on slow, but reliable, networks.
+
+    request
+      .get('/big-file?network=slow')
+      .timeout({
+        response: 5000,  // Wait 5 seconds for the server to start sending,
+        deadline: 60000, // but allow 1 minute for the file to finish loading.
+      })
+      .end(function(err, res){
+        if (err.timeout) { /* timed out! */ }
+      });
+
+Timeout errors have a `.timeout` property.
+
+## Authentication
+
+In both Node and browsers auth available via the `.auth()` method:
+
+    request
+      .get('http://local')
+      .auth('tobi', 'learnboost')
+      .end(callback);
+
+
+In the _Node_ client Basic auth can be in the URL as "user:pass":
+
+    request.get('http://tobi:learnboost@local').end(callback);
+
+By default only `Basic` auth is used. In browser you can add `{type:'auto'}` to enable all methods built-in in the browser (Digest, NTLM, etc.):
+
+    request.auth('digest', 'secret', {type:'auto'})
+
+## Following redirects
+
+By default up to 5 redirects will be followed, however you may specify this with the `res.redirects(n)` method:
+
+    request
+      .get('/some.png')
+      .redirects(2)
+      .end(callback);
+
+## Agents for global state
+
+### Saving cookies
+
+In Node SuperAgent does not save cookies by default, but you can use the `.agent()` method to create a copy of SuperAgent that saves cookies. Each copy has a separate cookie jar.
+
+    const agent = request.agent();
+    agent
+      .post('/login')
+      .then(() => {
+        return agent.get('/cookied-page');
+      });
+
+In browsers cookies are managed automatically by the browser, so the `.agent()` does not isolate cookies.
+
+### Default options for multiple requests
+
+Regular request methods (`.use()`, `.set()`, `.auth()`) called on the agent will be used as defaults for all requests made by that agent.
+
+    const agent = request.agent()
+      .use(plugin)
+      .auth(shared);
+
+    await agent.get('/with-plugin-and-auth');
+    await agent.get('/also-with-plugin-and-auth');
+
+## Piping data
+
+The Node client allows you to pipe data to and from the request. For example piping a file's contents as the request:
+
+    const request = require('superagent');
+    const fs = require('fs');
+
+    const stream = fs.createReadStream('path/to/my.json');
+    const req = request.post('/somewhere');
+    req.type('json');
+    stream.pipe(req);
+
+Note that when you pipe to a request, superagent sends the piped data with [chunked transfer encoding](https://en.wikipedia.org/wiki/Chunked_transfer_encoding), which isn't supported by all servers (for instance, Python WSGI servers).
+
+Or piping the response to a file:
+
+    const stream = fs.createWriteStream('path/to/my.json');
+    const req = request.get('/some.json');
+    req.pipe(stream);
+
+## Multipart requests
+
+SuperAgent is also great for _building_ multipart requests for which it provides methods `.attach()` and `.field()`.
+
+When you use `.field()` or `.attach()` you can't use `.send()` and you *must not* set `Content-Type` (the correct type will be set for you).
+
+### Attaching files
+
+To send a file use `.attach(name, [file], [options])`. You can attach multiple files by calling `.attach` multiple times. The arguments are:
+
+ * `name` — filed name in the form.
+ * `file` — either string with file path or `Blob`/`Buffer` object.
+ * `options` — (optional) either string with custom file name or `{filename: string}` object. In Node also `{contentType: 'mime/type'}` is supported. In browser create a `Blob` with an appropriate type instead.
+
+<br>
+
+    request
+      .post('/upload')
+      .attach('image1', 'path/to/felix.jpeg')
+      .attach('image2', imageBuffer, 'luna.jpeg')
+      .field('caption', 'My cats')
+      .end(callback);
+
+### Field values
+
+Much like form fields in HTML, you can set field values with `.field(name, value)` and `.field({name: value})`. Suppose you want to upload a few images with your name and email, your request might look something like this:
+
+     request
+       .post('/upload')
+       .field('user[name]', 'Tobi')
+       .field('user[email]', 'tobi@learnboost.com')
+       .field('friends[]', ['loki', 'jane'])
+       .attach('image', 'path/to/tobi.png')
+       .end(callback);
+
+## Compression
+
+The node client supports compressed responses, best of all, you don't have to do anything! It just works.
+
+## Buffering responses
+
+To force buffering of response bodies as `res.text` you may invoke `req.buffer()`. To undo the default of buffering for text responses such as "text/plain", "text/html" etc you may invoke `req.buffer(false)`.
+
+When buffered the `res.buffered` flag is provided, you may use this to handle both buffered and unbuffered responses in the same callback.
+
+## CORS
+
+For security reasons, browsers will block cross-origin requests unless the server opts-in using CORS headers. Browsers will also make extra __OPTIONS__ requests to check what HTTP headers and methods are allowed by the server. [Read more about CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/Access_control_CORS).
+
+The `.withCredentials()` method enables the ability to send cookies from the origin, however only when `Access-Control-Allow-Origin` is _not_ a wildcard ("*"), and `Access-Control-Allow-Credentials` is "true".
+
+    request
+      .get('http://api.example.com:4001/')
+      .withCredentials()
+      .then(function(res){
+        assert.equal(200, res.status);
+        assert.equal('tobi', res.text);
+      })
+
+## Error handling
+
+Your callback function will always be passed two arguments: error and response. If no error occurred, the first argument will be null:
+
+    request
+     .post('/upload')
+     .attach('image', 'path/to/tobi.png')
+     .end(function(err, res){
+
+     });
+
+An "error" event is also emitted, with you can listen for:
+
+    request
+      .post('/upload')
+      .attach('image', 'path/to/tobi.png')
+      .on('error', handle)
+      .end(function(err, res){
+
+      });
+
+Note that **superagent considers 4xx and 5xx responses (as well as unhandled 3xx responses) errors by default**. For example, if you get a `304 Not modified`, `403 Forbidden` or `500 Internal server error` response, this status information will be available via `err.status`. Errors from such responses also contain an `err.response` field with all of the properties mentioned in "[Response properties](#response-properties)". The library behaves in this way to handle the common case of wanting success responses and treating HTTP error status codes as errors while still allowing for custom logic around specific error conditions.
+
+Network failures, timeouts, and other errors that produce no response will contain no `err.status` or `err.response` fields.
+
+If you wish to handle 404 or other HTTP error responses, you can query the `err.status` property. When an HTTP error occurs (4xx or 5xx response) the `res.error` property is an `Error` object, this allows you to perform checks such as:
+
+    if (err && err.status === 404) {
+      alert('oh no ' + res.body.message);
+    }
+    else if (err) {
+      // all other error types we handle generically
+    }
+
+Alternatively, you can use the `.ok(callback)` method to decide whether a response is an error or not. The callback to the `ok` function gets a response and returns `true` if the response should be interpreted as success.
+
+    request.get('/404')
+      .ok(res => res.status < 500)
+      .then(response => {
+        // reads 404 page as a successful response
+      })
+
+## Progress tracking
+
+SuperAgent fires `progress` events on upload and download of large files.
+
+    request.post(url)
+      .attach('field_name', file)
+      .on('progress', event => {
+        /* the event is:
+        {
+          direction: "upload" or "download"
+          percent: 0 to 100 // may be missing if file size is unknown
+          total: // total file size, may be missing
+          loaded: // bytes downloaded or uploaded so far
+        } */
+      })
+      .end()
+
+## Promise and Generator support
+
+SuperAgent's request is a "thenable" object that's compatible with JavaScript promises and `async`/`await` syntax. Do not call `.end()` if you're using promises.
+
+Libraries like [co](https://github.com/tj/co) or a web framework like [koa](https://github.com/koajs/koa) can `yield` on any SuperAgent method:
+
+    const req = request
+      .get('http://local')
+      .auth('tobi', 'learnboost');
+    const res = yield req;
+
+Note that SuperAgent expects the global `Promise` object to be present. You'll need a polyfill to use promises in Internet Explorer or Node.js 0.10.
+
+## Browser and node versions
+
+SuperAgent has two implementations: one for web browsers (using XHR) and one for Node.JS (using core http module). By default Browserify and WebPack will pick the browser version.
+
+If want to use WebPack to compile code for Node.JS, you *must* specify [node target](https://webpack.github.io/docs/configuration.html#target) in its configuration.
+
+### Using browser version in electron
+
+[Electron](http://electron.atom.io/) developers report if you would prefer to use the browser version of SuperAgent instead of the Node version, you can `require('superagent/superagent')`. Your requests will now show up in the Chrome developer tools Network tab. Note this environment is not covered by automated test suite and not officially supported.

goTorrentWebUI/node_modules/superagent/docs/style.css

@@ -0,0 +1,87 @@
+body {
+  padding: 40px 80px;
+  font: 14px/1.5 "Helvetica Neue", Helvetica, sans-serif;
+  background: #181818 url(images/bg.png);
+  text-align: center;
+}
+
+#content {
+  margin: 0 auto;
+  padding: 10px 40px;
+  text-align: left;
+  background: white;
+  width: 50%;
+  -webkit-border-radius: 2px;
+  -moz-border-radius: 2px;
+  border-radius: 2px;
+  -webkit-box-shadow: 0 2px 5px 0 black;
+}
+
+#menu {
+  font-size: 13px;
+  margin: 0;
+  padding: 0;
+  text-align: left;
+  position: fixed;
+  top: 15px;
+  left: 15px;
+}
+
+#menu ul {
+  margin: 0;
+  padding: 0;
+}
+
+#menu li {
+  list-style: none;
+}
+
+#menu a {
+  color: rgba(255,255,255,.5);
+  text-decoration: none;
+}
+
+#menu a:hover {
+  color: white;
+}
+
+#menu .active a {
+  color: white;
+}
+
+pre {
+  padding: 10px;
+}
+
+code {
+  font-family: monaco, monospace, sans-serif;
+  font-size: 0.85em;
+}
+
+p code {
+  border: 1px solid #ECEA75;
+  padding: 1px 3px;
+  -webkit-border-radius: 2px;
+  -moz-border-radius: 2px;
+  border-radius: 2px;
+  background: #FDFCD1;
+}
+
+pre {
+  padding: 20px 25px;
+  border: 1px solid #ddd;
+  -webkit-box-shadow: inset 0 0 5px #eee;
+  -moz-box-shadow: inset 0 0 5px #eee;
+  box-shadow: inset 0 0 5px #eee;
+}
+
+code .comment { color: #ddd }
+code .init { color: #2F6FAD }
+code .string { color: #5890AD }
+code .keyword { color: #8A6343 }
+code .number { color: #2F6FAD }
+
+/* override tocbot style to avoid vertical white line in table of content */
+.toc-link::before {
+  content: initial;
+}

goTorrentWebUI/node_modules/superagent/docs/tail.html

@@ -0,0 +1,36 @@
+    </div>
+    <a href="http://github.com/visionmedia/superagent"><img style="position: absolute; top: 0; right: 0; border: 0;" src="https://s3.amazonaws.com/github/ribbons/forkme_right_white_ffffff.png" alt="Fork me on GitHub"></a>
+    <script src="https://cdnjs.cloudflare.com/ajax/libs/jquery/3.2.1/jquery.min.js"></script>
+    <script>
+      $('code').each(function(){
+        $(this).html(highlight($(this).text()));
+      });
+
+      function highlight(js) {
+        return js
+          .replace(/</g, '&lt;')
+          .replace(/>/g, '&gt;')
+          .replace(/('.*?')/gm, '<span class="string">$1</span>')
+          .replace(/(\d+\.\d+)/gm, '<span class="number">$1</span>')
+          .replace(/(\d+)/gm, '<span class="number">$1</span>')
+          .replace(/\bnew *(\w+)/gm, '<span class="keyword">new</span> <span class="init">$1</span>')
+          .replace(/\b(function|new|throw|return|var|if|else)\b/gm, '<span class="keyword">$1</span>')
+      }
+    </script>
+    <script src="https://cdnjs.cloudflare.com/ajax/libs/tocbot/3.0.0/tocbot.js"></script>
+    <script>
+      // Only use tocbot for main docs, not test docs
+      if (document.querySelector('#superagent')) {
+        tocbot.init({
+          // Where to render the table of contents.
+          tocSelector: '#menu',
+          // Where to grab the headings to build the table of contents.
+          contentSelector: '#content',
+          // Which headings to grab inside of the contentSelector element.
+          headingSelector: 'h2',
+          smoothScroll: false
+        });
+      }
+    </script>
+  </body>
+</html>

goTorrentWebUI/node_modules/superagent/lib/agent-base.js

@@ -0,0 +1,20 @@
+function Agent() {
+  this._defaults = [];
+}
+
+["use", "on", "once", "set", "query", "type", "accept", "auth", "withCredentials", "sortQuery", "retry", "ok", "redirects",
+ "timeout", "buffer", "serialize", "parse", "ca", "key", "pfx", "cert"].forEach(function(fn) {
+  /** Default setting for all requests from this agent */
+  Agent.prototype[fn] = function(/*varargs*/) {
+    this._defaults.push({fn:fn, arguments:arguments});
+    return this;
+  }
+});
+
+Agent.prototype._setDefaults = function(req) {
+    this._defaults.forEach(function(def) {
+      req[def.fn].apply(req, def.arguments);
+    });
+};
+
+module.exports = Agent;

goTorrentWebUI/node_modules/superagent/lib/client.js

@@ -0,0 +1,918 @@
+/**
+ * Root reference for iframes.
+ */
+
+var root;
+if (typeof window !== 'undefined') { // Browser window
+  root = window;
+} else if (typeof self !== 'undefined') { // Web Worker
+  root = self;
+} else { // Other environments
+  console.warn("Using browser-only version of superagent in non-browser environment");
+  root = this;
+}
+
+var Emitter = require('component-emitter');
+var RequestBase = require('./request-base');
+var isObject = require('./is-object');
+var ResponseBase = require('./response-base');
+var Agent = require('./agent-base');
+
+/**
+ * Noop.
+ */
+
+function noop(){};
+
+/**
+ * Expose `request`.
+ */
+
+var request = exports = module.exports = function(method, url) {
+  // callback
+  if ('function' == typeof url) {
+    return new exports.Request('GET', method).end(url);
+  }
+
+  // url first
+  if (1 == arguments.length) {
+    return new exports.Request('GET', method);
+  }
+
+  return new exports.Request(method, url);
+}
+
+exports.Request = Request;
+
+/**
+ * Determine XHR.
+ */
+
+request.getXHR = function () {
+  if (root.XMLHttpRequest
+      && (!root.location || 'file:' != root.location.protocol
+          || !root.ActiveXObject)) {
+    return new XMLHttpRequest;
+  } else {
+    try { return new ActiveXObject('Microsoft.XMLHTTP'); } catch(e) {}
+    try { return new ActiveXObject('Msxml2.XMLHTTP.6.0'); } catch(e) {}
+    try { return new ActiveXObject('Msxml2.XMLHTTP.3.0'); } catch(e) {}
+    try { return new ActiveXObject('Msxml2.XMLHTTP'); } catch(e) {}
+  }
+  throw Error("Browser-only version of superagent could not find XHR");
+};
+
+/**
+ * Removes leading and trailing whitespace, added to support IE.
+ *
+ * @param {String} s
+ * @return {String}
+ * @api private
+ */
+
+var trim = ''.trim
+  ? function(s) { return s.trim(); }
+  : function(s) { return s.replace(/(^\s*|\s*$)/g, ''); };
+
+/**
+ * Serialize the given `obj`.
+ *
+ * @param {Object} obj
+ * @return {String}
+ * @api private
+ */
+
+function serialize(obj) {
+  if (!isObject(obj)) return obj;
+  var pairs = [];
+  for (var key in obj) {
+    pushEncodedKeyValuePair(pairs, key, obj[key]);
+  }
+  return pairs.join('&');
+}
+
+/**
+ * Helps 'serialize' with serializing arrays.
+ * Mutates the pairs array.
+ *
+ * @param {Array} pairs
+ * @param {String} key
+ * @param {Mixed} val
+ */
+
+function pushEncodedKeyValuePair(pairs, key, val) {
+  if (val != null) {
+    if (Array.isArray(val)) {
+      val.forEach(function(v) {
+        pushEncodedKeyValuePair(pairs, key, v);
+      });
+    } else if (isObject(val)) {
+      for(var subkey in val) {
+        pushEncodedKeyValuePair(pairs, key + '[' + subkey + ']', val[subkey]);
+      }
+    } else {
+      pairs.push(encodeURIComponent(key)
+        + '=' + encodeURIComponent(val));
+    }
+  } else if (val === null) {
+    pairs.push(encodeURIComponent(key));
+  }
+}
+
+/**
+ * Expose serialization method.
+ */
+
+request.serializeObject = serialize;
+
+/**
+  * Parse the given x-www-form-urlencoded `str`.
+  *
+  * @param {String} str
+  * @return {Object}
+  * @api private
+  */
+
+function parseString(str) {
+  var obj = {};
+  var pairs = str.split('&');
+  var pair;
+  var pos;
+
+  for (var i = 0, len = pairs.length; i < len; ++i) {
+    pair = pairs[i];
+    pos = pair.indexOf('=');
+    if (pos == -1) {
+      obj[decodeURIComponent(pair)] = '';
+    } else {
+      obj[decodeURIComponent(pair.slice(0, pos))] =
+        decodeURIComponent(pair.slice(pos + 1));
+    }
+  }
+
+  return obj;
+}
+
+/**
+ * Expose parser.
+ */
+
+request.parseString = parseString;
+
+/**
+ * Default MIME type map.
+ *
+ *     superagent.types.xml = 'application/xml';
+ *
+ */
+
+request.types = {
+  html: 'text/html',
+  json: 'application/json',
+  xml: 'text/xml',
+  urlencoded: 'application/x-www-form-urlencoded',
+  'form': 'application/x-www-form-urlencoded',
+  'form-data': 'application/x-www-form-urlencoded'
+};
+
+/**
+ * Default serialization map.
+ *
+ *     superagent.serialize['application/xml'] = function(obj){
+ *       return 'generated xml here';
+ *     };
+ *
+ */
+
+request.serialize = {
+  'application/x-www-form-urlencoded': serialize,
+  'application/json': JSON.stringify,
+};
+
+/**
+  * Default parsers.
+  *
+  *     superagent.parse['application/xml'] = function(str){
+  *       return { object parsed from str };
+  *     };
+  *
+  */
+
+request.parse = {
+  'application/x-www-form-urlencoded': parseString,
+  'application/json': JSON.parse,
+};
+
+/**
+ * Parse the given header `str` into
+ * an object containing the mapped fields.
+ *
+ * @param {String} str
+ * @return {Object}
+ * @api private
+ */
+
+function parseHeader(str) {
+  var lines = str.split(/\r?\n/);
+  var fields = {};
+  var index;
+  var line;
+  var field;
+  var val;
+
+  for (var i = 0, len = lines.length; i < len; ++i) {
+    line = lines[i];
+    index = line.indexOf(':');
+    if (index === -1) { // could be empty line, just skip it
+      continue;
+    }
+    field = line.slice(0, index).toLowerCase();
+    val = trim(line.slice(index + 1));
+    fields[field] = val;
+  }
+
+  return fields;
+}
+
+/**
+ * Check if `mime` is json or has +json structured syntax suffix.
+ *
+ * @param {String} mime
+ * @return {Boolean}
+ * @api private
+ */
+
+function isJSON(mime) {
+  return /[\/+]json\b/.test(mime);
+}
+
+/**
+ * Initialize a new `Response` with the given `xhr`.
+ *
+ *  - set flags (.ok, .error, etc)
+ *  - parse header
+ *
+ * Examples:
+ *
+ *  Aliasing `superagent` as `request` is nice:
+ *
+ *      request = superagent;
+ *
+ *  We can use the promise-like API, or pass callbacks:
+ *
+ *      request.get('/').end(function(res){});
+ *      request.get('/', function(res){});
+ *
+ *  Sending data can be chained:
+ *
+ *      request
+ *        .post('/user')
+ *        .send({ name: 'tj' })
+ *        .end(function(res){});
+ *
+ *  Or passed to `.send()`:
+ *
+ *      request
+ *        .post('/user')
+ *        .send({ name: 'tj' }, function(res){});
+ *
+ *  Or passed to `.post()`:
+ *
+ *      request
+ *        .post('/user', { name: 'tj' })
+ *        .end(function(res){});
+ *
+ * Or further reduced to a single call for simple cases:
+ *
+ *      request
+ *        .post('/user', { name: 'tj' }, function(res){});
+ *
+ * @param {XMLHTTPRequest} xhr
+ * @param {Object} options
+ * @api private
+ */
+
+function Response(req) {
+  this.req = req;
+  this.xhr = this.req.xhr;
+  // responseText is accessible only if responseType is '' or 'text' and on older browsers
+  this.text = ((this.req.method !='HEAD' && (this.xhr.responseType === '' || this.xhr.responseType === 'text')) || typeof this.xhr.responseType === 'undefined')
+     ? this.xhr.responseText
+     : null;
+  this.statusText = this.req.xhr.statusText;
+  var status = this.xhr.status;
+  // handle IE9 bug: http://stackoverflow.com/questions/10046972/msie-returns-status-code-of-1223-for-ajax-request
+  if (status === 1223) {
+    status = 204;
+  }
+  this._setStatusProperties(status);
+  this.header = this.headers = parseHeader(this.xhr.getAllResponseHeaders());
+  // getAllResponseHeaders sometimes falsely returns "" for CORS requests, but
+  // getResponseHeader still works. so we get content-type even if getting
+  // other headers fails.
+  this.header['content-type'] = this.xhr.getResponseHeader('content-type');
+  this._setHeaderProperties(this.header);
+
+  if (null === this.text && req._responseType) {
+    this.body = this.xhr.response;
+  } else {
+    this.body = this.req.method != 'HEAD'
+      ? this._parseBody(this.text ? this.text : this.xhr.response)
+      : null;
+  }
+}
+
+ResponseBase(Response.prototype);
+
+/**
+ * Parse the given body `str`.
+ *
+ * Used for auto-parsing of bodies. Parsers
+ * are defined on the `superagent.parse` object.
+ *
+ * @param {String} str
+ * @return {Mixed}
+ * @api private
+ */
+
+Response.prototype._parseBody = function(str) {
+  var parse = request.parse[this.type];
+  if (this.req._parser) {
+    return this.req._parser(this, str);
+  }
+  if (!parse && isJSON(this.type)) {
+    parse = request.parse['application/json'];
+  }
+  return parse && str && (str.length || str instanceof Object)
+    ? parse(str)
+    : null;
+};
+
+/**
+ * Return an `Error` representative of this response.
+ *
+ * @return {Error}
+ * @api public
+ */
+
+Response.prototype.toError = function(){
+  var req = this.req;
+  var method = req.method;
+  var url = req.url;
+
+  var msg = 'cannot ' + method + ' ' + url + ' (' + this.status + ')';
+  var err = new Error(msg);
+  err.status = this.status;
+  err.method = method;
+  err.url = url;
+
+  return err;
+};
+
+/**
+ * Expose `Response`.
+ */
+
+request.Response = Response;
+
+/**
+ * Initialize a new `Request` with the given `method` and `url`.
+ *
+ * @param {String} method
+ * @param {String} url
+ * @api public
+ */
+
+function Request(method, url) {
+  var self = this;
+  this._query = this._query || [];
+  this.method = method;
+  this.url = url;
+  this.header = {}; // preserves header name case
+  this._header = {}; // coerces header names to lowercase
+  this.on('end', function(){
+    var err = null;
+    var res = null;
+
+    try {
+      res = new Response(self);
+    } catch(e) {
+      err = new Error('Parser is unable to parse the response');
+      err.parse = true;
+      err.original = e;
+      // issue #675: return the raw response if the response parsing fails
+      if (self.xhr) {
+        // ie9 doesn't have 'response' property
+        err.rawResponse = typeof self.xhr.responseType == 'undefined' ? self.xhr.responseText : self.xhr.response;
+        // issue #876: return the http status code if the response parsing fails
+        err.status = self.xhr.status ? self.xhr.status : null;
+        err.statusCode = err.status; // backwards-compat only
+      } else {
+        err.rawResponse = null;
+        err.status = null;
+      }
+
+      return self.callback(err);
+    }
+
+    self.emit('response', res);
+
+    var new_err;
+    try {
+      if (!self._isResponseOK(res)) {
+        new_err = new Error(res.statusText || 'Unsuccessful HTTP response');
+      }
+    } catch(custom_err) {
+      new_err = custom_err; // ok() callback can throw
+    }
+
+    // #1000 don't catch errors from the callback to avoid double calling it
+    if (new_err) {
+      new_err.original = err;
+      new_err.response = res;
+      new_err.status = res.status;
+      self.callback(new_err, res);
+    } else {
+      self.callback(null, res);
+    }
+  });
+}
+
+/**
+ * Mixin `Emitter` and `RequestBase`.
+ */
+
+Emitter(Request.prototype);
+RequestBase(Request.prototype);
+
+/**
+ * Set Content-Type to `type`, mapping values from `request.types`.
+ *
+ * Examples:
+ *
+ *      superagent.types.xml = 'application/xml';
+ *
+ *      request.post('/')
+ *        .type('xml')
+ *        .send(xmlstring)
+ *        .end(callback);
+ *
+ *      request.post('/')
+ *        .type('application/xml')
+ *        .send(xmlstring)
+ *        .end(callback);
+ *
+ * @param {String} type
+ * @return {Request} for chaining
+ * @api public
+ */
+
+Request.prototype.type = function(type){
+  this.set('Content-Type', request.types[type] || type);
+  return this;
+};
+
+/**
+ * Set Accept to `type`, mapping values from `request.types`.
+ *
+ * Examples:
+ *
+ *      superagent.types.json = 'application/json';
+ *
+ *      request.get('/agent')
+ *        .accept('json')
+ *        .end(callback);
+ *
+ *      request.get('/agent')
+ *        .accept('application/json')
+ *        .end(callback);
+ *
+ * @param {String} accept
+ * @return {Request} for chaining
+ * @api public
+ */
+
+Request.prototype.accept = function(type){
+  this.set('Accept', request.types[type] || type);
+  return this;
+};
+
+/**
+ * Set Authorization field value with `user` and `pass`.
+ *
+ * @param {String} user
+ * @param {String} [pass] optional in case of using 'bearer' as type
+ * @param {Object} options with 'type' property 'auto', 'basic' or 'bearer' (default 'basic')
+ * @return {Request} for chaining
+ * @api public
+ */
+
+Request.prototype.auth = function(user, pass, options){
+  if (1 === arguments.length) pass = '';
+  if (typeof pass === 'object' && pass !== null) { // pass is optional and can be replaced with options
+    options = pass;
+    pass = '';
+  }
+  if (!options) {
+    options = {
+      type: 'function' === typeof btoa ? 'basic' : 'auto',
+    };
+  }
+
+  var encoder = function(string) {
+    if ('function' === typeof btoa) {
+      return btoa(string);
+    }
+    throw new Error('Cannot use basic auth, btoa is not a function');
+  };
+
+  return this._auth(user, pass, options, encoder);
+};
+
+/**
+ * Add query-string `val`.
+ *
+ * Examples:
+ *
+ *   request.get('/shoes')
+ *     .query('size=10')
+ *     .query({ color: 'blue' })
+ *
+ * @param {Object|String} val
+ * @return {Request} for chaining
+ * @api public
+ */
+
+Request.prototype.query = function(val){
+  if ('string' != typeof val) val = serialize(val);
+  if (val) this._query.push(val);
+  return this;
+};
+
+/**
+ * Queue the given `file` as an attachment to the specified `field`,
+ * with optional `options` (or filename).
+ *
+ * ``` js
+ * request.post('/upload')
+ *   .attach('content', new Blob(['<a id="a"><b id="b">hey!</b></a>'], { type: "text/html"}))
+ *   .end(callback);
+ * ```
+ *
+ * @param {String} field
+ * @param {Blob|File} file
+ * @param {String|Object} options
+ * @return {Request} for chaining
+ * @api public
+ */
+
+Request.prototype.attach = function(field, file, options){
+  if (file) {
+    if (this._data) {
+      throw Error("superagent can't mix .send() and .attach()");
+    }
+
+    this._getFormData().append(field, file, options || file.name);
+  }
+  return this;
+};
+
+Request.prototype._getFormData = function(){
+  if (!this._formData) {
+    this._formData = new root.FormData();
+  }
+  return this._formData;
+};
+
+/**
+ * Invoke the callback with `err` and `res`
+ * and handle arity check.
+ *
+ * @param {Error} err
+ * @param {Response} res
+ * @api private
+ */
+
+Request.prototype.callback = function(err, res){
+  if (this._shouldRetry(err, res)) {
+    return this._retry();
+  }
+
+  var fn = this._callback;
+  this.clearTimeout();
+
+  if (err) {
+    if (this._maxRetries) err.retries = this._retries - 1;
+    this.emit('error', err);
+  }
+
+  fn(err, res);
+};
+
+/**
+ * Invoke callback with x-domain error.
+ *
+ * @api private
+ */
+
+Request.prototype.crossDomainError = function(){
+  var err = new Error('Request has been terminated\nPossible causes: the network is offline, Origin is not allowed by Access-Control-Allow-Origin, the page is being unloaded, etc.');
+  err.crossDomain = true;
+
+  err.status = this.status;
+  err.method = this.method;
+  err.url = this.url;
+
+  this.callback(err);
+};
+
+// This only warns, because the request is still likely to work
+Request.prototype.buffer = Request.prototype.ca = Request.prototype.agent = function(){
+  console.warn("This is not supported in browser version of superagent");
+  return this;
+};
+
+// This throws, because it can't send/receive data as expected
+Request.prototype.pipe = Request.prototype.write = function(){
+  throw Error("Streaming is not supported in browser version of superagent");
+};
+
+/**
+ * Check if `obj` is a host object,
+ * we don't want to serialize these :)
+ *
+ * @param {Object} obj
+ * @return {Boolean}
+ * @api private
+ */
+Request.prototype._isHost = function _isHost(obj) {
+  // Native objects stringify to [object File], [object Blob], [object FormData], etc.
+  return obj && 'object' === typeof obj && !Array.isArray(obj) && Object.prototype.toString.call(obj) !== '[object Object]';
+}
+
+/**
+ * Initiate request, invoking callback `fn(res)`
+ * with an instanceof `Response`.
+ *
+ * @param {Function} fn
+ * @return {Request} for chaining
+ * @api public
+ */
+
+Request.prototype.end = function(fn){
+  if (this._endCalled) {
+    console.warn("Warning: .end() was called twice. This is not supported in superagent");
+  }
+  this._endCalled = true;
+
+  // store callback
+  this._callback = fn || noop;
+
+  // querystring
+  this._finalizeQueryString();
+
+  return this._end();
+};
+
+Request.prototype._end = function() {
+  var self = this;
+  var xhr = (this.xhr = request.getXHR());
+  var data = this._formData || this._data;
+
+  this._setTimeouts();
+
+  // state change
+  xhr.onreadystatechange = function(){
+    var readyState = xhr.readyState;
+    if (readyState >= 2 && self._responseTimeoutTimer) {
+      clearTimeout(self._responseTimeoutTimer);
+    }
+    if (4 != readyState) {
+      return;
+    }
+
+    // In IE9, reads to any property (e.g. status) off of an aborted XHR will
+    // result in the error "Could not complete the operation due to error c00c023f"
+    var status;
+    try { status = xhr.status } catch(e) { status = 0; }
+
+    if (!status) {
+      if (self.timedout || self._aborted) return;
+      return self.crossDomainError();
+    }
+    self.emit('end');
+  };
+
+  // progress
+  var handleProgress = function(direction, e) {
+    if (e.total > 0) {
+      e.percent = e.loaded / e.total * 100;
+    }
+    e.direction = direction;
+    self.emit('progress', e);
+  };
+  if (this.hasListeners('progress')) {
+    try {
+      xhr.onprogress = handleProgress.bind(null, 'download');
+      if (xhr.upload) {
+        xhr.upload.onprogress = handleProgress.bind(null, 'upload');
+      }
+    } catch(e) {
+      // Accessing xhr.upload fails in IE from a web worker, so just pretend it doesn't exist.
+      // Reported here:
+      // https://connect.microsoft.com/IE/feedback/details/837245/xmlhttprequest-upload-throws-invalid-argument-when-used-from-web-worker-context
+    }
+  }
+
+  // initiate request
+  try {
+    if (this.username && this.password) {
+      xhr.open(this.method, this.url, true, this.username, this.password);
+    } else {
+      xhr.open(this.method, this.url, true);
+    }
+  } catch (err) {
+    // see #1149
+    return this.callback(err);
+  }
+
+  // CORS
+  if (this._withCredentials) xhr.withCredentials = true;
+
+  // body
+  if (!this._formData && 'GET' != this.method && 'HEAD' != this.method && 'string' != typeof data && !this._isHost(data)) {
+    // serialize stuff
+    var contentType = this._header['content-type'];
+    var serialize = this._serializer || request.serialize[contentType ? contentType.split(';')[0] : ''];
+    if (!serialize && isJSON(contentType)) {
+      serialize = request.serialize['application/json'];
+    }
+    if (serialize) data = serialize(data);
+  }
+
+  // set header fields
+  for (var field in this.header) {
+    if (null == this.header[field]) continue;
+
+    if (this.header.hasOwnProperty(field))
+      xhr.setRequestHeader(field, this.header[field]);
+  }
+
+  if (this._responseType) {
+    xhr.responseType = this._responseType;
+  }
+
+  // send stuff
+  this.emit('request', this);
+
+  // IE11 xhr.send(undefined) sends 'undefined' string as POST payload (instead of nothing)
+  // We need null here if data is undefined
+  xhr.send(typeof data !== 'undefined' ? data : null);
+  return this;
+};
+
+request.agent = function() {
+  return new Agent();
+};
+
+["GET", "POST", "OPTIONS", "PATCH", "PUT", "DELETE"].forEach(function(method) {
+  Agent.prototype[method.toLowerCase()] = function(url, fn) {
+    var req = new request.Request(method, url);
+    this._setDefaults(req);
+    if (fn) {
+      req.end(fn);
+    }
+    return req;
+  };
+});
+
+Agent.prototype.del = Agent.prototype['delete'];
+
+/**
+ * GET `url` with optional callback `fn(res)`.
+ *
+ * @param {String} url
+ * @param {Mixed|Function} [data] or fn
+ * @param {Function} [fn]
+ * @return {Request}
+ * @api public
+ */
+
+request.get = function(url, data, fn) {
+  var req = request('GET', url);
+  if ('function' == typeof data) (fn = data), (data = null);
+  if (data) req.query(data);
+  if (fn) req.end(fn);
+  return req;
+};
+
+/**
+ * HEAD `url` with optional callback `fn(res)`.
+ *
+ * @param {String} url
+ * @param {Mixed|Function} [data] or fn
+ * @param {Function} [fn]
+ * @return {Request}
+ * @api public
+ */
+
+request.head = function(url, data, fn) {
+  var req = request('HEAD', url);
+  if ('function' == typeof data) (fn = data), (data = null);
+  if (data) req.query(data);
+  if (fn) req.end(fn);
+  return req;
+};
+
+/**
+ * OPTIONS query to `url` with optional callback `fn(res)`.
+ *
+ * @param {String} url
+ * @param {Mixed|Function} [data] or fn
+ * @param {Function} [fn]
+ * @return {Request}
+ * @api public
+ */
+
+request.options = function(url, data, fn) {
+  var req = request('OPTIONS', url);
+  if ('function' == typeof data) (fn = data), (data = null);
+  if (data) req.send(data);
+  if (fn) req.end(fn);
+  return req;
+};
+
+/**
+ * DELETE `url` with optional `data` and callback `fn(res)`.
+ *
+ * @param {String} url
+ * @param {Mixed} [data]
+ * @param {Function} [fn]
+ * @return {Request}
+ * @api public
+ */
+
+function del(url, data, fn) {
+  var req = request('DELETE', url);
+  if ('function' == typeof data) (fn = data), (data = null);
+  if (data) req.send(data);
+  if (fn) req.end(fn);
+  return req;
+}
+
+request['del'] = del;
+request['delete'] = del;
+
+/**
+ * PATCH `url` with optional `data` and callback `fn(res)`.
+ *
+ * @param {String} url
+ * @param {Mixed} [data]
+ * @param {Function} [fn]
+ * @return {Request}
+ * @api public
+ */
+
+request.patch = function(url, data, fn) {
+  var req = request('PATCH', url);
+  if ('function' == typeof data) (fn = data), (data = null);
+  if (data) req.send(data);
+  if (fn) req.end(fn);
+  return req;
+};
+
+/**
+ * POST `url` with optional `data` and callback `fn(res)`.
+ *
+ * @param {String} url
+ * @param {Mixed} [data]
+ * @param {Function} [fn]
+ * @return {Request}
+ * @api public
+ */
+
+request.post = function(url, data, fn) {
+  var req = request('POST', url);
+  if ('function' == typeof data) (fn = data), (data = null);
+  if (data) req.send(data);
+  if (fn) req.end(fn);
+  return req;
+};
+
+/**
+ * PUT `url` with optional `data` and callback `fn(res)`.
+ *
+ * @param {String} url
+ * @param {Mixed|Function} [data] or fn
+ * @param {Function} [fn]
+ * @return {Request}
+ * @api public
+ */
+
+request.put = function(url, data, fn) {
+  var req = request('PUT', url);
+  if ('function' == typeof data) (fn = data), (data = null);
+  if (data) req.send(data);
+  if (fn) req.end(fn);
+  return req;
+};

goTorrentWebUI/node_modules/superagent/lib/is-object.js

@@ -0,0 +1,15 @@
+'use strict';
+
+/**
+ * Check if `obj` is an object.
+ *
+ * @param {Object} obj
+ * @return {Boolean}
+ * @api private
+ */
+
+function isObject(obj) {
+  return null !== obj && 'object' === typeof obj;
+}
+
+module.exports = isObject;

goTorrentWebUI/node_modules/superagent/lib/node/agent.js

@@ -0,0 +1,92 @@
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+
+const CookieJar = require('cookiejar').CookieJar;
+const CookieAccess = require('cookiejar').CookieAccessInfo;
+const parse = require('url').parse;
+const request = require('../..');
+const AgentBase = require('../agent-base');
+let methods = require('methods');
+
+/**
+ * Expose `Agent`.
+ */
+
+module.exports = Agent;
+
+/**
+ * Initialize a new `Agent`.
+ *
+ * @api public
+ */
+
+function Agent(options) {
+  if (!(this instanceof Agent)) {
+    return new Agent(options);
+  }
+  AgentBase.call(this);
+  this.jar = new CookieJar();
+
+  if (options) {
+    if (options.ca) {this.ca(options.ca);}
+    if (options.key) {this.key(options.key);}
+    if (options.pfx) {this.pfx(options.pfx);}
+    if (options.cert) {this.cert(options.cert);}
+  }
+}
+
+Agent.prototype = Object.create(AgentBase.prototype);
+
+/**
+ * Save the cookies in the given `res` to
+ * the agent's cookie jar for persistence.
+ *
+ * @param {Response} res
+ * @api private
+ */
+
+Agent.prototype._saveCookies = function(res) {
+  const cookies = res.headers['set-cookie'];
+  if (cookies) this.jar.setCookies(cookies);
+};
+
+/**
+ * Attach cookies when available to the given `req`.
+ *
+ * @param {Request} req
+ * @api private
+ */
+
+Agent.prototype._attachCookies = function(req) {
+  const url = parse(req.url);
+  const access = CookieAccess(
+    url.hostname,
+    url.pathname,
+    'https:' == url.protocol
+  );
+  const cookies = this.jar.getCookies(access).toValueString();
+  req.cookies = cookies;
+};
+
+methods.forEach(name => {
+  const method = name.toUpperCase();
+  Agent.prototype[name] = function(url, fn) {
+    const req = new request.Request(method, url);
+
+    req.on('response', this._saveCookies.bind(this));
+    req.on('redirect', this._saveCookies.bind(this));
+    req.on('redirect', this._attachCookies.bind(this, req));
+    this._attachCookies(req);
+    this._setDefaults(req);
+
+    if (fn) {
+      req.end(fn);
+    }
+    return req;
+  };
+});
+
+Agent.prototype.del = Agent.prototype['delete'];

goTorrentWebUI/node_modules/superagent/lib/node/parsers/image.js

@@ -0,0 +1,12 @@
+'use strict';
+
+module.exports = (res, fn) => {
+  const data = []; // Binary data needs binary storage
+
+  res.on('data', chunk => {
+    data.push(chunk);
+  });
+  res.on('end', () => {
+    fn(null, Buffer.concat(data));
+  });
+};

goTorrentWebUI/node_modules/superagent/lib/node/parsers/index.js

@@ -0,0 +1,10 @@
+'use strict';
+
+exports['application/x-www-form-urlencoded'] = require('./urlencoded');
+exports['application/json'] = require('./json');
+exports.text = require('./text');
+
+const binary = require('./image');
+exports['application/octet-stream'] = binary;
+exports['application/pdf'] = binary;
+exports.image = binary;

goTorrentWebUI/node_modules/superagent/lib/node/parsers/json.js

@@ -0,0 +1,22 @@
+'use strict';
+
+module.exports = function parseJSON(res, fn){
+  res.text = '';
+  res.setEncoding('utf8');
+  res.on('data', chunk => {
+    res.text += chunk;
+  });
+  res.on('end', () => {
+    try {
+      var body = res.text && JSON.parse(res.text);
+    } catch (e) {
+      var err = e;
+      // issue #675: return the raw response if the response parsing fails
+      err.rawResponse = res.text || null;
+      // issue #876: return the http status code if the response parsing fails
+      err.statusCode = res.statusCode;
+    } finally {
+      fn(err, body);
+    }
+  });
+};

goTorrentWebUI/node_modules/superagent/lib/node/parsers/text.js

@@ -0,0 +1,10 @@
+'use strict';
+
+module.exports = function(res, fn){
+  res.text = '';
+  res.setEncoding('utf8');
+  res.on('data', chunk => {
+    res.text += chunk;
+  });
+  res.on('end', fn);
+};

goTorrentWebUI/node_modules/superagent/lib/node/parsers/urlencoded.js

@@ -0,0 +1,22 @@
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+
+const qs = require('qs');
+
+module.exports = function(res, fn){
+  res.text = '';
+  res.setEncoding('ascii');
+  res.on('data', chunk => {
+    res.text += chunk;
+  });
+  res.on('end', () => {
+    try {
+      fn(null, qs.parse(res.text));
+    } catch (err) {
+      fn(err);
+    }
+  });
+};

goTorrentWebUI/node_modules/superagent/lib/node/response.js

@@ -0,0 +1,123 @@
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+
+const util = require('util');
+const Stream = require('stream');
+const ResponseBase = require('../response-base');
+
+/**
+ * Expose `Response`.
+ */
+
+module.exports = Response;
+
+/**
+ * Initialize a new `Response` with the given `xhr`.
+ *
+ *  - set flags (.ok, .error, etc)
+ *  - parse header
+ *
+ * @param {Request} req
+ * @param {Object} options
+ * @constructor
+ * @extends {Stream}
+ * @implements {ReadableStream}
+ * @api private
+ */
+
+function Response(req) {
+  Stream.call(this);
+  const res = (this.res = req.res);
+  this.request = req;
+  this.req = req.req;
+  this.text = res.text;
+  this.body = res.body !== undefined ? res.body : {};
+  this.files = res.files || {};
+  this.buffered = 'string' == typeof this.text;
+  this.header = this.headers = res.headers;
+  this._setStatusProperties(res.statusCode);
+  this._setHeaderProperties(this.header);
+  this.setEncoding = res.setEncoding.bind(res);
+  res.on('data', this.emit.bind(this, 'data'));
+  res.on('end', this.emit.bind(this, 'end'));
+  res.on('close', this.emit.bind(this, 'close'));
+  res.on('error', this.emit.bind(this, 'error'));
+}
+
+/**
+ * Inherit from `Stream`.
+ */
+
+util.inherits(Response, Stream);
+ResponseBase(Response.prototype);
+
+/**
+ * Implements methods of a `ReadableStream`
+ */
+
+Response.prototype.destroy = function(err){
+  this.res.destroy(err);
+};
+
+/**
+ * Pause.
+ */
+
+Response.prototype.pause = function(){
+  this.res.pause();
+};
+
+/**
+ * Resume.
+ */
+
+Response.prototype.resume = function(){
+  this.res.resume();
+};
+
+/**
+ * Return an `Error` representative of this response.
+ *
+ * @return {Error}
+ * @api public
+ */
+
+Response.prototype.toError = function() {
+  const req = this.req;
+  const method = req.method;
+  const path = req.path;
+
+  const msg = `cannot ${method} ${path} (${this.status})`;
+  const err = new Error(msg);
+  err.status = this.status;
+  err.text = this.text;
+  err.method = method;
+  err.path = path;
+
+  return err;
+};
+
+
+Response.prototype.setStatusProperties = function(status){
+  console.warn("In superagent 2.x setStatusProperties is a private method");
+  return this._setStatusProperties(status);
+};
+
+/**
+ * To json.
+ *
+ * @return {Object}
+ * @api public
+ */
+
+Response.prototype.toJSON = function() {
+  return {
+    req: this.request.toJSON(),
+    header: this.header,
+    status: this.status,
+    text: this.text,
+  };
+};

goTorrentWebUI/node_modules/superagent/lib/node/unzip.js

@@ -0,0 +1,71 @@
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+
+const StringDecoder = require('string_decoder').StringDecoder;
+const Stream = require('stream');
+const zlib = require('zlib');
+
+/**
+ * Buffers response data events and re-emits when they're unzipped.
+ *
+ * @param {Request} req
+ * @param {Response} res
+ * @api private
+ */
+
+exports.unzip = (req, res) => {
+  const unzip = zlib.createUnzip();
+  const stream = new Stream();
+  let decoder;
+
+  // make node responseOnEnd() happy
+  stream.req = req;
+
+  unzip.on('error', err => {
+    if (err && err.code === 'Z_BUF_ERROR') {
+      // unexpected end of file is ignored by browsers and curl
+      stream.emit('end');
+      return;
+    }
+    stream.emit('error', err);
+  });
+
+  // pipe to unzip
+  res.pipe(unzip);
+
+  // override `setEncoding` to capture encoding
+  res.setEncoding = type => {
+    decoder = new StringDecoder(type);
+  };
+
+  // decode upon decompressing with captured encoding
+  unzip.on('data', buf => {
+    if (decoder) {
+      const str = decoder.write(buf);
+      if (str.length) stream.emit('data', str);
+    } else {
+      stream.emit('data', buf);
+    }
+  });
+
+  unzip.on('end', () => {
+    stream.emit('end');
+  });
+
+  // override `on` to capture data listeners
+  const _on = res.on;
+  res.on = function(type, fn) {
+    if ('data' == type || 'end' == type) {
+      stream.on(type, fn);
+    } else if ('error' == type) {
+      stream.on(type, fn);
+      _on.call(res, type, fn);
+    } else {
+      _on.call(res, type, fn);
+    }
+    return this;
+  };
+};

goTorrentWebUI/node_modules/superagent/lib/request-base.js

@@ -0,0 +1,694 @@
+'use strict';
+
+/**
+ * Module of mixed-in functions shared between node and client code
+ */
+var isObject = require('./is-object');
+
+/**
+ * Expose `RequestBase`.
+ */
+
+module.exports = RequestBase;
+
+/**
+ * Initialize a new `RequestBase`.
+ *
+ * @api public
+ */
+
+function RequestBase(obj) {
+  if (obj) return mixin(obj);
+}
+
+/**
+ * Mixin the prototype properties.
+ *
+ * @param {Object} obj
+ * @return {Object}
+ * @api private
+ */
+
+function mixin(obj) {
+  for (var key in RequestBase.prototype) {
+    obj[key] = RequestBase.prototype[key];
+  }
+  return obj;
+}
+
+/**
+ * Clear previous timeout.
+ *
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.clearTimeout = function _clearTimeout(){
+  clearTimeout(this._timer);
+  clearTimeout(this._responseTimeoutTimer);
+  delete this._timer;
+  delete this._responseTimeoutTimer;
+  return this;
+};
+
+/**
+ * Override default response body parser
+ *
+ * This function will be called to convert incoming data into request.body
+ *
+ * @param {Function}
+ * @api public
+ */
+
+RequestBase.prototype.parse = function parse(fn){
+  this._parser = fn;
+  return this;
+};
+
+/**
+ * Set format of binary response body.
+ * In browser valid formats are 'blob' and 'arraybuffer',
+ * which return Blob and ArrayBuffer, respectively.
+ *
+ * In Node all values result in Buffer.
+ *
+ * Examples:
+ *
+ *      req.get('/')
+ *        .responseType('blob')
+ *        .end(callback);
+ *
+ * @param {String} val
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.responseType = function(val){
+  this._responseType = val;
+  return this;
+};
+
+/**
+ * Override default request body serializer
+ *
+ * This function will be called to convert data set via .send or .attach into payload to send
+ *
+ * @param {Function}
+ * @api public
+ */
+
+RequestBase.prototype.serialize = function serialize(fn){
+  this._serializer = fn;
+  return this;
+};
+
+/**
+ * Set timeouts.
+ *
+ * - response timeout is time between sending request and receiving the first byte of the response. Includes DNS and connection time.
+ * - deadline is the time from start of the request to receiving response body in full. If the deadline is too short large files may not load at all on slow connections.
+ *
+ * Value of 0 or false means no timeout.
+ *
+ * @param {Number|Object} ms or {response, deadline}
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.timeout = function timeout(options){
+  if (!options || 'object' !== typeof options) {
+    this._timeout = options;
+    this._responseTimeout = 0;
+    return this;
+  }
+
+  for(var option in options) {
+    switch(option) {
+      case 'deadline':
+        this._timeout = options.deadline;
+        break;
+      case 'response':
+        this._responseTimeout = options.response;
+        break;
+      default:
+        console.warn("Unknown timeout option", option);
+    }
+  }
+  return this;
+};
+
+/**
+ * Set number of retry attempts on error.
+ *
+ * Failed requests will be retried 'count' times if timeout or err.code >= 500.
+ *
+ * @param {Number} count
+ * @param {Function} [fn]
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.retry = function retry(count, fn){
+  // Default to 1 if no count passed or true
+  if (arguments.length === 0 || count === true) count = 1;
+  if (count <= 0) count = 0;
+  this._maxRetries = count;
+  this._retries = 0;
+  this._retryCallback = fn;
+  return this;
+};
+
+var ERROR_CODES = [
+  'ECONNRESET',
+  'ETIMEDOUT',
+  'EADDRINFO',
+  'ESOCKETTIMEDOUT'
+];
+
+/**
+ * Determine if a request should be retried.
+ * (Borrowed from segmentio/superagent-retry)
+ *
+ * @param {Error} err
+ * @param {Response} [res]
+ * @returns {Boolean}
+ */
+RequestBase.prototype._shouldRetry = function(err, res) {
+  if (!this._maxRetries || this._retries++ >= this._maxRetries) {
+    return false;
+  }
+  if (this._retryCallback) {
+    try {
+      var override = this._retryCallback(err, res);
+      if (override === true) return true;
+      if (override === false) return false;
+      // undefined falls back to defaults
+    } catch(e) {
+      console.error(e);
+    }
+  }
+  if (res && res.status && res.status >= 500 && res.status != 501) return true;
+  if (err) {
+    if (err.code && ~ERROR_CODES.indexOf(err.code)) return true;
+    // Superagent timeout
+    if (err.timeout && err.code == 'ECONNABORTED') return true;
+    if (err.crossDomain) return true;
+  }
+  return false;
+};
+
+/**
+ * Retry request
+ *
+ * @return {Request} for chaining
+ * @api private
+ */
+
+RequestBase.prototype._retry = function() {
+
+  this.clearTimeout();
+
+  // node
+  if (this.req) {
+    this.req = null;
+    this.req = this.request();
+  }
+
+  this._aborted = false;
+  this.timedout = false;
+
+  return this._end();
+};
+
+/**
+ * Promise support
+ *
+ * @param {Function} resolve
+ * @param {Function} [reject]
+ * @return {Request}
+ */
+
+RequestBase.prototype.then = function then(resolve, reject) {
+  if (!this._fullfilledPromise) {
+    var self = this;
+    if (this._endCalled) {
+      console.warn("Warning: superagent request was sent twice, because both .end() and .then() were called. Never call .end() if you use promises");
+    }
+    this._fullfilledPromise = new Promise(function(innerResolve, innerReject) {
+      self.end(function(err, res) {
+        if (err) innerReject(err);
+        else innerResolve(res);
+      });
+    });
+  }
+  return this._fullfilledPromise.then(resolve, reject);
+};
+
+RequestBase.prototype.catch = function(cb) {
+  return this.then(undefined, cb);
+};
+
+/**
+ * Allow for extension
+ */
+
+RequestBase.prototype.use = function use(fn) {
+  fn(this);
+  return this;
+};
+
+RequestBase.prototype.ok = function(cb) {
+  if ('function' !== typeof cb) throw Error("Callback required");
+  this._okCallback = cb;
+  return this;
+};
+
+RequestBase.prototype._isResponseOK = function(res) {
+  if (!res) {
+    return false;
+  }
+
+  if (this._okCallback) {
+    return this._okCallback(res);
+  }
+
+  return res.status >= 200 && res.status < 300;
+};
+
+/**
+ * Get request header `field`.
+ * Case-insensitive.
+ *
+ * @param {String} field
+ * @return {String}
+ * @api public
+ */
+
+RequestBase.prototype.get = function(field){
+  return this._header[field.toLowerCase()];
+};
+
+/**
+ * Get case-insensitive header `field` value.
+ * This is a deprecated internal API. Use `.get(field)` instead.
+ *
+ * (getHeader is no longer used internally by the superagent code base)
+ *
+ * @param {String} field
+ * @return {String}
+ * @api private
+ * @deprecated
+ */
+
+RequestBase.prototype.getHeader = RequestBase.prototype.get;
+
+/**
+ * Set header `field` to `val`, or multiple fields with one object.
+ * Case-insensitive.
+ *
+ * Examples:
+ *
+ *      req.get('/')
+ *        .set('Accept', 'application/json')
+ *        .set('X-API-Key', 'foobar')
+ *        .end(callback);
+ *
+ *      req.get('/')
+ *        .set({ Accept: 'application/json', 'X-API-Key': 'foobar' })
+ *        .end(callback);
+ *
+ * @param {String|Object} field
+ * @param {String} val
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.set = function(field, val){
+  if (isObject(field)) {
+    for (var key in field) {
+      this.set(key, field[key]);
+    }
+    return this;
+  }
+  this._header[field.toLowerCase()] = val;
+  this.header[field] = val;
+  return this;
+};
+
+/**
+ * Remove header `field`.
+ * Case-insensitive.
+ *
+ * Example:
+ *
+ *      req.get('/')
+ *        .unset('User-Agent')
+ *        .end(callback);
+ *
+ * @param {String} field
+ */
+RequestBase.prototype.unset = function(field){
+  delete this._header[field.toLowerCase()];
+  delete this.header[field];
+  return this;
+};
+
+/**
+ * Write the field `name` and `val`, or multiple fields with one object
+ * for "multipart/form-data" request bodies.
+ *
+ * ``` js
+ * request.post('/upload')
+ *   .field('foo', 'bar')
+ *   .end(callback);
+ *
+ * request.post('/upload')
+ *   .field({ foo: 'bar', baz: 'qux' })
+ *   .end(callback);
+ * ```
+ *
+ * @param {String|Object} name
+ * @param {String|Blob|File|Buffer|fs.ReadStream} val
+ * @return {Request} for chaining
+ * @api public
+ */
+RequestBase.prototype.field = function(name, val) {
+  // name should be either a string or an object.
+  if (null === name || undefined === name) {
+    throw new Error('.field(name, val) name can not be empty');
+  }
+
+  if (this._data) {
+    console.error(".field() can't be used if .send() is used. Please use only .send() or only .field() & .attach()");
+  }
+
+  if (isObject(name)) {
+    for (var key in name) {
+      this.field(key, name[key]);
+    }
+    return this;
+  }
+
+  if (Array.isArray(val)) {
+    for (var i in val) {
+      this.field(name, val[i]);
+    }
+    return this;
+  }
+
+  // val should be defined now
+  if (null === val || undefined === val) {
+    throw new Error('.field(name, val) val can not be empty');
+  }
+  if ('boolean' === typeof val) {
+    val = '' + val;
+  }
+  this._getFormData().append(name, val);
+  return this;
+};
+
+/**
+ * Abort the request, and clear potential timeout.
+ *
+ * @return {Request}
+ * @api public
+ */
+RequestBase.prototype.abort = function(){
+  if (this._aborted) {
+    return this;
+  }
+  this._aborted = true;
+  this.xhr && this.xhr.abort(); // browser
+  this.req && this.req.abort(); // node
+  this.clearTimeout();
+  this.emit('abort');
+  return this;
+};
+
+RequestBase.prototype._auth = function(user, pass, options, base64Encoder) {
+  switch (options.type) {
+    case 'basic':
+      this.set('Authorization', 'Basic ' + base64Encoder(user + ':' + pass));
+      break;
+
+    case 'auto':
+      this.username = user;
+      this.password = pass;
+      break;
+
+    case 'bearer': // usage would be .auth(accessToken, { type: 'bearer' })
+      this.set('Authorization', 'Bearer ' + user);
+      break;
+  }
+  return this;
+};
+
+/**
+ * Enable transmission of cookies with x-domain requests.
+ *
+ * Note that for this to work the origin must not be
+ * using "Access-Control-Allow-Origin" with a wildcard,
+ * and also must set "Access-Control-Allow-Credentials"
+ * to "true".
+ *
+ * @api public
+ */
+
+RequestBase.prototype.withCredentials = function(on) {
+  // This is browser-only functionality. Node side is no-op.
+  if (on == undefined) on = true;
+  this._withCredentials = on;
+  return this;
+};
+
+/**
+ * Set the max redirects to `n`. Does noting in browser XHR implementation.
+ *
+ * @param {Number} n
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.redirects = function(n){
+  this._maxRedirects = n;
+  return this;
+};
+
+/**
+ * Maximum size of buffered response body, in bytes. Counts uncompressed size.
+ * Default 200MB.
+ *
+ * @param {Number} n
+ * @return {Request} for chaining
+ */
+RequestBase.prototype.maxResponseSize = function(n){
+  if ('number' !== typeof n) {
+    throw TypeError("Invalid argument");
+  }
+  this._maxResponseSize = n;
+  return this;
+};
+
+/**
+ * Convert to a plain javascript object (not JSON string) of scalar properties.
+ * Note as this method is designed to return a useful non-this value,
+ * it cannot be chained.
+ *
+ * @return {Object} describing method, url, and data of this request
+ * @api public
+ */
+
+RequestBase.prototype.toJSON = function() {
+  return {
+    method: this.method,
+    url: this.url,
+    data: this._data,
+    headers: this._header,
+  };
+};
+
+/**
+ * Send `data` as the request body, defaulting the `.type()` to "json" when
+ * an object is given.
+ *
+ * Examples:
+ *
+ *       // manual json
+ *       request.post('/user')
+ *         .type('json')
+ *         .send('{"name":"tj"}')
+ *         .end(callback)
+ *
+ *       // auto json
+ *       request.post('/user')
+ *         .send({ name: 'tj' })
+ *         .end(callback)
+ *
+ *       // manual x-www-form-urlencoded
+ *       request.post('/user')
+ *         .type('form')
+ *         .send('name=tj')
+ *         .end(callback)
+ *
+ *       // auto x-www-form-urlencoded
+ *       request.post('/user')
+ *         .type('form')
+ *         .send({ name: 'tj' })
+ *         .end(callback)
+ *
+ *       // defaults to x-www-form-urlencoded
+ *      request.post('/user')
+ *        .send('name=tobi')
+ *        .send('species=ferret')
+ *        .end(callback)
+ *
+ * @param {String|Object} data
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.send = function(data){
+  var isObj = isObject(data);
+  var type = this._header['content-type'];
+
+  if (this._formData) {
+    console.error(".send() can't be used if .attach() or .field() is used. Please use only .send() or only .field() & .attach()");
+  }
+
+  if (isObj && !this._data) {
+    if (Array.isArray(data)) {
+      this._data = [];
+    } else if (!this._isHost(data)) {
+      this._data = {};
+    }
+  } else if (data && this._data && this._isHost(this._data)) {
+    throw Error("Can't merge these send calls");
+  }
+
+  // merge
+  if (isObj && isObject(this._data)) {
+    for (var key in data) {
+      this._data[key] = data[key];
+    }
+  } else if ('string' == typeof data) {
+    // default to x-www-form-urlencoded
+    if (!type) this.type('form');
+    type = this._header['content-type'];
+    if ('application/x-www-form-urlencoded' == type) {
+      this._data = this._data
+        ? this._data + '&' + data
+        : data;
+    } else {
+      this._data = (this._data || '') + data;
+    }
+  } else {
+    this._data = data;
+  }
+
+  if (!isObj || this._isHost(data)) {
+    return this;
+  }
+
+  // default to json
+  if (!type) this.type('json');
+  return this;
+};
+
+/**
+ * Sort `querystring` by the sort function
+ *
+ *
+ * Examples:
+ *
+ *       // default order
+ *       request.get('/user')
+ *         .query('name=Nick')
+ *         .query('search=Manny')
+ *         .sortQuery()
+ *         .end(callback)
+ *
+ *       // customized sort function
+ *       request.get('/user')
+ *         .query('name=Nick')
+ *         .query('search=Manny')
+ *         .sortQuery(function(a, b){
+ *           return a.length - b.length;
+ *         })
+ *         .end(callback)
+ *
+ *
+ * @param {Function} sort
+ * @return {Request} for chaining
+ * @api public
+ */
+
+RequestBase.prototype.sortQuery = function(sort) {
+  // _sort default to true but otherwise can be a function or boolean
+  this._sort = typeof sort === 'undefined' ? true : sort;
+  return this;
+};
+
+/**
+ * Compose querystring to append to req.url
+ *
+ * @api private
+ */
+RequestBase.prototype._finalizeQueryString = function(){
+  var query = this._query.join('&');
+  if (query) {
+    this.url += (this.url.indexOf('?') >= 0 ? '&' : '?') + query;
+  }
+  this._query.length = 0; // Makes the call idempotent
+
+  if (this._sort) {
+    var index = this.url.indexOf('?');
+    if (index >= 0) {
+      var queryArr = this.url.substring(index + 1).split('&');
+      if ('function' === typeof this._sort) {
+        queryArr.sort(this._sort);
+      } else {
+        queryArr.sort();
+      }
+      this.url = this.url.substring(0, index) + '?' + queryArr.join('&');
+    }
+  }
+};
+
+// For backwards compat only
+RequestBase.prototype._appendQueryString = function() {console.trace("Unsupported");}
+
+/**
+ * Invoke callback with timeout error.
+ *
+ * @api private
+ */
+
+RequestBase.prototype._timeoutError = function(reason, timeout, errno){
+  if (this._aborted) {
+    return;
+  }
+  var err = new Error(reason + timeout + 'ms exceeded');
+  err.timeout = timeout;
+  err.code = 'ECONNABORTED';
+  err.errno = errno;
+  this.timedout = true;
+  this.abort();
+  this.callback(err);
+};
+
+RequestBase.prototype._setTimeouts = function() {
+  var self = this;
+
+  // deadline
+  if (this._timeout && !this._timer) {
+    this._timer = setTimeout(function(){
+      self._timeoutError('Timeout of ', self._timeout, 'ETIME');
+    }, this._timeout);
+  }
+  // response timeout
+  if (this._responseTimeout && !this._responseTimeoutTimer) {
+    this._responseTimeoutTimer = setTimeout(function(){
+      self._timeoutError('Response timeout of ', self._responseTimeout, 'ETIMEDOUT');
+    }, this._responseTimeout);
+  }
+};

goTorrentWebUI/node_modules/superagent/lib/response-base.js

@@ -0,0 +1,134 @@
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+
+var utils = require('./utils');
+
+/**
+ * Expose `ResponseBase`.
+ */
+
+module.exports = ResponseBase;
+
+/**
+ * Initialize a new `ResponseBase`.
+ *
+ * @api public
+ */
+
+function ResponseBase(obj) {
+  if (obj) return mixin(obj);
+}
+
+/**
+ * Mixin the prototype properties.
+ *
+ * @param {Object} obj
+ * @return {Object}
+ * @api private
+ */
+
+function mixin(obj) {
+  for (var key in ResponseBase.prototype) {
+    obj[key] = ResponseBase.prototype[key];
+  }
+  return obj;
+}
+
+/**
+ * Get case-insensitive `field` value.
+ *
+ * @param {String} field
+ * @return {String}
+ * @api public
+ */
+
+ResponseBase.prototype.get = function(field) {
+  return this.header[field.toLowerCase()];
+};
+
+/**
+ * Set header related properties:
+ *
+ *   - `.type` the content type without params
+ *
+ * A response of "Content-Type: text/plain; charset=utf-8"
+ * will provide you with a `.type` of "text/plain".
+ *
+ * @param {Object} header
+ * @api private
+ */
+
+ResponseBase.prototype._setHeaderProperties = function(header){
+    // TODO: moar!
+    // TODO: make this a util
+
+    // content-type
+    var ct = header['content-type'] || '';
+    this.type = utils.type(ct);
+
+    // params
+    var params = utils.params(ct);
+    for (var key in params) this[key] = params[key];
+
+    this.links = {};
+
+    // links
+    try {
+        if (header.link) {
+            this.links = utils.parseLinks(header.link);
+        }
+    } catch (err) {
+        // ignore
+    }
+};
+
+/**
+ * Set flags such as `.ok` based on `status`.
+ *
+ * For example a 2xx response will give you a `.ok` of __true__
+ * whereas 5xx will be __false__ and `.error` will be __true__. The
+ * `.clientError` and `.serverError` are also available to be more
+ * specific, and `.statusType` is the class of error ranging from 1..5
+ * sometimes useful for mapping respond colors etc.
+ *
+ * "sugar" properties are also defined for common cases. Currently providing:
+ *
+ *   - .noContent
+ *   - .badRequest
+ *   - .unauthorized
+ *   - .notAcceptable
+ *   - .notFound
+ *
+ * @param {Number} status
+ * @api private
+ */
+
+ResponseBase.prototype._setStatusProperties = function(status){
+    var type = status / 100 | 0;
+
+    // status / class
+    this.status = this.statusCode = status;
+    this.statusType = type;
+
+    // basics
+    this.info = 1 == type;
+    this.ok = 2 == type;
+    this.redirect = 3 == type;
+    this.clientError = 4 == type;
+    this.serverError = 5 == type;
+    this.error = (4 == type || 5 == type)
+        ? this.toError()
+        : false;
+
+    // sugar
+    this.accepted = 202 == status;
+    this.noContent = 204 == status;
+    this.badRequest = 400 == status;
+    this.unauthorized = 401 == status;
+    this.notAcceptable = 406 == status;
+    this.forbidden = 403 == status;
+    this.notFound = 404 == status;
+};

goTorrentWebUI/node_modules/superagent/lib/utils.js

@@ -0,0 +1,71 @@
+'use strict';
+
+/**
+ * Return the mime type for the given `str`.
+ *
+ * @param {String} str
+ * @return {String}
+ * @api private
+ */
+
+exports.type = function(str){
+  return str.split(/ *; */).shift();
+};
+
+/**
+ * Return header field parameters.
+ *
+ * @param {String} str
+ * @return {Object}
+ * @api private
+ */
+
+exports.params = function(str){
+  return str.split(/ *; */).reduce(function(obj, str){
+    var parts = str.split(/ *= */);
+    var key = parts.shift();
+    var val = parts.shift();
+
+    if (key && val) obj[key] = val;
+    return obj;
+  }, {});
+};
+
+/**
+ * Parse Link header fields.
+ *
+ * @param {String} str
+ * @return {Object}
+ * @api private
+ */
+
+exports.parseLinks = function(str){
+  return str.split(/ *, */).reduce(function(obj, str){
+    var parts = str.split(/ *; */);
+    var url = parts[0].slice(1, -1);
+    var rel = parts[1].split(/ *= */)[1].slice(1, -1);
+    obj[rel] = url;
+    return obj;
+  }, {});
+};
+
+/**
+ * Strip content related fields from `header`.
+ *
+ * @param {Object} header
+ * @return {Object} header
+ * @api private
+ */
+
+exports.cleanHeader = function(header, changesOrigin){
+  delete header['content-type'];
+  delete header['content-length'];
+  delete header['transfer-encoding'];
+  delete header['host'];
+  // secuirty
+  if (changesOrigin) {
+    delete header['authorization'];
+    delete header['cookie'];
+  }
+  return header;
+};

goTorrentWebUI/node_modules/superagent/node_modules/.bin/mime

@@ -0,0 +1,15 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+    *CYGWIN*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+  "$basedir/node"  "$basedir/../mime/cli.js" "$@"
+  ret=$?
+else 
+  node  "$basedir/../mime/cli.js" "$@"
+  ret=$?
+fi
+exit $ret

goTorrentWebUI/node_modules/superagent/node_modules/.bin/mime.cmd

@@ -0,0 +1,7 @@
+@IF EXIST "%~dp0\node.exe" (
+  "%~dp0\node.exe"  "%~dp0\..\mime\cli.js" %*
+) ELSE (
+  @SETLOCAL
+  @SET PATHEXT=%PATHEXT:;.JS;=;%
+  node  "%~dp0\..\mime\cli.js" %*
+)

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Alex Indigo
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/README.md

@@ -0,0 +1,233 @@
+# asynckit [![NPM Module](https://img.shields.io/npm/v/asynckit.svg?style=flat)](https://www.npmjs.com/package/asynckit)
+
+Minimal async jobs utility library, with streams support.
+
+[![PhantomJS Build](https://img.shields.io/travis/alexindigo/asynckit/v0.4.0.svg?label=browser&style=flat)](https://travis-ci.org/alexindigo/asynckit)
+[![Linux Build](https://img.shields.io/travis/alexindigo/asynckit/v0.4.0.svg?label=linux:0.12-6.x&style=flat)](https://travis-ci.org/alexindigo/asynckit)
+[![Windows Build](https://img.shields.io/appveyor/ci/alexindigo/asynckit/v0.4.0.svg?label=windows:0.12-6.x&style=flat)](https://ci.appveyor.com/project/alexindigo/asynckit)
+
+[![Coverage Status](https://img.shields.io/coveralls/alexindigo/asynckit/v0.4.0.svg?label=code+coverage&style=flat)](https://coveralls.io/github/alexindigo/asynckit?branch=master)
+[![Dependency Status](https://img.shields.io/david/alexindigo/asynckit/v0.4.0.svg?style=flat)](https://david-dm.org/alexindigo/asynckit)
+[![bitHound Overall Score](https://www.bithound.io/github/alexindigo/asynckit/badges/score.svg)](https://www.bithound.io/github/alexindigo/asynckit)
+
+<!-- [![Readme](https://img.shields.io/badge/readme-tested-brightgreen.svg?style=flat)](https://www.npmjs.com/package/reamde) -->
+
+AsyncKit provides harness for `parallel` and `serial` iterators over list of items represented by arrays or objects.
+Optionally it accepts abort function (should be synchronously return by iterator for each item), and terminates left over jobs upon an error event. For specific iteration order built-in (`ascending` and `descending`) and custom sort helpers also supported, via `asynckit.serialOrdered` method.
+
+It ensures async operations to keep behavior more stable and prevent `Maximum call stack size exceeded` errors, from sync iterators.
+
+| compression        |     size |
+| :----------------- | -------: |
+| asynckit.js        | 12.34 kB |
+| asynckit.min.js    |  4.11 kB |
+| asynckit.min.js.gz |  1.47 kB |
+
+
+## Install
+
+```sh
+$ npm install --save asynckit
+```
+
+## Examples
+
+### Parallel Jobs
+
+Runs iterator over provided array in parallel. Stores output in the `result` array,
+on the matching positions. In unlikely event of an error from one of the jobs,
+will terminate rest of the active jobs (if abort function is provided)
+and return error along with salvaged data to the main callback function.
+
+#### Input Array
+
+```javascript
+var parallel = require('asynckit').parallel
+  , assert   = require('assert')
+  ;
+
+var source         = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+  , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ]
+  , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ]
+  , target         = []
+  ;
+
+parallel(source, asyncJob, function(err, result)
+{
+  assert.deepEqual(result, expectedResult);
+  assert.deepEqual(target, expectedTarget);
+});
+
+// async job accepts one element from the array
+// and a callback function
+function asyncJob(item, cb)
+{
+  // different delays (in ms) per item
+  var delay = item * 25;
+
+  // pretend different jobs take different time to finish
+  // and not in consequential order
+  var timeoutId = setTimeout(function() {
+    target.push(item);
+    cb(null, item * 2);
+  }, delay);
+
+  // allow to cancel "leftover" jobs upon error
+  // return function, invoking of which will abort this job
+  return clearTimeout.bind(null, timeoutId);
+}
+```
+
+More examples could be found in [test/test-parallel-array.js](test/test-parallel-array.js).
+
+#### Input Object
+
+Also it supports named jobs, listed via object.
+
+```javascript
+var parallel = require('asynckit/parallel')
+  , assert   = require('assert')
+  ;
+
+var source         = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 }
+  , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 }
+  , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ]
+  , expectedKeys   = [ 'first', 'one', 'two', 'four', 'eight', 'sixteen', 'thirtyTwo', 'sixtyFour' ]
+  , target         = []
+  , keys           = []
+  ;
+
+parallel(source, asyncJob, function(err, result)
+{
+  assert.deepEqual(result, expectedResult);
+  assert.deepEqual(target, expectedTarget);
+  assert.deepEqual(keys, expectedKeys);
+});
+
+// supports full value, key, callback (shortcut) interface
+function asyncJob(item, key, cb)
+{
+  // different delays (in ms) per item
+  var delay = item * 25;
+
+  // pretend different jobs take different time to finish
+  // and not in consequential order
+  var timeoutId = setTimeout(function() {
+    keys.push(key);
+    target.push(item);
+    cb(null, item * 2);
+  }, delay);
+
+  // allow to cancel "leftover" jobs upon error
+  // return function, invoking of which will abort this job
+  return clearTimeout.bind(null, timeoutId);
+}
+```
+
+More examples could be found in [test/test-parallel-object.js](test/test-parallel-object.js).
+
+### Serial Jobs
+
+Runs iterator over provided array sequentially. Stores output in the `result` array,
+on the matching positions. In unlikely event of an error from one of the jobs,
+will not proceed to the rest of the items in the list
+and return error along with salvaged data to the main callback function.
+
+#### Input Array
+
+```javascript
+var serial = require('asynckit/serial')
+  , assert = require('assert')
+  ;
+
+var source         = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+  , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ]
+  , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ]
+  , target         = []
+  ;
+
+serial(source, asyncJob, function(err, result)
+{
+  assert.deepEqual(result, expectedResult);
+  assert.deepEqual(target, expectedTarget);
+});
+
+// extended interface (item, key, callback)
+// also supported for arrays
+function asyncJob(item, key, cb)
+{
+  target.push(key);
+
+  // it will be automatically made async
+  // even it iterator "returns" in the same event loop
+  cb(null, item * 2);
+}
+```
+
+More examples could be found in [test/test-serial-array.js](test/test-serial-array.js).
+
+#### Input Object
+
+Also it supports named jobs, listed via object.
+
+```javascript
+var serial = require('asynckit').serial
+  , assert = require('assert')
+  ;
+
+var source         = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+  , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ]
+  , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ]
+  , target         = []
+  ;
+
+var source         = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 }
+  , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 }
+  , expectedTarget = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+  , target         = []
+  ;
+
+
+serial(source, asyncJob, function(err, result)
+{
+  assert.deepEqual(result, expectedResult);
+  assert.deepEqual(target, expectedTarget);
+});
+
+// shortcut interface (item, callback)
+// works for object as well as for the arrays
+function asyncJob(item, cb)
+{
+  target.push(item);
+
+  // it will be automatically made async
+  // even it iterator "returns" in the same event loop
+  cb(null, item * 2);
+}
+```
+
+More examples could be found in [test/test-serial-object.js](test/test-serial-object.js).
+
+_Note: Since _object_ is an _unordered_ collection of properties,
+it may produce unexpected results with sequential iterations.
+Whenever order of the jobs' execution is important please use `serialOrdered` method._
+
+### Ordered Serial Iterations
+
+TBD
+
+For example [compare-property](compare-property) package.
+
+### Streaming interface
+
+TBD
+
+## Want to Know More?
+
+More examples can be found in [test folder](test/).
+
+Or open an [issue](https://github.com/alexindigo/asynckit/issues) with questions and/or suggestions.
+
+## License
+
+AsyncKit is licensed under the MIT license.

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/bench.js

@@ -0,0 +1,76 @@
+/* eslint no-console: "off" */
+
+var asynckit = require('./')
+  , async    = require('async')
+  , assert   = require('assert')
+  , expected = 0
+  ;
+
+var Benchmark = require('benchmark');
+var suite = new Benchmark.Suite;
+
+var source = [];
+for (var z = 1; z < 100; z++)
+{
+  source.push(z);
+  expected += z;
+}
+
+suite
+// add tests
+
+.add('async.map', function(deferred)
+{
+  var total = 0;
+
+  async.map(source,
+  function(i, cb)
+  {
+    setImmediate(function()
+    {
+      total += i;
+      cb(null, total);
+    });
+  },
+  function(err, result)
+  {
+    assert.ifError(err);
+    assert.equal(result[result.length - 1], expected);
+    deferred.resolve();
+  });
+}, {'defer': true})
+
+
+.add('asynckit.parallel', function(deferred)
+{
+  var total = 0;
+
+  asynckit.parallel(source,
+  function(i, cb)
+  {
+    setImmediate(function()
+    {
+      total += i;
+      cb(null, total);
+    });
+  },
+  function(err, result)
+  {
+    assert.ifError(err);
+    assert.equal(result[result.length - 1], expected);
+    deferred.resolve();
+  });
+}, {'defer': true})
+
+
+// add listeners
+.on('cycle', function(ev)
+{
+  console.log(String(ev.target));
+})
+.on('complete', function()
+{
+  console.log('Fastest is ' + this.filter('fastest').map('name'));
+})
+// run async
+.run({ 'async': true });

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/index.js

@@ -0,0 +1,6 @@
+module.exports =
+{
+  parallel      : require('./parallel.js'),
+  serial        : require('./serial.js'),
+  serialOrdered : require('./serialOrdered.js')
+};

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/abort.js

@@ -0,0 +1,29 @@
+// API
+module.exports = abort;
+
+/**
+ * Aborts leftover active jobs
+ *
+ * @param {object} state - current state object
+ */
+function abort(state)
+{
+  Object.keys(state.jobs).forEach(clean.bind(state));
+
+  // reset leftover jobs
+  state.jobs = {};
+}
+
+/**
+ * Cleans up leftover job by invoking abort function for the provided job id
+ *
+ * @this  state
+ * @param {string|number} key - job id to abort
+ */
+function clean(key)
+{
+  if (typeof this.jobs[key] == 'function')
+  {
+    this.jobs[key]();
+  }
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/async.js

@@ -0,0 +1,34 @@
+var defer = require('./defer.js');
+
+// API
+module.exports = async;
+
+/**
+ * Runs provided callback asynchronously
+ * even if callback itself is not
+ *
+ * @param   {function} callback - callback to invoke
+ * @returns {function} - augmented callback
+ */
+function async(callback)
+{
+  var isAsync = false;
+
+  // check if async happened
+  defer(function() { isAsync = true; });
+
+  return function async_callback(err, result)
+  {
+    if (isAsync)
+    {
+      callback(err, result);
+    }
+    else
+    {
+      defer(function nextTick_callback()
+      {
+        callback(err, result);
+      });
+    }
+  };
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/defer.js

@@ -0,0 +1,26 @@
+module.exports = defer;
+
+/**
+ * Runs provided function on next iteration of the event loop
+ *
+ * @param {function} fn - function to run
+ */
+function defer(fn)
+{
+  var nextTick = typeof setImmediate == 'function'
+    ? setImmediate
+    : (
+      typeof process == 'object' && typeof process.nextTick == 'function'
+      ? process.nextTick
+      : null
+    );
+
+  if (nextTick)
+  {
+    nextTick(fn);
+  }
+  else
+  {
+    setTimeout(fn, 0);
+  }
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/iterate.js

@@ -0,0 +1,75 @@
+var async = require('./async.js')
+  , abort = require('./abort.js')
+  ;
+
+// API
+module.exports = iterate;
+
+/**
+ * Iterates over each job object
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {object} state - current job status
+ * @param {function} callback - invoked when all elements processed
+ */
+function iterate(list, iterator, state, callback)
+{
+  // store current index
+  var key = state['keyedList'] ? state['keyedList'][state.index] : state.index;
+
+  state.jobs[key] = runJob(iterator, key, list[key], function(error, output)
+  {
+    // don't repeat yourself
+    // skip secondary callbacks
+    if (!(key in state.jobs))
+    {
+      return;
+    }
+
+    // clean up jobs
+    delete state.jobs[key];
+
+    if (error)
+    {
+      // don't process rest of the results
+      // stop still active jobs
+      // and reset the list
+      abort(state);
+    }
+    else
+    {
+      state.results[key] = output;
+    }
+
+    // return salvaged results
+    callback(error, state.results);
+  });
+}
+
+/**
+ * Runs iterator over provided job element
+ *
+ * @param   {function} iterator - iterator to invoke
+ * @param   {string|number} key - key/index of the element in the list of jobs
+ * @param   {mixed} item - job description
+ * @param   {function} callback - invoked after iterator is done with the job
+ * @returns {function|mixed} - job abort function or something else
+ */
+function runJob(iterator, key, item, callback)
+{
+  var aborter;
+
+  // allow shortcut if iterator expects only two arguments
+  if (iterator.length == 2)
+  {
+    aborter = iterator(item, async(callback));
+  }
+  // otherwise go with full three arguments
+  else
+  {
+    aborter = iterator(item, key, async(callback));
+  }
+
+  return aborter;
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/readable_asynckit.js

@@ -0,0 +1,91 @@
+var streamify = require('./streamify.js')
+  , defer     = require('./defer.js')
+  ;
+
+// API
+module.exports = ReadableAsyncKit;
+
+/**
+ * Base constructor for all streams
+ * used to hold properties/methods
+ */
+function ReadableAsyncKit()
+{
+  ReadableAsyncKit.super_.apply(this, arguments);
+
+  // list of active jobs
+  this.jobs = {};
+
+  // add stream methods
+  this.destroy = destroy;
+  this._start  = _start;
+  this._read   = _read;
+}
+
+/**
+ * Destroys readable stream,
+ * by aborting outstanding jobs
+ *
+ * @returns {void}
+ */
+function destroy()
+{
+  if (this.destroyed)
+  {
+    return;
+  }
+
+  this.destroyed = true;
+
+  if (typeof this.terminator == 'function')
+  {
+    this.terminator();
+  }
+}
+
+/**
+ * Starts provided jobs in async manner
+ *
+ * @private
+ */
+function _start()
+{
+  // first argument – runner function
+  var runner = arguments[0]
+    // take away first argument
+    , args   = Array.prototype.slice.call(arguments, 1)
+      // second argument - input data
+    , input  = args[0]
+      // last argument - result callback
+    , endCb  = streamify.callback.call(this, args[args.length - 1])
+    ;
+
+  args[args.length - 1] = endCb;
+  // third argument - iterator
+  args[1] = streamify.iterator.call(this, args[1]);
+
+  // allow time for proper setup
+  defer(function()
+  {
+    if (!this.destroyed)
+    {
+      this.terminator = runner.apply(null, args);
+    }
+    else
+    {
+      endCb(null, Array.isArray(input) ? [] : {});
+    }
+  }.bind(this));
+}
+
+
+/**
+ * Implement _read to comply with Readable streams
+ * Doesn't really make sense for flowing object mode
+ *
+ * @private
+ */
+function _read()
+{
+
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/readable_parallel.js

@@ -0,0 +1,25 @@
+var parallel = require('../parallel.js');
+
+// API
+module.exports = ReadableParallel;
+
+/**
+ * Streaming wrapper to `asynckit.parallel`
+ *
+ * @param   {array|object} list - array or object (named list) to iterate over
+ * @param   {function} iterator - iterator to run
+ * @param   {function} callback - invoked when all elements processed
+ * @returns {stream.Readable#}
+ */
+function ReadableParallel(list, iterator, callback)
+{
+  if (!(this instanceof ReadableParallel))
+  {
+    return new ReadableParallel(list, iterator, callback);
+  }
+
+  // turn on object mode
+  ReadableParallel.super_.call(this, {objectMode: true});
+
+  this._start(parallel, list, iterator, callback);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/readable_serial.js

@@ -0,0 +1,25 @@
+var serial = require('../serial.js');
+
+// API
+module.exports = ReadableSerial;
+
+/**
+ * Streaming wrapper to `asynckit.serial`
+ *
+ * @param   {array|object} list - array or object (named list) to iterate over
+ * @param   {function} iterator - iterator to run
+ * @param   {function} callback - invoked when all elements processed
+ * @returns {stream.Readable#}
+ */
+function ReadableSerial(list, iterator, callback)
+{
+  if (!(this instanceof ReadableSerial))
+  {
+    return new ReadableSerial(list, iterator, callback);
+  }
+
+  // turn on object mode
+  ReadableSerial.super_.call(this, {objectMode: true});
+
+  this._start(serial, list, iterator, callback);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/readable_serial_ordered.js

@@ -0,0 +1,29 @@
+var serialOrdered = require('../serialOrdered.js');
+
+// API
+module.exports = ReadableSerialOrdered;
+// expose sort helpers
+module.exports.ascending  = serialOrdered.ascending;
+module.exports.descending = serialOrdered.descending;
+
+/**
+ * Streaming wrapper to `asynckit.serialOrdered`
+ *
+ * @param   {array|object} list - array or object (named list) to iterate over
+ * @param   {function} iterator - iterator to run
+ * @param   {function} sortMethod - custom sort function
+ * @param   {function} callback - invoked when all elements processed
+ * @returns {stream.Readable#}
+ */
+function ReadableSerialOrdered(list, iterator, sortMethod, callback)
+{
+  if (!(this instanceof ReadableSerialOrdered))
+  {
+    return new ReadableSerialOrdered(list, iterator, sortMethod, callback);
+  }
+
+  // turn on object mode
+  ReadableSerialOrdered.super_.call(this, {objectMode: true});
+
+  this._start(serialOrdered, list, iterator, sortMethod, callback);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/state.js

@@ -0,0 +1,37 @@
+// API
+module.exports = state;
+
+/**
+ * Creates initial state object
+ * for iteration over list
+ *
+ * @param   {array|object} list - list to iterate over
+ * @param   {function|null} sortMethod - function to use for keys sort,
+ *                                     or `null` to keep them as is
+ * @returns {object} - initial state object
+ */
+function state(list, sortMethod)
+{
+  var isNamedList = !Array.isArray(list)
+    , initState =
+    {
+      index    : 0,
+      keyedList: isNamedList || sortMethod ? Object.keys(list) : null,
+      jobs     : {},
+      results  : isNamedList ? {} : [],
+      size     : isNamedList ? Object.keys(list).length : list.length
+    }
+    ;
+
+  if (sortMethod)
+  {
+    // sort array keys based on it's values
+    // sort object's keys just on own merit
+    initState.keyedList.sort(isNamedList ? sortMethod : function(a, b)
+    {
+      return sortMethod(list[a], list[b]);
+    });
+  }
+
+  return initState;
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/streamify.js

@@ -0,0 +1,141 @@
+var async = require('./async.js');
+
+// API
+module.exports = {
+  iterator: wrapIterator,
+  callback: wrapCallback
+};
+
+/**
+ * Wraps iterators with long signature
+ *
+ * @this    ReadableAsyncKit#
+ * @param   {function} iterator - function to wrap
+ * @returns {function} - wrapped function
+ */
+function wrapIterator(iterator)
+{
+  var stream = this;
+
+  return function(item, key, cb)
+  {
+    var aborter
+      , wrappedCb = async(wrapIteratorCallback.call(stream, cb, key))
+      ;
+
+    stream.jobs[key] = wrappedCb;
+
+    // it's either shortcut (item, cb)
+    if (iterator.length == 2)
+    {
+      aborter = iterator(item, wrappedCb);
+    }
+    // or long format (item, key, cb)
+    else
+    {
+      aborter = iterator(item, key, wrappedCb);
+    }
+
+    return aborter;
+  };
+}
+
+/**
+ * Wraps provided callback function
+ * allowing to execute snitch function before
+ * real callback
+ *
+ * @this    ReadableAsyncKit#
+ * @param   {function} callback - function to wrap
+ * @returns {function} - wrapped function
+ */
+function wrapCallback(callback)
+{
+  var stream = this;
+
+  var wrapped = function(error, result)
+  {
+    return finisher.call(stream, error, result, callback);
+  };
+
+  return wrapped;
+}
+
+/**
+ * Wraps provided iterator callback function
+ * makes sure snitch only called once,
+ * but passes secondary calls to the original callback
+ *
+ * @this    ReadableAsyncKit#
+ * @param   {function} callback - callback to wrap
+ * @param   {number|string} key - iteration key
+ * @returns {function} wrapped callback
+ */
+function wrapIteratorCallback(callback, key)
+{
+  var stream = this;
+
+  return function(error, output)
+  {
+    // don't repeat yourself
+    if (!(key in stream.jobs))
+    {
+      callback(error, output);
+      return;
+    }
+
+    // clean up jobs
+    delete stream.jobs[key];
+
+    return streamer.call(stream, error, {key: key, value: output}, callback);
+  };
+}
+
+/**
+ * Stream wrapper for iterator callback
+ *
+ * @this  ReadableAsyncKit#
+ * @param {mixed} error - error response
+ * @param {mixed} output - iterator output
+ * @param {function} callback - callback that expects iterator results
+ */
+function streamer(error, output, callback)
+{
+  if (error && !this.error)
+  {
+    this.error = error;
+    this.pause();
+    this.emit('error', error);
+    // send back value only, as expected
+    callback(error, output && output.value);
+    return;
+  }
+
+  // stream stuff
+  this.push(output);
+
+  // back to original track
+  // send back value only, as expected
+  callback(error, output && output.value);
+}
+
+/**
+ * Stream wrapper for finishing callback
+ *
+ * @this  ReadableAsyncKit#
+ * @param {mixed} error - error response
+ * @param {mixed} output - iterator output
+ * @param {function} callback - callback that expects final results
+ */
+function finisher(error, output, callback)
+{
+  // signal end of the stream
+  // only for successfully finished streams
+  if (!error)
+  {
+    this.push(null);
+  }
+
+  // back to original track
+  callback(error, output);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/lib/terminator.js

@@ -0,0 +1,29 @@
+var abort = require('./abort.js')
+  , async = require('./async.js')
+  ;
+
+// API
+module.exports = terminator;
+
+/**
+ * Terminates jobs in the attached state context
+ *
+ * @this  AsyncKitState#
+ * @param {function} callback - final callback to invoke after termination
+ */
+function terminator(callback)
+{
+  if (!Object.keys(this.jobs).length)
+  {
+    return;
+  }
+
+  // fast forward iteration index
+  this.index = this.size;
+
+  // abort jobs
+  abort(this);
+
+  // send back results we have so far
+  async(callback)(null, this.results);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/package.json

@@ -0,0 +1,94 @@
+{
+  "_args": [
+    [
+      "asynckit@0.4.0",
+      "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project"
+    ]
+  ],
+  "_from": "asynckit@0.4.0",
+  "_id": "asynckit@0.4.0",
+  "_inBundle": false,
+  "_integrity": "sha1-x57Zf380y48robyXkLzDZkdLS3k=",
+  "_location": "/superagent/asynckit",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "asynckit@0.4.0",
+    "name": "asynckit",
+    "escapedName": "asynckit",
+    "rawSpec": "0.4.0",
+    "saveSpec": null,
+    "fetchSpec": "0.4.0"
+  },
+  "_requiredBy": [
+    "/superagent/form-data"
+  ],
+  "_resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz",
+  "_spec": "0.4.0",
+  "_where": "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project",
+  "author": {
+    "name": "Alex Indigo",
+    "email": "iam@alexindigo.com"
+  },
+  "bugs": {
+    "url": "https://github.com/alexindigo/asynckit/issues"
+  },
+  "dependencies": {},
+  "description": "Minimal async jobs utility library, with streams support",
+  "devDependencies": {
+    "browserify": "^13.0.0",
+    "browserify-istanbul": "^2.0.0",
+    "coveralls": "^2.11.9",
+    "eslint": "^2.9.0",
+    "istanbul": "^0.4.3",
+    "obake": "^0.1.2",
+    "phantomjs-prebuilt": "^2.1.7",
+    "pre-commit": "^1.1.3",
+    "reamde": "^1.1.0",
+    "rimraf": "^2.5.2",
+    "size-table": "^0.2.0",
+    "tap-spec": "^4.1.1",
+    "tape": "^4.5.1"
+  },
+  "homepage": "https://github.com/alexindigo/asynckit#readme",
+  "keywords": [
+    "async",
+    "jobs",
+    "parallel",
+    "serial",
+    "iterator",
+    "array",
+    "object",
+    "stream",
+    "destroy",
+    "terminate",
+    "abort"
+  ],
+  "license": "MIT",
+  "main": "index.js",
+  "name": "asynckit",
+  "pre-commit": [
+    "clean",
+    "lint",
+    "test",
+    "browser",
+    "report",
+    "size"
+  ],
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/alexindigo/asynckit.git"
+  },
+  "scripts": {
+    "browser": "browserify -t browserify-istanbul test/lib/browserify_adjustment.js test/test-*.js | obake --coverage | tap-spec",
+    "clean": "rimraf coverage",
+    "debug": "tape test/test-*.js",
+    "lint": "eslint *.js lib/*.js test/*.js",
+    "report": "istanbul report",
+    "size": "browserify index.js | size-table asynckit",
+    "test": "istanbul cover --reporter=json tape -- 'test/test-*.js' | tap-spec",
+    "win-test": "tape test/test-*.js"
+  },
+  "version": "0.4.0"
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/parallel.js

@@ -0,0 +1,43 @@
+var iterate    = require('./lib/iterate.js')
+  , initState  = require('./lib/state.js')
+  , terminator = require('./lib/terminator.js')
+  ;
+
+// Public API
+module.exports = parallel;
+
+/**
+ * Runs iterator over provided array elements in parallel
+ *
+ * @param   {array|object} list - array or object (named list) to iterate over
+ * @param   {function} iterator - iterator to run
+ * @param   {function} callback - invoked when all elements processed
+ * @returns {function} - jobs terminator
+ */
+function parallel(list, iterator, callback)
+{
+  var state = initState(list);
+
+  while (state.index < (state['keyedList'] || list).length)
+  {
+    iterate(list, iterator, state, function(error, result)
+    {
+      if (error)
+      {
+        callback(error, result);
+        return;
+      }
+
+      // looks like it's the last one
+      if (Object.keys(state.jobs).length === 0)
+      {
+        callback(null, state.results);
+        return;
+      }
+    });
+
+    state.index++;
+  }
+
+  return terminator.bind(state, callback);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/serial.js

@@ -0,0 +1,17 @@
+var serialOrdered = require('./serialOrdered.js');
+
+// Public API
+module.exports = serial;
+
+/**
+ * Runs iterator over provided array elements in series
+ *
+ * @param   {array|object} list - array or object (named list) to iterate over
+ * @param   {function} iterator - iterator to run
+ * @param   {function} callback - invoked when all elements processed
+ * @returns {function} - jobs terminator
+ */
+function serial(list, iterator, callback)
+{
+  return serialOrdered(list, iterator, null, callback);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/serialOrdered.js

@@ -0,0 +1,75 @@
+var iterate    = require('./lib/iterate.js')
+  , initState  = require('./lib/state.js')
+  , terminator = require('./lib/terminator.js')
+  ;
+
+// Public API
+module.exports = serialOrdered;
+// sorting helpers
+module.exports.ascending  = ascending;
+module.exports.descending = descending;
+
+/**
+ * Runs iterator over provided sorted array elements in series
+ *
+ * @param   {array|object} list - array or object (named list) to iterate over
+ * @param   {function} iterator - iterator to run
+ * @param   {function} sortMethod - custom sort function
+ * @param   {function} callback - invoked when all elements processed
+ * @returns {function} - jobs terminator
+ */
+function serialOrdered(list, iterator, sortMethod, callback)
+{
+  var state = initState(list, sortMethod);
+
+  iterate(list, iterator, state, function iteratorHandler(error, result)
+  {
+    if (error)
+    {
+      callback(error, result);
+      return;
+    }
+
+    state.index++;
+
+    // are we there yet?
+    if (state.index < (state['keyedList'] || list).length)
+    {
+      iterate(list, iterator, state, iteratorHandler);
+      return;
+    }
+
+    // done here
+    callback(null, state.results);
+  });
+
+  return terminator.bind(state, callback);
+}
+
+/*
+ * -- Sort methods
+ */
+
+/**
+ * sort helper to sort array elements in ascending order
+ *
+ * @param   {mixed} a - an item to compare
+ * @param   {mixed} b - an item to compare
+ * @returns {number} - comparison result
+ */
+function ascending(a, b)
+{
+  return a < b ? -1 : a > b ? 1 : 0;
+}
+
+/**
+ * sort helper to sort array elements in descending order
+ *
+ * @param   {mixed} a - an item to compare
+ * @param   {mixed} b - an item to compare
+ * @returns {number} - comparison result
+ */
+function descending(a, b)
+{
+  return -1 * ascending(a, b);
+}

goTorrentWebUI/node_modules/superagent/node_modules/asynckit/stream.js

@@ -0,0 +1,21 @@
+var inherits              = require('util').inherits
+  , Readable              = require('stream').Readable
+  , ReadableAsyncKit      = require('./lib/readable_asynckit.js')
+  , ReadableParallel      = require('./lib/readable_parallel.js')
+  , ReadableSerial        = require('./lib/readable_serial.js')
+  , ReadableSerialOrdered = require('./lib/readable_serial_ordered.js')
+  ;
+
+// API
+module.exports =
+{
+  parallel      : ReadableParallel,
+  serial        : ReadableSerial,
+  serialOrdered : ReadableSerialOrdered, 
+};
+
+inherits(ReadableAsyncKit, Readable);
+
+inherits(ReadableParallel, ReadableAsyncKit);
+inherits(ReadableSerial, ReadableAsyncKit);
+inherits(ReadableSerialOrdered, ReadableAsyncKit);

goTorrentWebUI/node_modules/superagent/node_modules/combined-stream/License

@@ -0,0 +1,19 @@
+Copyright (c) 2011 Debuggable Limited <felix@debuggable.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

goTorrentWebUI/node_modules/superagent/node_modules/combined-stream/Readme.md

@@ -0,0 +1,138 @@
+# combined-stream
+
+A stream that emits multiple other streams one after another.
+
+**NB** Currently `combined-stream` works with streams vesrion 1 only. There is ongoing effort to switch this library to streams version 2. Any help is welcome. :) Meanwhile you can explore other libraries that provide streams2 support with more or less compatability with `combined-stream`.
+
+- [combined-stream2](https://www.npmjs.com/package/combined-stream2): A drop-in streams2-compatible replacement for the combined-stream module.
+
+- [multistream](https://www.npmjs.com/package/multistream): A stream that emits multiple other streams one after another.
+
+## Installation
+
+``` bash
+npm install combined-stream
+```
+
+## Usage
+
+Here is a simple example that shows how you can use combined-stream to combine
+two files into one:
+
+``` javascript
+var CombinedStream = require('combined-stream');
+var fs = require('fs');
+
+var combinedStream = CombinedStream.create();
+combinedStream.append(fs.createReadStream('file1.txt'));
+combinedStream.append(fs.createReadStream('file2.txt'));
+
+combinedStream.pipe(fs.createWriteStream('combined.txt'));
+```
+
+While the example above works great, it will pause all source streams until
+they are needed. If you don't want that to happen, you can set `pauseStreams`
+to `false`:
+
+``` javascript
+var CombinedStream = require('combined-stream');
+var fs = require('fs');
+
+var combinedStream = CombinedStream.create({pauseStreams: false});
+combinedStream.append(fs.createReadStream('file1.txt'));
+combinedStream.append(fs.createReadStream('file2.txt'));
+
+combinedStream.pipe(fs.createWriteStream('combined.txt'));
+```
+
+However, what if you don't have all the source streams yet, or you don't want
+to allocate the resources (file descriptors, memory, etc.) for them right away?
+Well, in that case you can simply provide a callback that supplies the stream
+by calling a `next()` function:
+
+``` javascript
+var CombinedStream = require('combined-stream');
+var fs = require('fs');
+
+var combinedStream = CombinedStream.create();
+combinedStream.append(function(next) {
+  next(fs.createReadStream('file1.txt'));
+});
+combinedStream.append(function(next) {
+  next(fs.createReadStream('file2.txt'));
+});
+
+combinedStream.pipe(fs.createWriteStream('combined.txt'));
+```
+
+## API
+
+### CombinedStream.create([options])
+
+Returns a new combined stream object. Available options are:
+
+* `maxDataSize`
+* `pauseStreams`
+
+The effect of those options is described below.
+
+### combinedStream.pauseStreams = `true`
+
+Whether to apply back pressure to the underlaying streams. If set to `false`,
+the underlaying streams will never be paused. If set to `true`, the
+underlaying streams will be paused right after being appended, as well as when
+`delayedStream.pipe()` wants to throttle.
+
+### combinedStream.maxDataSize = `2 * 1024 * 1024`
+
+The maximum amount of bytes (or characters) to buffer for all source streams.
+If this value is exceeded, `combinedStream` emits an `'error'` event.
+
+### combinedStream.dataSize = `0`
+
+The amount of bytes (or characters) currently buffered by `combinedStream`.
+
+### combinedStream.append(stream)
+
+Appends the given `stream` to the combinedStream object. If `pauseStreams` is
+set to `true, this stream will also be paused right away.
+
+`streams` can also be a function that takes one parameter called `next`. `next`
+is a function that must be invoked in order to provide the `next` stream, see
+example above.
+
+Regardless of how the `stream` is appended, combined-stream always attaches an
+`'error'` listener to it, so you don't have to do that manually.
+
+Special case: `stream` can also be a String or Buffer.
+
+### combinedStream.write(data)
+
+You should not call this, `combinedStream` takes care of piping the appended
+streams into itself for you.
+
+### combinedStream.resume()
+
+Causes `combinedStream` to start drain the streams it manages. The function is
+idempotent, and also emits a `'resume'` event each time which usually goes to
+the stream that is currently being drained.
+
+### combinedStream.pause();
+
+If `combinedStream.pauseStreams` is set to `false`, this does nothing.
+Otherwise a `'pause'` event is emitted, this goes to the stream that is
+currently being drained, so you can use it to apply back pressure.
+
+### combinedStream.end();
+
+Sets `combinedStream.writable` to false, emits an `'end'` event, and removes
+all streams from the queue.
+
+### combinedStream.destroy();
+
+Same as `combinedStream.end()`, except it emits a `'close'` event instead of
+`'end'`.
+
+## License
+
+combined-stream is licensed under the MIT license.

goTorrentWebUI/node_modules/superagent/node_modules/combined-stream/lib/combined_stream.js

@@ -0,0 +1,188 @@
+var util = require('util');
+var Stream = require('stream').Stream;
+var DelayedStream = require('delayed-stream');
+
+module.exports = CombinedStream;
+function CombinedStream() {
+  this.writable = false;
+  this.readable = true;
+  this.dataSize = 0;
+  this.maxDataSize = 2 * 1024 * 1024;
+  this.pauseStreams = true;
+
+  this._released = false;
+  this._streams = [];
+  this._currentStream = null;
+}
+util.inherits(CombinedStream, Stream);
+
+CombinedStream.create = function(options) {
+  var combinedStream = new this();
+
+  options = options || {};
+  for (var option in options) {
+    combinedStream[option] = options[option];
+  }
+
+  return combinedStream;
+};
+
+CombinedStream.isStreamLike = function(stream) {
+  return (typeof stream !== 'function')
+    && (typeof stream !== 'string')
+    && (typeof stream !== 'boolean')
+    && (typeof stream !== 'number')
+    && (!Buffer.isBuffer(stream));
+};
+
+CombinedStream.prototype.append = function(stream) {
+  var isStreamLike = CombinedStream.isStreamLike(stream);
+
+  if (isStreamLike) {
+    if (!(stream instanceof DelayedStream)) {
+      var newStream = DelayedStream.create(stream, {
+        maxDataSize: Infinity,
+        pauseStream: this.pauseStreams,
+      });
+      stream.on('data', this._checkDataSize.bind(this));
+      stream = newStream;
+    }
+
+    this._handleErrors(stream);
+
+    if (this.pauseStreams) {
+      stream.pause();
+    }
+  }
+
+  this._streams.push(stream);
+  return this;
+};
+
+CombinedStream.prototype.pipe = function(dest, options) {
+  Stream.prototype.pipe.call(this, dest, options);
+  this.resume();
+  return dest;
+};
+
+CombinedStream.prototype._getNext = function() {
+  this._currentStream = null;
+  var stream = this._streams.shift();
+
+
+  if (typeof stream == 'undefined') {
+    this.end();
+    return;
+  }
+
+  if (typeof stream !== 'function') {
+    this._pipeNext(stream);
+    return;
+  }
+
+  var getStream = stream;
+  getStream(function(stream) {
+    var isStreamLike = CombinedStream.isStreamLike(stream);
+    if (isStreamLike) {
+      stream.on('data', this._checkDataSize.bind(this));
+      this._handleErrors(stream);
+    }
+
+    this._pipeNext(stream);
+  }.bind(this));
+};
+
+CombinedStream.prototype._pipeNext = function(stream) {
+  this._currentStream = stream;
+
+  var isStreamLike = CombinedStream.isStreamLike(stream);
+  if (isStreamLike) {
+    stream.on('end', this._getNext.bind(this));
+    stream.pipe(this, {end: false});
+    return;
+  }
+
+  var value = stream;
+  this.write(value);
+  this._getNext();
+};
+
+CombinedStream.prototype._handleErrors = function(stream) {
+  var self = this;
+  stream.on('error', function(err) {
+    self._emitError(err);
+  });
+};
+
+CombinedStream.prototype.write = function(data) {
+  this.emit('data', data);
+};
+
+CombinedStream.prototype.pause = function() {
+  if (!this.pauseStreams) {
+    return;
+  }
+
+  if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause();
+  this.emit('pause');
+};
+
+CombinedStream.prototype.resume = function() {
+  if (!this._released) {
+    this._released = true;
+    this.writable = true;
+    this._getNext();
+  }
+
+  if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume();
+  this.emit('resume');
+};
+
+CombinedStream.prototype.end = function() {
+  this._reset();
+  this.emit('end');
+};
+
+CombinedStream.prototype.destroy = function() {
+  this._reset();
+  this.emit('close');
+};
+
+CombinedStream.prototype._reset = function() {
+  this.writable = false;
+  this._streams = [];
+  this._currentStream = null;
+};
+
+CombinedStream.prototype._checkDataSize = function() {
+  this._updateDataSize();
+  if (this.dataSize <= this.maxDataSize) {
+    return;
+  }
+
+  var message =
+    'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.';
+  this._emitError(new Error(message));
+};
+
+CombinedStream.prototype._updateDataSize = function() {
+  this.dataSize = 0;
+
+  var self = this;
+  this._streams.forEach(function(stream) {
+    if (!stream.dataSize) {
+      return;
+    }
+
+    self.dataSize += stream.dataSize;
+  });
+
+  if (this._currentStream && this._currentStream.dataSize) {
+    this.dataSize += this._currentStream.dataSize;
+  }
+};
+
+CombinedStream.prototype._emitError = function(err) {
+  this._reset();
+  this.emit('error', err);
+};

goTorrentWebUI/node_modules/superagent/node_modules/combined-stream/package.json

@@ -0,0 +1,60 @@
+{
+  "_args": [
+    [
+      "combined-stream@1.0.5",
+      "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project"
+    ]
+  ],
+  "_from": "combined-stream@1.0.5",
+  "_id": "combined-stream@1.0.5",
+  "_inBundle": false,
+  "_integrity": "sha1-k4NwpXtKUd6ix3wV1cX9+JUWQAk=",
+  "_location": "/superagent/combined-stream",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "combined-stream@1.0.5",
+    "name": "combined-stream",
+    "escapedName": "combined-stream",
+    "rawSpec": "1.0.5",
+    "saveSpec": null,
+    "fetchSpec": "1.0.5"
+  },
+  "_requiredBy": [
+    "/superagent/form-data"
+  ],
+  "_resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.5.tgz",
+  "_spec": "1.0.5",
+  "_where": "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project",
+  "author": {
+    "name": "Felix Geisendörfer",
+    "email": "felix@debuggable.com",
+    "url": "http://debuggable.com/"
+  },
+  "bugs": {
+    "url": "https://github.com/felixge/node-combined-stream/issues"
+  },
+  "dependencies": {
+    "delayed-stream": "~1.0.0"
+  },
+  "description": "A stream that emits multiple other streams one after another.",
+  "devDependencies": {
+    "far": "~0.0.7"
+  },
+  "engines": {
+    "node": ">= 0.8"
+  },
+  "homepage": "https://github.com/felixge/node-combined-stream",
+  "license": "MIT",
+  "main": "./lib/combined_stream",
+  "name": "combined-stream",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/felixge/node-combined-stream.git"
+  },
+  "scripts": {
+    "test": "node test/run.js"
+  },
+  "version": "1.0.5"
+}

goTorrentWebUI/node_modules/superagent/node_modules/component-emitter/History.md

@@ -0,0 +1,68 @@
+
+1.2.1 / 2016-04-18
+==================
+
+ * enable client side use
+
+1.2.0 / 2014-02-12
+==================
+
+ * prefix events with `$` to support object prototype method names
+
+1.1.3 / 2014-06-20
+==================
+
+ * republish for npm
+ * add LICENSE file
+
+1.1.2 / 2014-02-10
+==================
+
+  * package: rename to "component-emitter"
+  * package: update "main" and "component" fields
+  * Add license to Readme (same format as the other components)
+  * created .npmignore
+  * travis stuff
+
+1.1.1 / 2013-12-01
+==================
+
+  * fix .once adding .on to the listener
+  * docs: Emitter#off()
+  * component: add `.repo` prop
+
+1.1.0 / 2013-10-20
+==================
+
+ * add `.addEventListener()` and `.removeEventListener()` aliases
+
+1.0.1 / 2013-06-27
+==================
+
+ * add support for legacy ie
+
+1.0.0 / 2013-02-26
+==================
+
+  * add `.off()` support for removing all listeners
+
+0.0.6 / 2012-10-08
+==================
+
+  * add `this._callbacks` initialization to prevent funky gotcha
+
+0.0.5 / 2012-09-07
+==================
+
+  * fix `Emitter.call(this)` usage
+
+0.0.3 / 2012-07-11
+==================
+
+  * add `.listeners()`
+  * rename `.has()` to `.hasListeners()`
+
+0.0.2 / 2012-06-28
+==================
+
+  * fix `.off()` with `.once()`-registered callbacks

goTorrentWebUI/node_modules/superagent/node_modules/component-emitter/LICENSE

@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2014 Component contributors <dev@component.io>
+
+Permission is hereby granted, free of charge, to any person
+obtaining a copy of this software and associated documentation
+files (the "Software"), to deal in the Software without
+restriction, including without limitation the rights to use,
+copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the
+Software is furnished to do so, subject to the following
+conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+OTHER DEALINGS IN THE SOFTWARE.

goTorrentWebUI/node_modules/superagent/node_modules/component-emitter/Readme.md

@@ -0,0 +1,74 @@
+# Emitter [![Build Status](https://travis-ci.org/component/emitter.png)](https://travis-ci.org/component/emitter)
+
+  Event emitter component.
+
+## Installation
+
+```
+$ component install component/emitter
+```
+
+## API
+
+### Emitter(obj)
+
+  The `Emitter` may also be used as a mixin. For example
+  a "plain" object may become an emitter, or you may
+  extend an existing prototype.
+
+  As an `Emitter` instance:
+
+```js
+var Emitter = require('emitter');
+var emitter = new Emitter;
+emitter.emit('something');
+```
+
+  As a mixin:
+
+```js
+var Emitter = require('emitter');
+var user = { name: 'tobi' };
+Emitter(user);
+
+user.emit('im a user');
+```
+
+  As a prototype mixin:
+
+```js
+var Emitter = require('emitter');
+Emitter(User.prototype);
+```
+
+### Emitter#on(event, fn)
+
+  Register an `event` handler `fn`.
+
+### Emitter#once(event, fn)
+
+  Register a single-shot `event` handler `fn`,
+  removed immediately after it is invoked the
+  first time.
+
+### Emitter#off(event, fn)
+
+  * Pass `event` and `fn` to remove a listener.
+  * Pass `event` to remove all listeners on that event.
+  * Pass nothing to remove all listeners on all events.
+
+### Emitter#emit(event, ...)
+
+  Emit an `event` with variable option args.
+
+### Emitter#listeners(event)
+
+  Return an array of callbacks, or an empty array.
+
+### Emitter#hasListeners(event)
+
+  Check if this emitter has `event` handlers.
+
+## License
+
+MIT

goTorrentWebUI/node_modules/superagent/node_modules/component-emitter/index.js

@@ -0,0 +1,163 @@
+
+/**
+ * Expose `Emitter`.
+ */
+
+if (typeof module !== 'undefined') {
+  module.exports = Emitter;
+}
+
+/**
+ * Initialize a new `Emitter`.
+ *
+ * @api public
+ */
+
+function Emitter(obj) {
+  if (obj) return mixin(obj);
+};
+
+/**
+ * Mixin the emitter properties.
+ *
+ * @param {Object} obj
+ * @return {Object}
+ * @api private
+ */
+
+function mixin(obj) {
+  for (var key in Emitter.prototype) {
+    obj[key] = Emitter.prototype[key];
+  }
+  return obj;
+}
+
+/**
+ * Listen on the given `event` with `fn`.
+ *
+ * @param {String} event
+ * @param {Function} fn
+ * @return {Emitter}
+ * @api public
+ */
+
+Emitter.prototype.on =
+Emitter.prototype.addEventListener = function(event, fn){
+  this._callbacks = this._callbacks || {};
+  (this._callbacks['$' + event] = this._callbacks['$' + event] || [])
+    .push(fn);
+  return this;
+};
+
+/**
+ * Adds an `event` listener that will be invoked a single
+ * time then automatically removed.
+ *
+ * @param {String} event
+ * @param {Function} fn
+ * @return {Emitter}
+ * @api public
+ */
+
+Emitter.prototype.once = function(event, fn){
+  function on() {
+    this.off(event, on);
+    fn.apply(this, arguments);
+  }
+
+  on.fn = fn;
+  this.on(event, on);
+  return this;
+};
+
+/**
+ * Remove the given callback for `event` or all
+ * registered callbacks.
+ *
+ * @param {String} event
+ * @param {Function} fn
+ * @return {Emitter}
+ * @api public
+ */
+
+Emitter.prototype.off =
+Emitter.prototype.removeListener =
+Emitter.prototype.removeAllListeners =
+Emitter.prototype.removeEventListener = function(event, fn){
+  this._callbacks = this._callbacks || {};
+
+  // all
+  if (0 == arguments.length) {
+    this._callbacks = {};
+    return this;
+  }
+
+  // specific event
+  var callbacks = this._callbacks['$' + event];
+  if (!callbacks) return this;
+
+  // remove all handlers
+  if (1 == arguments.length) {
+    delete this._callbacks['$' + event];
+    return this;
+  }
+
+  // remove specific handler
+  var cb;
+  for (var i = 0; i < callbacks.length; i++) {
+    cb = callbacks[i];
+    if (cb === fn || cb.fn === fn) {
+      callbacks.splice(i, 1);
+      break;
+    }
+  }
+  return this;
+};
+
+/**
+ * Emit `event` with the given args.
+ *
+ * @param {String} event
+ * @param {Mixed} ...
+ * @return {Emitter}
+ */
+
+Emitter.prototype.emit = function(event){
+  this._callbacks = this._callbacks || {};
+  var args = [].slice.call(arguments, 1)
+    , callbacks = this._callbacks['$' + event];
+
+  if (callbacks) {
+    callbacks = callbacks.slice(0);
+    for (var i = 0, len = callbacks.length; i < len; ++i) {
+      callbacks[i].apply(this, args);
+    }
+  }
+
+  return this;
+};
+
+/**
+ * Return array of callbacks for `event`.
+ *
+ * @param {String} event
+ * @return {Array}
+ * @api public
+ */
+
+Emitter.prototype.listeners = function(event){
+  this._callbacks = this._callbacks || {};
+  return this._callbacks['$' + event] || [];
+};
+
+/**
+ * Check if this emitter has `event` handlers.
+ *
+ * @param {String} event
+ * @return {Boolean}
+ * @api public
+ */
+
+Emitter.prototype.hasListeners = function(event){
+  return !! this.listeners(event).length;
+};

goTorrentWebUI/node_modules/superagent/node_modules/component-emitter/package.json

@@ -0,0 +1,59 @@
+{
+  "_args": [
+    [
+      "component-emitter@1.2.1",
+      "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project"
+    ]
+  ],
+  "_from": "component-emitter@1.2.1",
+  "_id": "component-emitter@1.2.1",
+  "_inBundle": false,
+  "_integrity": "sha1-E3kY1teCg/ffemt8WmPhQOaUJeY=",
+  "_location": "/superagent/component-emitter",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "component-emitter@1.2.1",
+    "name": "component-emitter",
+    "escapedName": "component-emitter",
+    "rawSpec": "1.2.1",
+    "saveSpec": null,
+    "fetchSpec": "1.2.1"
+  },
+  "_requiredBy": [
+    "/superagent"
+  ],
+  "_resolved": "https://registry.npmjs.org/component-emitter/-/component-emitter-1.2.1.tgz",
+  "_spec": "1.2.1",
+  "_where": "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project",
+  "bugs": {
+    "url": "https://github.com/component/emitter/issues"
+  },
+  "component": {
+    "scripts": {
+      "emitter/index.js": "index.js"
+    }
+  },
+  "description": "Event emitter",
+  "devDependencies": {
+    "mocha": "*",
+    "should": "*"
+  },
+  "files": [
+    "index.js",
+    "LICENSE"
+  ],
+  "homepage": "https://github.com/component/emitter#readme",
+  "license": "MIT",
+  "main": "index.js",
+  "name": "component-emitter",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/component/emitter.git"
+  },
+  "scripts": {
+    "test": "make test"
+  },
+  "version": "1.2.1"
+}

goTorrentWebUI/node_modules/superagent/node_modules/cookiejar/LICENSE

@@ -0,0 +1,9 @@
+The MIT License (MIT)
+Copyright (c) 2013 Bradley Meck 
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+

goTorrentWebUI/node_modules/superagent/node_modules/cookiejar/cookiejar.js

@@ -0,0 +1,265 @@
+/* jshint node: true */
+(function () {
+    "use strict";
+
+    function CookieAccessInfo(domain, path, secure, script) {
+        if (this instanceof CookieAccessInfo) {
+            this.domain = domain || undefined;
+            this.path = path || "/";
+            this.secure = !!secure;
+            this.script = !!script;
+            return this;
+        }
+        return new CookieAccessInfo(domain, path, secure, script);
+    }
+    CookieAccessInfo.All = Object.freeze(Object.create(null));
+    exports.CookieAccessInfo = CookieAccessInfo;
+
+    function Cookie(cookiestr, request_domain, request_path) {
+        if (cookiestr instanceof Cookie) {
+            return cookiestr;
+        }
+        if (this instanceof Cookie) {
+            this.name = null;
+            this.value = null;
+            this.expiration_date = Infinity;
+            this.path = String(request_path || "/");
+            this.explicit_path = false;
+            this.domain = request_domain || null;
+            this.explicit_domain = false;
+            this.secure = false; //how to define default?
+            this.noscript = false; //httponly
+            if (cookiestr) {
+                this.parse(cookiestr, request_domain, request_path);
+            }
+            return this;
+        }
+        return new Cookie(cookiestr, request_domain, request_path);
+    }
+    exports.Cookie = Cookie;
+
+    Cookie.prototype.toString = function toString() {
+        var str = [this.name + "=" + this.value];
+        if (this.expiration_date !== Infinity) {
+            str.push("expires=" + (new Date(this.expiration_date)).toGMTString());
+        }
+        if (this.domain) {
+            str.push("domain=" + this.domain);
+        }
+        if (this.path) {
+            str.push("path=" + this.path);
+        }
+        if (this.secure) {
+            str.push("secure");
+        }
+        if (this.noscript) {
+            str.push("httponly");
+        }
+        return str.join("; ");
+    };
+
+    Cookie.prototype.toValueString = function toValueString() {
+        return this.name + "=" + this.value;
+    };
+
+    var cookie_str_splitter = /[:](?=\s*[a-zA-Z0-9_\-]+\s*[=])/g;
+    Cookie.prototype.parse = function parse(str, request_domain, request_path) {
+        if (this instanceof Cookie) {
+            var parts = str.split(";").filter(function (value) {
+                    return !!value;
+                }),
+                pair = parts[0].match(/([^=]+)=([\s\S]*)/),
+                key = pair[1],
+                value = pair[2],
+                i;
+            this.name = key;
+            this.value = value;
+
+            for (i = 1; i < parts.length; i += 1) {
+                pair = parts[i].match(/([^=]+)(?:=([\s\S]*))?/);
+                key = pair[1].trim().toLowerCase();
+                value = pair[2];
+                switch (key) {
+                case "httponly":
+                    this.noscript = true;
+                    break;
+                case "expires":
+                    this.expiration_date = value ?
+                            Number(Date.parse(value)) :
+                            Infinity;
+                    break;
+                case "path":
+                    this.path = value ?
+                            value.trim() :
+                            "";
+                    this.explicit_path = true;
+                    break;
+                case "domain":
+                    this.domain = value ?
+                            value.trim() :
+                            "";
+                    this.explicit_domain = !!this.domain;
+                    break;
+                case "secure":
+                    this.secure = true;
+                    break;
+                }
+            }
+
+            if (!this.explicit_path) {
+               this.path = request_path || "/";
+            }
+            if (!this.explicit_domain) {
+               this.domain = request_domain;
+            }
+
+            return this;
+        }
+        return new Cookie().parse(str, request_domain, request_path);
+    };
+
+    Cookie.prototype.matches = function matches(access_info) {
+        if (access_info === CookieAccessInfo.All) {
+          return true;
+        }
+        if (this.noscript && access_info.script ||
+                this.secure && !access_info.secure ||
+                !this.collidesWith(access_info)) {
+            return false;
+        }
+        return true;
+    };
+
+    Cookie.prototype.collidesWith = function collidesWith(access_info) {
+        if ((this.path && !access_info.path) || (this.domain && !access_info.domain)) {
+            return false;
+        }
+        if (this.path && access_info.path.indexOf(this.path) !== 0) {
+            return false;
+        }
+        if (this.explicit_path && access_info.path.indexOf( this.path ) !== 0) {
+           return false;
+        }
+        var access_domain = access_info.domain && access_info.domain.replace(/^[\.]/,'');
+        var cookie_domain = this.domain && this.domain.replace(/^[\.]/,'');
+        if (cookie_domain === access_domain) {
+            return true;
+        }
+        if (cookie_domain) {
+            if (!this.explicit_domain) {
+                return false; // we already checked if the domains were exactly the same
+            }
+            var wildcard = access_domain.indexOf(cookie_domain);
+            if (wildcard === -1 || wildcard !== access_domain.length - cookie_domain.length) {
+                return false;
+            }
+            return true;
+        }
+        return true;
+    };
+
+    function CookieJar() {
+        var cookies, cookies_list, collidable_cookie;
+        if (this instanceof CookieJar) {
+            cookies = Object.create(null); //name: [Cookie]
+
+            this.setCookie = function setCookie(cookie, request_domain, request_path) {
+                var remove, i;
+                cookie = new Cookie(cookie, request_domain, request_path);
+                //Delete the cookie if the set is past the current time
+                remove = cookie.expiration_date <= Date.now();
+                if (cookies[cookie.name] !== undefined) {
+                    cookies_list = cookies[cookie.name];
+                    for (i = 0; i < cookies_list.length; i += 1) {
+                        collidable_cookie = cookies_list[i];
+                        if (collidable_cookie.collidesWith(cookie)) {
+                            if (remove) {
+                                cookies_list.splice(i, 1);
+                                if (cookies_list.length === 0) {
+                                    delete cookies[cookie.name];
+                                }
+                                return false;
+                            }
+                            cookies_list[i] = cookie;
+                            return cookie;
+                        }
+                    }
+                    if (remove) {
+                        return false;
+                    }
+                    cookies_list.push(cookie);
+                    return cookie;
+                }
+                if (remove) {
+                    return false;
+                }
+                cookies[cookie.name] = [cookie];
+                return cookies[cookie.name];
+            };
+            //returns a cookie
+            this.getCookie = function getCookie(cookie_name, access_info) {
+                var cookie, i;
+                cookies_list = cookies[cookie_name];
+                if (!cookies_list) {
+                    return;
+                }
+                for (i = 0; i < cookies_list.length; i += 1) {
+                    cookie = cookies_list[i];
+                    if (cookie.expiration_date <= Date.now()) {
+                        if (cookies_list.length === 0) {
+                            delete cookies[cookie.name];
+                        }
+                        continue;
+                    }
+
+                    if (cookie.matches(access_info)) {
+                        return cookie;
+                    }
+                }
+            };
+            //returns a list of cookies
+            this.getCookies = function getCookies(access_info) {
+                var matches = [], cookie_name, cookie;
+                for (cookie_name in cookies) {
+                    cookie = this.getCookie(cookie_name, access_info);
+                    if (cookie) {
+                        matches.push(cookie);
+                    }
+                }
+                matches.toString = function toString() {
+                    return matches.join(":");
+                };
+                matches.toValueString = function toValueString() {
+                    return matches.map(function (c) {
+                        return c.toValueString();
+                    }).join(';');
+                };
+                return matches;
+            };
+
+            return this;
+        }
+        return new CookieJar();
+    }
+    exports.CookieJar = CookieJar;
+
+    //returns list of cookies that were set correctly. Cookies that are expired and removed are not returned.
+    CookieJar.prototype.setCookies = function setCookies(cookies, request_domain, request_path) {
+        cookies = Array.isArray(cookies) ?
+                cookies :
+                cookies.split(cookie_str_splitter);
+        var successful = [],
+            i,
+            cookie;
+        cookies = cookies.map(function(item){
+            return new Cookie(item, request_domain, request_path);
+        });
+        for (i = 0; i < cookies.length; i += 1) {
+            cookie = cookies[i];
+            if (this.setCookie(cookie, request_domain, request_path)) {
+                successful.push(cookie);
+            }
+        }
+        return successful;
+    };
+}());

goTorrentWebUI/node_modules/superagent/node_modules/cookiejar/package.json

@@ -0,0 +1,58 @@
+{
+  "_args": [
+    [
+      "cookiejar@2.1.1",
+      "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project"
+    ]
+  ],
+  "_from": "cookiejar@2.1.1",
+  "_id": "cookiejar@2.1.1",
+  "_inBundle": false,
+  "_integrity": "sha1-Qa1XsbVVlR7BcUEqgZQrHoIA00o=",
+  "_location": "/superagent/cookiejar",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "cookiejar@2.1.1",
+    "name": "cookiejar",
+    "escapedName": "cookiejar",
+    "rawSpec": "2.1.1",
+    "saveSpec": null,
+    "fetchSpec": "2.1.1"
+  },
+  "_requiredBy": [
+    "/superagent"
+  ],
+  "_resolved": "https://registry.npmjs.org/cookiejar/-/cookiejar-2.1.1.tgz",
+  "_spec": "2.1.1",
+  "_where": "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project",
+  "author": {
+    "name": "bradleymeck"
+  },
+  "bugs": {
+    "url": "https://github.com/bmeck/node-cookiejar/issues"
+  },
+  "description": "simple persistent cookiejar system",
+  "devDependencies": {
+    "jshint": "^2.8.0"
+  },
+  "files": [
+    "cookiejar.js"
+  ],
+  "homepage": "https://github.com/bmeck/node-cookiejar#readme",
+  "jshintConfig": {
+    "node": true
+  },
+  "license": "MIT",
+  "main": "cookiejar.js",
+  "name": "cookiejar",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/bmeck/node-cookiejar.git"
+  },
+  "scripts": {
+    "test": "node tests/test.js"
+  },
+  "version": "2.1.1"
+}

goTorrentWebUI/node_modules/superagent/node_modules/cookiejar/readme.md

@@ -0,0 +1,57 @@
+# CookieJar
+
+Simple robust cookie library
+
+## Exports
+
+### CookieAccessInfo(domain,path,secure,script)
+
+    class to determine matching qualities of a cookie
+
+##### Properties
+
+* String domain - domain to match
+* String path - path to match
+* Boolean secure - access is secure (ssl generally)
+* Boolean script - access is from a script
+
+
+### Cookie(cookiestr_or_cookie, request_domain, request_path)
+
+    turns input into a Cookie (singleton if given a Cookie)
+    the `request_domain` argument is used to default the domain if it is not explicit in the cookie string 
+    the `request_path` argument is used to set the path if it is not explicit in a cookie String.
+
+    explicit domains/paths will cascade, implied domains/paths must *exactly* match (see http://en.wikipedia.org/wiki/HTTP_cookie#Domain_and_Pat)
+
+##### Properties
+
+* String name - name of the cookie
+* String value - string associated with the cookie
+* String domain - domain to match (on a cookie a '.' at the start means a wildcard matching anything ending in the rest)
+* Boolean explicit_domain - if the domain was explicitly set via the cookie string
+* String path - base path to match (matches any path starting with this '/' is root)
+* Boolean explicit_path - if the path was explicitly set via the cookie string
+* Boolean noscript - if it should be kept from scripts
+* Boolean secure - should it only be transmitted over secure means
+* Number expiration_date - number of millis since 1970 at which this should be removed
+
+##### Methods
+
+* String toString() - the __set-cookie:__ string for this cookie
+* String toValueString() - the __cookie:__ string for this cookie
+* Cookie parse(cookiestr, request_domain, request_path) - parses the string onto this cookie or a new one if called directly
+* Boolean matches(access_info) - returns true if the access_info allows retrieval of this cookie
+* Boolean collidesWith(cookie) - returns true if the cookies cannot exist in the same space (domain and path match)
+
+
+### CookieJar()
+
+    class to hold numerous cookies from multiple domains correctly
+
+##### Methods
+
+* Cookie setCookie(cookie, request_domain, request_path) - modify (or add if not already-existing) a cookie to the jar
+* Cookie[] setCookies(cookiestr_or_list, request_domain, request_path) - modify (or add if not already-existing) a large number of cookies to the jar
+* Cookie getCookie(cookie_name,access_info) - get a cookie with the name and access_info matching
+* Cookie[] getCookies(access_info) - grab all cookies matching this access_info

goTorrentWebUI/node_modules/superagent/node_modules/core-util-is/LICENSE

@@ -0,0 +1,19 @@
+Copyright Node.js contributors. All rights reserved.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to
+deal in the Software without restriction, including without limitation the
+rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+sell copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS
+IN THE SOFTWARE.

goTorrentWebUI/node_modules/superagent/node_modules/core-util-is/README.md

@@ -0,0 +1,3 @@
+# core-util-is
+
+The `util.is*` functions introduced in Node v0.12.

goTorrentWebUI/node_modules/superagent/node_modules/core-util-is/float.patch

@@ -0,0 +1,604 @@
+diff --git a/lib/util.js b/lib/util.js
+index a03e874..9074e8e 100644
+--- a/lib/util.js
++++ b/lib/util.js
+@@ -19,430 +19,6 @@
+ // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+ // USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+-var formatRegExp = /%[sdj%]/g;
+-exports.format = function(f) {
+-  if (!isString(f)) {
+-    var objects = [];
+-    for (var i = 0; i < arguments.length; i++) {
+-      objects.push(inspect(arguments[i]));
+-    }
+-    return objects.join(' ');
+-  }
+-
+-  var i = 1;
+-  var args = arguments;
+-  var len = args.length;
+-  var str = String(f).replace(formatRegExp, function(x) {
+-    if (x === '%%') return '%';
+-    if (i >= len) return x;
+-    switch (x) {
+-      case '%s': return String(args[i++]);
+-      case '%d': return Number(args[i++]);
+-      case '%j':
+-        try {
+-          return JSON.stringify(args[i++]);
+-        } catch (_) {
+-          return '[Circular]';
+-        }
+-      default:
+-        return x;
+-    }
+-  });
+-  for (var x = args[i]; i < len; x = args[++i]) {
+-    if (isNull(x) || !isObject(x)) {
+-      str += ' ' + x;
+-    } else {
+-      str += ' ' + inspect(x);
+-    }
+-  }
+-  return str;
+-};
+-
+-
+-// Mark that a method should not be used.
+-// Returns a modified function which warns once by default.
+-// If --no-deprecation is set, then it is a no-op.
+-exports.deprecate = function(fn, msg) {
+-  // Allow for deprecating things in the process of starting up.
+-  if (isUndefined(global.process)) {
+-    return function() {
+-      return exports.deprecate(fn, msg).apply(this, arguments);
+-    };
+-  }
+-
+-  if (process.noDeprecation === true) {
+-    return fn;
+-  }
+-
+-  var warned = false;
+-  function deprecated() {
+-    if (!warned) {
+-      if (process.throwDeprecation) {
+-        throw new Error(msg);
+-      } else if (process.traceDeprecation) {
+-        console.trace(msg);
+-      } else {
+-        console.error(msg);
+-      }
+-      warned = true;
+-    }
+-    return fn.apply(this, arguments);
+-  }
+-
+-  return deprecated;
+-};
+-
+-
+-var debugs = {};
+-var debugEnviron;
+-exports.debuglog = function(set) {
+-  if (isUndefined(debugEnviron))
+-    debugEnviron = process.env.NODE_DEBUG || '';
+-  set = set.toUpperCase();
+-  if (!debugs[set]) {
+-    if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) {
+-      var pid = process.pid;
+-      debugs[set] = function() {
+-        var msg = exports.format.apply(exports, arguments);
+-        console.error('%s %d: %s', set, pid, msg);
+-      };
+-    } else {
+-      debugs[set] = function() {};
+-    }
+-  }
+-  return debugs[set];
+-};
+-
+-
+-/**
+- * Echos the value of a value. Trys to print the value out
+- * in the best way possible given the different types.
+- *
+- * @param {Object} obj The object to print out.
+- * @param {Object} opts Optional options object that alters the output.
+- */
+-/* legacy: obj, showHidden, depth, colors*/
+-function inspect(obj, opts) {
+-  // default options
+-  var ctx = {
+-    seen: [],
+-    stylize: stylizeNoColor
+-  };
+-  // legacy...
+-  if (arguments.length >= 3) ctx.depth = arguments[2];
+-  if (arguments.length >= 4) ctx.colors = arguments[3];
+-  if (isBoolean(opts)) {
+-    // legacy...
+-    ctx.showHidden = opts;
+-  } else if (opts) {
+-    // got an "options" object
+-    exports._extend(ctx, opts);
+-  }
+-  // set default options
+-  if (isUndefined(ctx.showHidden)) ctx.showHidden = false;
+-  if (isUndefined(ctx.depth)) ctx.depth = 2;
+-  if (isUndefined(ctx.colors)) ctx.colors = false;
+-  if (isUndefined(ctx.customInspect)) ctx.customInspect = true;
+-  if (ctx.colors) ctx.stylize = stylizeWithColor;
+-  return formatValue(ctx, obj, ctx.depth);
+-}
+-exports.inspect = inspect;
+-
+-
+-// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics
+-inspect.colors = {
+-  'bold' : [1, 22],
+-  'italic' : [3, 23],
+-  'underline' : [4, 24],
+-  'inverse' : [7, 27],
+-  'white' : [37, 39],
+-  'grey' : [90, 39],
+-  'black' : [30, 39],
+-  'blue' : [34, 39],
+-  'cyan' : [36, 39],
+-  'green' : [32, 39],
+-  'magenta' : [35, 39],
+-  'red' : [31, 39],
+-  'yellow' : [33, 39]
+-};
+-
+-// Don't use 'blue' not visible on cmd.exe
+-inspect.styles = {
+-  'special': 'cyan',
+-  'number': 'yellow',
+-  'boolean': 'yellow',
+-  'undefined': 'grey',
+-  'null': 'bold',
+-  'string': 'green',
+-  'date': 'magenta',
+-  // "name": intentionally not styling
+-  'regexp': 'red'
+-};
+-
+-
+-function stylizeWithColor(str, styleType) {
+-  var style = inspect.styles[styleType];
+-
+-  if (style) {
+-    return '\u001b[' + inspect.colors[style][0] + 'm' + str +
+-           '\u001b[' + inspect.colors[style][1] + 'm';
+-  } else {
+-    return str;
+-  }
+-}
+-
+-
+-function stylizeNoColor(str, styleType) {
+-  return str;
+-}
+-
+-
+-function arrayToHash(array) {
+-  var hash = {};
+-
+-  array.forEach(function(val, idx) {
+-    hash[val] = true;
+-  });
+-
+-  return hash;
+-}
+-
+-
+-function formatValue(ctx, value, recurseTimes) {
+-  // Provide a hook for user-specified inspect functions.
+-  // Check that value is an object with an inspect function on it
+-  if (ctx.customInspect &&
+-      value &&
+-      isFunction(value.inspect) &&
+-      // Filter out the util module, it's inspect function is special
+-      value.inspect !== exports.inspect &&
+-      // Also filter out any prototype objects using the circular check.
+-      !(value.constructor && value.constructor.prototype === value)) {
+-    var ret = value.inspect(recurseTimes, ctx);
+-    if (!isString(ret)) {
+-      ret = formatValue(ctx, ret, recurseTimes);
+-    }
+-    return ret;
+-  }
+-
+-  // Primitive types cannot have properties
+-  var primitive = formatPrimitive(ctx, value);
+-  if (primitive) {
+-    return primitive;
+-  }
+-
+-  // Look up the keys of the object.
+-  var keys = Object.keys(value);
+-  var visibleKeys = arrayToHash(keys);
+-
+-  if (ctx.showHidden) {
+-    keys = Object.getOwnPropertyNames(value);
+-  }
+-
+-  // Some type of object without properties can be shortcutted.
+-  if (keys.length === 0) {
+-    if (isFunction(value)) {
+-      var name = value.name ? ': ' + value.name : '';
+-      return ctx.stylize('[Function' + name + ']', 'special');
+-    }
+-    if (isRegExp(value)) {
+-      return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+-    }
+-    if (isDate(value)) {
+-      return ctx.stylize(Date.prototype.toString.call(value), 'date');
+-    }
+-    if (isError(value)) {
+-      return formatError(value);
+-    }
+-  }
+-
+-  var base = '', array = false, braces = ['{', '}'];
+-
+-  // Make Array say that they are Array
+-  if (isArray(value)) {
+-    array = true;
+-    braces = ['[', ']'];
+-  }
+-
+-  // Make functions say that they are functions
+-  if (isFunction(value)) {
+-    var n = value.name ? ': ' + value.name : '';
+-    base = ' [Function' + n + ']';
+-  }
+-
+-  // Make RegExps say that they are RegExps
+-  if (isRegExp(value)) {
+-    base = ' ' + RegExp.prototype.toString.call(value);
+-  }
+-
+-  // Make dates with properties first say the date
+-  if (isDate(value)) {
+-    base = ' ' + Date.prototype.toUTCString.call(value);
+-  }
+-
+-  // Make error with message first say the error
+-  if (isError(value)) {
+-    base = ' ' + formatError(value);
+-  }
+-
+-  if (keys.length === 0 && (!array || value.length == 0)) {
+-    return braces[0] + base + braces[1];
+-  }
+-
+-  if (recurseTimes < 0) {
+-    if (isRegExp(value)) {
+-      return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+-    } else {
+-      return ctx.stylize('[Object]', 'special');
+-    }
+-  }
+-
+-  ctx.seen.push(value);
+-
+-  var output;
+-  if (array) {
+-    output = formatArray(ctx, value, recurseTimes, visibleKeys, keys);
+-  } else {
+-    output = keys.map(function(key) {
+-      return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array);
+-    });
+-  }
+-
+-  ctx.seen.pop();
+-
+-  return reduceToSingleString(output, base, braces);
+-}
+-
+-
+-function formatPrimitive(ctx, value) {
+-  if (isUndefined(value))
+-    return ctx.stylize('undefined', 'undefined');
+-  if (isString(value)) {
+-    var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '')
+-                                             .replace(/'/g, "\\'")
+-                                             .replace(/\\"/g, '"') + '\'';
+-    return ctx.stylize(simple, 'string');
+-  }
+-  if (isNumber(value)) {
+-    // Format -0 as '-0'. Strict equality won't distinguish 0 from -0,
+-    // so instead we use the fact that 1 / -0 < 0 whereas 1 / 0 > 0 .
+-    if (value === 0 && 1 / value < 0)
+-      return ctx.stylize('-0', 'number');
+-    return ctx.stylize('' + value, 'number');
+-  }
+-  if (isBoolean(value))
+-    return ctx.stylize('' + value, 'boolean');
+-  // For some reason typeof null is "object", so special case here.
+-  if (isNull(value))
+-    return ctx.stylize('null', 'null');
+-}
+-
+-
+-function formatError(value) {
+-  return '[' + Error.prototype.toString.call(value) + ']';
+-}
+-
+-
+-function formatArray(ctx, value, recurseTimes, visibleKeys, keys) {
+-  var output = [];
+-  for (var i = 0, l = value.length; i < l; ++i) {
+-    if (hasOwnProperty(value, String(i))) {
+-      output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+-          String(i), true));
+-    } else {
+-      output.push('');
+-    }
+-  }
+-  keys.forEach(function(key) {
+-    if (!key.match(/^\d+$/)) {
+-      output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+-          key, true));
+-    }
+-  });
+-  return output;
+-}
+-
+-
+-function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) {
+-  var name, str, desc;
+-  desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] };
+-  if (desc.get) {
+-    if (desc.set) {
+-      str = ctx.stylize('[Getter/Setter]', 'special');
+-    } else {
+-      str = ctx.stylize('[Getter]', 'special');
+-    }
+-  } else {
+-    if (desc.set) {
+-      str = ctx.stylize('[Setter]', 'special');
+-    }
+-  }
+-  if (!hasOwnProperty(visibleKeys, key)) {
+-    name = '[' + key + ']';
+-  }
+-  if (!str) {
+-    if (ctx.seen.indexOf(desc.value) < 0) {
+-      if (isNull(recurseTimes)) {
+-        str = formatValue(ctx, desc.value, null);
+-      } else {
+-        str = formatValue(ctx, desc.value, recurseTimes - 1);
+-      }
+-      if (str.indexOf('\n') > -1) {
+-        if (array) {
+-          str = str.split('\n').map(function(line) {
+-            return '  ' + line;
+-          }).join('\n').substr(2);
+-        } else {
+-          str = '\n' + str.split('\n').map(function(line) {
+-            return '   ' + line;
+-          }).join('\n');
+-        }
+-      }
+-    } else {
+-      str = ctx.stylize('[Circular]', 'special');
+-    }
+-  }
+-  if (isUndefined(name)) {
+-    if (array && key.match(/^\d+$/)) {
+-      return str;
+-    }
+-    name = JSON.stringify('' + key);
+-    if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) {
+-      name = name.substr(1, name.length - 2);
+-      name = ctx.stylize(name, 'name');
+-    } else {
+-      name = name.replace(/'/g, "\\'")
+-                 .replace(/\\"/g, '"')
+-                 .replace(/(^"|"$)/g, "'");
+-      name = ctx.stylize(name, 'string');
+-    }
+-  }
+-
+-  return name + ': ' + str;
+-}
+-
+-
+-function reduceToSingleString(output, base, braces) {
+-  var numLinesEst = 0;
+-  var length = output.reduce(function(prev, cur) {
+-    numLinesEst++;
+-    if (cur.indexOf('\n') >= 0) numLinesEst++;
+-    return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1;
+-  }, 0);
+-
+-  if (length > 60) {
+-    return braces[0] +
+-           (base === '' ? '' : base + '\n ') +
+-           ' ' +
+-           output.join(',\n  ') +
+-           ' ' +
+-           braces[1];
+-  }
+-
+-  return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1];
+-}
+-
+-
+ // NOTE: These type checking functions intentionally don't use `instanceof`
+ // because it is fragile and can be easily faked with `Object.create()`.
+ function isArray(ar) {
+@@ -522,166 +98,10 @@ function isPrimitive(arg) {
+ exports.isPrimitive = isPrimitive;
+
+ function isBuffer(arg) {
+-  return arg instanceof Buffer;
++  return Buffer.isBuffer(arg);
+ }
+ exports.isBuffer = isBuffer;
+
+ function objectToString(o) {
+   return Object.prototype.toString.call(o);
+-}
+-
+-
+-function pad(n) {
+-  return n < 10 ? '0' + n.toString(10) : n.toString(10);
+-}
+-
+-
+-var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep',
+-              'Oct', 'Nov', 'Dec'];
+-
+-// 26 Feb 16:19:34
+-function timestamp() {
+-  var d = new Date();
+-  var time = [pad(d.getHours()),
+-              pad(d.getMinutes()),
+-              pad(d.getSeconds())].join(':');
+-  return [d.getDate(), months[d.getMonth()], time].join(' ');
+-}
+-
+-
+-// log is just a thin wrapper to console.log that prepends a timestamp
+-exports.log = function() {
+-  console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments));
+-};
+-
+-
+-/**
+- * Inherit the prototype methods from one constructor into another.
+- *
+- * The Function.prototype.inherits from lang.js rewritten as a standalone
+- * function (not on Function.prototype). NOTE: If this file is to be loaded
+- * during bootstrapping this function needs to be rewritten using some native
+- * functions as prototype setup using normal JavaScript does not work as
+- * expected during bootstrapping (see mirror.js in r114903).
+- *
+- * @param {function} ctor Constructor function which needs to inherit the
+- *     prototype.
+- * @param {function} superCtor Constructor function to inherit prototype from.
+- */
+-exports.inherits = function(ctor, superCtor) {
+-  ctor.super_ = superCtor;
+-  ctor.prototype = Object.create(superCtor.prototype, {
+-    constructor: {
+-      value: ctor,
+-      enumerable: false,
+-      writable: true,
+-      configurable: true
+-    }
+-  });
+-};
+-
+-exports._extend = function(origin, add) {
+-  // Don't do anything if add isn't an object
+-  if (!add || !isObject(add)) return origin;
+-
+-  var keys = Object.keys(add);
+-  var i = keys.length;
+-  while (i--) {
+-    origin[keys[i]] = add[keys[i]];
+-  }
+-  return origin;
+-};
+-
+-function hasOwnProperty(obj, prop) {
+-  return Object.prototype.hasOwnProperty.call(obj, prop);
+-}
+-
+-
+-// Deprecated old stuff.
+-
+-exports.p = exports.deprecate(function() {
+-  for (var i = 0, len = arguments.length; i < len; ++i) {
+-    console.error(exports.inspect(arguments[i]));
+-  }
+-}, 'util.p: Use console.error() instead');
+-
+-
+-exports.exec = exports.deprecate(function() {
+-  return require('child_process').exec.apply(this, arguments);
+-}, 'util.exec is now called `child_process.exec`.');
+-
+-
+-exports.print = exports.deprecate(function() {
+-  for (var i = 0, len = arguments.length; i < len; ++i) {
+-    process.stdout.write(String(arguments[i]));
+-  }
+-}, 'util.print: Use console.log instead');
+-
+-
+-exports.puts = exports.deprecate(function() {
+-  for (var i = 0, len = arguments.length; i < len; ++i) {
+-    process.stdout.write(arguments[i] + '\n');
+-  }
+-}, 'util.puts: Use console.log instead');
+-
+-
+-exports.debug = exports.deprecate(function(x) {
+-  process.stderr.write('DEBUG: ' + x + '\n');
+-}, 'util.debug: Use console.error instead');
+-
+-
+-exports.error = exports.deprecate(function(x) {
+-  for (var i = 0, len = arguments.length; i < len; ++i) {
+-    process.stderr.write(arguments[i] + '\n');
+-  }
+-}, 'util.error: Use console.error instead');
+-
+-
+-exports.pump = exports.deprecate(function(readStream, writeStream, callback) {
+-  var callbackCalled = false;
+-
+-  function call(a, b, c) {
+-    if (callback && !callbackCalled) {
+-      callback(a, b, c);
+-      callbackCalled = true;
+-    }
+-  }
+-
+-  readStream.addListener('data', function(chunk) {
+-    if (writeStream.write(chunk) === false) readStream.pause();
+-  });
+-
+-  writeStream.addListener('drain', function() {
+-    readStream.resume();
+-  });
+-
+-  readStream.addListener('end', function() {
+-    writeStream.end();
+-  });
+-
+-  readStream.addListener('close', function() {
+-    call();
+-  });
+-
+-  readStream.addListener('error', function(err) {
+-    writeStream.end();
+-    call(err);
+-  });
+-
+-  writeStream.addListener('error', function(err) {
+-    readStream.destroy();
+-    call(err);
+-  });
+-}, 'util.pump(): Use readableStream.pipe() instead');
+-
+-
+-var uv;
+-exports._errnoException = function(err, syscall) {
+-  if (isUndefined(uv)) uv = process.binding('uv');
+-  var errname = uv.errname(err);
+-  var e = new Error(syscall + ' ' + errname);
+-  e.code = errname;
+-  e.errno = errname;
+-  e.syscall = syscall;
+-  return e;
+-};
++}

goTorrentWebUI/node_modules/superagent/node_modules/core-util-is/lib/util.js

@@ -0,0 +1,107 @@
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// NOTE: These type checking functions intentionally don't use `instanceof`
+// because it is fragile and can be easily faked with `Object.create()`.
+
+function isArray(arg) {
+  if (Array.isArray) {
+    return Array.isArray(arg);
+  }
+  return objectToString(arg) === '[object Array]';
+}
+exports.isArray = isArray;
+
+function isBoolean(arg) {
+  return typeof arg === 'boolean';
+}
+exports.isBoolean = isBoolean;
+
+function isNull(arg) {
+  return arg === null;
+}
+exports.isNull = isNull;
+
+function isNullOrUndefined(arg) {
+  return arg == null;
+}
+exports.isNullOrUndefined = isNullOrUndefined;
+
+function isNumber(arg) {
+  return typeof arg === 'number';
+}
+exports.isNumber = isNumber;
+
+function isString(arg) {
+  return typeof arg === 'string';
+}
+exports.isString = isString;
+
+function isSymbol(arg) {
+  return typeof arg === 'symbol';
+}
+exports.isSymbol = isSymbol;
+
+function isUndefined(arg) {
+  return arg === void 0;
+}
+exports.isUndefined = isUndefined;
+
+function isRegExp(re) {
+  return objectToString(re) === '[object RegExp]';
+}
+exports.isRegExp = isRegExp;
+
+function isObject(arg) {
+  return typeof arg === 'object' && arg !== null;
+}
+exports.isObject = isObject;
+
+function isDate(d) {
+  return objectToString(d) === '[object Date]';
+}
+exports.isDate = isDate;
+
+function isError(e) {
+  return (objectToString(e) === '[object Error]' || e instanceof Error);
+}
+exports.isError = isError;
+
+function isFunction(arg) {
+  return typeof arg === 'function';
+}
+exports.isFunction = isFunction;
+
+function isPrimitive(arg) {
+  return arg === null ||
+         typeof arg === 'boolean' ||
+         typeof arg === 'number' ||
+         typeof arg === 'string' ||
+         typeof arg === 'symbol' ||  // ES6 symbol
+         typeof arg === 'undefined';
+}
+exports.isPrimitive = isPrimitive;
+
+exports.isBuffer = Buffer.isBuffer;
+
+function objectToString(o) {
+  return Object.prototype.toString.call(o);
+}

goTorrentWebUI/node_modules/superagent/node_modules/core-util-is/package.json

@@ -0,0 +1,65 @@
+{
+  "_args": [
+    [
+      "core-util-is@1.0.2",
+      "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project"
+    ]
+  ],
+  "_from": "core-util-is@1.0.2",
+  "_id": "core-util-is@1.0.2",
+  "_inBundle": false,
+  "_integrity": "sha1-tf1UIgqivFq1eqtxQMlAdUUDwac=",
+  "_location": "/superagent/core-util-is",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "core-util-is@1.0.2",
+    "name": "core-util-is",
+    "escapedName": "core-util-is",
+    "rawSpec": "1.0.2",
+    "saveSpec": null,
+    "fetchSpec": "1.0.2"
+  },
+  "_requiredBy": [
+    "/superagent/readable-stream"
+  ],
+  "_resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.2.tgz",
+  "_spec": "1.0.2",
+  "_where": "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project",
+  "author": {
+    "name": "Isaac Z. Schlueter",
+    "email": "i@izs.me",
+    "url": "http://blog.izs.me/"
+  },
+  "bugs": {
+    "url": "https://github.com/isaacs/core-util-is/issues"
+  },
+  "description": "The `util.is*` functions introduced in Node v0.12.",
+  "devDependencies": {
+    "tap": "^2.3.0"
+  },
+  "homepage": "https://github.com/isaacs/core-util-is#readme",
+  "keywords": [
+    "util",
+    "isBuffer",
+    "isArray",
+    "isNumber",
+    "isString",
+    "isRegExp",
+    "isThis",
+    "isThat",
+    "polyfill"
+  ],
+  "license": "MIT",
+  "main": "lib/util.js",
+  "name": "core-util-is",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/isaacs/core-util-is.git"
+  },
+  "scripts": {
+    "test": "tap test.js"
+  },
+  "version": "1.0.2"
+}

goTorrentWebUI/node_modules/superagent/node_modules/core-util-is/test.js

@@ -0,0 +1,68 @@
+var assert = require('tap');
+
+var t = require('./lib/util');
+
+assert.equal(t.isArray([]), true);
+assert.equal(t.isArray({}), false);
+
+assert.equal(t.isBoolean(null), false);
+assert.equal(t.isBoolean(true), true);
+assert.equal(t.isBoolean(false), true);
+
+assert.equal(t.isNull(null), true);
+assert.equal(t.isNull(undefined), false);
+assert.equal(t.isNull(false), false);
+assert.equal(t.isNull(), false);
+
+assert.equal(t.isNullOrUndefined(null), true);
+assert.equal(t.isNullOrUndefined(undefined), true);
+assert.equal(t.isNullOrUndefined(false), false);
+assert.equal(t.isNullOrUndefined(), true);
+
+assert.equal(t.isNumber(null), false);
+assert.equal(t.isNumber('1'), false);
+assert.equal(t.isNumber(1), true);
+
+assert.equal(t.isString(null), false);
+assert.equal(t.isString('1'), true);
+assert.equal(t.isString(1), false);
+
+assert.equal(t.isSymbol(null), false);
+assert.equal(t.isSymbol('1'), false);
+assert.equal(t.isSymbol(1), false);
+assert.equal(t.isSymbol(Symbol()), true);
+
+assert.equal(t.isUndefined(null), false);
+assert.equal(t.isUndefined(undefined), true);
+assert.equal(t.isUndefined(false), false);
+assert.equal(t.isUndefined(), true);
+
+assert.equal(t.isRegExp(null), false);
+assert.equal(t.isRegExp('1'), false);
+assert.equal(t.isRegExp(new RegExp()), true);
+
+assert.equal(t.isObject({}), true);
+assert.equal(t.isObject([]), true);
+assert.equal(t.isObject(new RegExp()), true);
+assert.equal(t.isObject(new Date()), true);
+
+assert.equal(t.isDate(null), false);
+assert.equal(t.isDate('1'), false);
+assert.equal(t.isDate(new Date()), true);
+
+assert.equal(t.isError(null), false);
+assert.equal(t.isError({ err: true }), false);
+assert.equal(t.isError(new Error()), true);
+
+assert.equal(t.isFunction(null), false);
+assert.equal(t.isFunction({ }), false);
+assert.equal(t.isFunction(function() {}), true);
+
+assert.equal(t.isPrimitive(null), true);
+assert.equal(t.isPrimitive(''), true);
+assert.equal(t.isPrimitive(0), true);
+assert.equal(t.isPrimitive(new Date()), false);
+
+assert.equal(t.isBuffer(null), false);
+assert.equal(t.isBuffer({}), false);
+assert.equal(t.isBuffer(new Buffer(0)), true);

goTorrentWebUI/node_modules/superagent/node_modules/debug/.coveralls.yml

@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve

goTorrentWebUI/node_modules/superagent/node_modules/debug/.eslintrc

@@ -0,0 +1,14 @@
+{
+  "env": {
+    "browser": true,
+    "node": true
+  },
+  "globals": {
+    "chrome": true
+  },
+  "rules": {
+    "no-console": 0,
+    "no-empty": [1, { "allowEmptyCatch": true }]
+  },
+  "extends": "eslint:recommended"
+}

goTorrentWebUI/node_modules/superagent/node_modules/debug/.npmignore

@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json

goTorrentWebUI/node_modules/superagent/node_modules/debug/.travis.yml

@@ -0,0 +1,20 @@
+sudo: false
+
+language: node_js
+
+node_js:
+  - "4"
+  - "6"
+  - "8"
+
+install:
+  - make install
+
+script:
+  - make lint
+  - make test
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

goTorrentWebUI/node_modules/superagent/node_modules/debug/CHANGELOG.md

@@ -0,0 +1,395 @@
+
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
+2.6.9 / 2017-09-22
+==================
+
+  * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+  * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+  * Fix: Inline extend function in node implementation (#452, @dougwilson)
+  * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+  
+  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+  * Misc: clean up browser reference checks (#447, @thebigredgeek)
+  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+  * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+  * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+  * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+  * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+  * Docs: fixed README typo (#391, @lurch)
+  * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+  * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+  * Fix: wrong reference in bower file (@thebigredgeek)
+  * Fix: webworker compatibility (@thebigredgeek)
+  * Fix: output formatting issue (#388, @kribblo)
+  * Fix: babel-loader compatibility (#383, @escwald)
+  * Misc: removed built asset from repo and publications (@thebigredgeek)
+  * Misc: moved source files to /src (#378, @yamikuronue)
+  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+  * Test: coveralls integration (#378, @yamikuronue)
+  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+  * Fix: custom log function (#379, @hsiliev)
+  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+  * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+  * Fix: browser colors (#367, @tootallnate)
+  * Misc: travis ci integration (@thebigredgeek)
+  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+  * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+  * Fix: revert "handle regex special characters" (@tootallnate)
+  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+  * Improvement: allow colors in workers (#335, @botverse)
+  * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+  * Fix: be super-safe in index.js as well (@TooTallNate)
+  * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+  * Fix: Added electron compatibility (#324, @paulcbetts)
+  * Improvement: Added performance optimizations (@tootallnate)
+  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+  * Readme: fix USE_COLORS to DEBUG_COLORS
+  * Readme: Doc fixes for format string sugar (#269, @mlucool)
+  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+  * Readme: better docs for browser support (#224, @matthewmueller)
+  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+  * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release

goTorrentWebUI/node_modules/superagent/node_modules/debug/LICENSE

@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
+and associated documentation files (the 'Software'), to deal in the Software without restriction, 
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial 
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+

goTorrentWebUI/node_modules/superagent/node_modules/debug/Makefile

@@ -0,0 +1,58 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+install: node_modules
+
+browser: dist/debug.js
+
+node_modules: package.json
+	@NODE_ENV= $(PKG) install
+	@touch node_modules
+
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
+	@$(BROWSERIFY) \
+		--standalone debug \
+		. > dist/debug.js
+
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
+		"make test-node" \
+		"make test-browser"
+
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
+
+.PHONY: browser install clean lint test test-all test-node test-browser

goTorrentWebUI/node_modules/superagent/node_modules/debug/README.md

@@ -0,0 +1,368 @@
+# debug
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
+
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
+
+#### Windows note
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Note that PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Then, run the program to be debugged as usual.
+
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

goTorrentWebUI/node_modules/superagent/node_modules/debug/karma.conf.js

@@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+  config.set({
+
+    // base path that will be used to resolve all patterns (eg. files, exclude)
+    basePath: '',
+
+
+    // frameworks to use
+    // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+    frameworks: ['mocha', 'chai', 'sinon'],
+
+
+    // list of files / patterns to load in the browser
+    files: [
+      'dist/debug.js',
+      'test/*spec.js'
+    ],
+
+
+    // list of files to exclude
+    exclude: [
+      'src/node.js'
+    ],
+
+
+    // preprocess matching files before serving them to the browser
+    // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+    preprocessors: {
+    },
+
+    // test results reporter to use
+    // possible values: 'dots', 'progress'
+    // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+    reporters: ['progress'],
+
+
+    // web server port
+    port: 9876,
+
+
+    // enable / disable colors in the output (reporters and logs)
+    colors: true,
+
+
+    // level of logging
+    // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+    logLevel: config.LOG_INFO,
+
+
+    // enable / disable watching file and executing tests whenever any file changes
+    autoWatch: true,
+
+
+    // start these browsers
+    // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+    browsers: ['PhantomJS'],
+
+
+    // Continuous Integration mode
+    // if true, Karma captures browsers, runs the tests and exits
+    singleRun: false,
+
+    // Concurrency level
+    // how many browser should be started simultaneous
+    concurrency: Infinity
+  })
+}

goTorrentWebUI/node_modules/superagent/node_modules/debug/node.js

@@ -0,0 +1 @@
+module.exports = require('./src/node');

goTorrentWebUI/node_modules/superagent/node_modules/debug/package.json

@@ -0,0 +1,85 @@
+{
+  "_args": [
+    [
+      "debug@3.1.0",
+      "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project"
+    ]
+  ],
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
+  "_inBundle": false,
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
+  "_location": "/superagent/debug",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "debug@3.1.0",
+    "name": "debug",
+    "escapedName": "debug",
+    "rawSpec": "3.1.0",
+    "saveSpec": null,
+    "fetchSpec": "3.1.0"
+  },
+  "_requiredBy": [
+    "/superagent"
+  ],
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
+  "_where": "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project",
+  "author": {
+    "name": "TJ Holowaychuk",
+    "email": "tj@vision-media.ca"
+  },
+  "browser": "./src/browser.js",
+  "bugs": {
+    "url": "https://github.com/visionmedia/debug/issues"
+  },
+  "contributors": [
+    {
+      "name": "Nathan Rajlich",
+      "email": "nathan@tootallnate.net",
+      "url": "http://n8.io"
+    },
+    {
+      "name": "Andrew Rhyne",
+      "email": "rhyneandrew@gmail.com"
+    }
+  ],
+  "dependencies": {
+    "ms": "2.0.0"
+  },
+  "description": "small debugging utility",
+  "devDependencies": {
+    "browserify": "14.4.0",
+    "chai": "^3.5.0",
+    "concurrently": "^3.1.0",
+    "coveralls": "^2.11.15",
+    "eslint": "^3.12.1",
+    "istanbul": "^0.4.5",
+    "karma": "^1.3.0",
+    "karma-chai": "^0.1.0",
+    "karma-mocha": "^1.3.0",
+    "karma-phantomjs-launcher": "^1.0.2",
+    "karma-sinon": "^1.0.5",
+    "mocha": "^3.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "rimraf": "^2.5.4",
+    "sinon": "^1.17.6",
+    "sinon-chai": "^2.8.0"
+  },
+  "homepage": "https://github.com/visionmedia/debug#readme",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "license": "MIT",
+  "main": "./src/index.js",
+  "name": "debug",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/visionmedia/debug.git"
+  },
+  "version": "3.1.0"
+}

goTorrentWebUI/node_modules/superagent/node_modules/debug/src/browser.js

@@ -0,0 +1,195 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+               && 'undefined' != typeof chrome.storage
+                  ? chrome.storage.local
+                  : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+  '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC',
+  '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF',
+  '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC',
+  '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF',
+  '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC',
+  '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033',
+  '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366',
+  '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933',
+  '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC',
+  '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF',
+  '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+  // NB: In an Electron preload script, document will be defined but not fully
+  // initialized. Since we know we're in Chrome, we'll just detect this case
+  // explicitly
+  if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+    return true;
+  }
+
+  // Internet Explorer and Edge do not support colors.
+  if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+    return false;
+  }
+
+  // is webkit? http://stackoverflow.com/a/16459606/376773
+  // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+  return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+    // is firebug? http://stackoverflow.com/a/398120/376773
+    (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+    // is firefox >= v31?
+    // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+    // double check webkit in userAgent just in case we are in a worker
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+  try {
+    return JSON.stringify(v);
+  } catch (err) {
+    return '[UnexpectedJSONParseError]: ' + err.message;
+  }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var useColors = this.useColors;
+
+  args[0] = (useColors ? '%c' : '')
+    + this.namespace
+    + (useColors ? ' %c' : ' ')
+    + args[0]
+    + (useColors ? '%c ' : ' ')
+    + '+' + exports.humanize(this.diff);
+
+  if (!useColors) return;
+
+  var c = 'color: ' + this.color;
+  args.splice(1, 0, c, 'color: inherit')
+
+  // the final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-zA-Z%]/g, function(match) {
+    if ('%%' === match) return;
+    index++;
+    if ('%c' === match) {
+      // we only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+
+  args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+  // this hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return 'object' === typeof console
+    && console.log
+    && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  try {
+    if (null == namespaces) {
+      exports.storage.removeItem('debug');
+    } else {
+      exports.storage.debug = namespaces;
+    }
+  } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  var r;
+  try {
+    r = exports.storage.debug;
+  } catch(e) {}
+
+  // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+  if (!r && typeof process !== 'undefined' && 'env' in process) {
+    r = process.env.DEBUG;
+  }
+
+  return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+  try {
+    return window.localStorage;
+  } catch (e) {}
+}

goTorrentWebUI/node_modules/superagent/node_modules/debug/src/debug.js

@@ -0,0 +1,225 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * Active `debug` instances.
+ */
+exports.instances = [];
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+  var hash = 0, i;
+
+  for (i in namespace) {
+    hash  = ((hash << 5) - hash) + namespace.charCodeAt(i);
+    hash |= 0; // Convert to 32bit integer
+  }
+
+  return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+  var prevTime;
+
+  function debug() {
+    // disabled?
+    if (!debug.enabled) return;
+
+    var self = debug;
+
+    // set `diff` timestamp
+    var curr = +new Date();
+    var ms = curr - (prevTime || curr);
+    self.diff = ms;
+    self.prev = prevTime;
+    self.curr = curr;
+    prevTime = curr;
+
+    // turn the `arguments` into a proper Array
+    var args = new Array(arguments.length);
+    for (var i = 0; i < args.length; i++) {
+      args[i] = arguments[i];
+    }
+
+    args[0] = exports.coerce(args[0]);
+
+    if ('string' !== typeof args[0]) {
+      // anything else let's inspect with %O
+      args.unshift('%O');
+    }
+
+    // apply any `formatters` transformations
+    var index = 0;
+    args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+      // if we encounter an escaped % then don't increase the array index
+      if (match === '%%') return match;
+      index++;
+      var formatter = exports.formatters[format];
+      if ('function' === typeof formatter) {
+        var val = args[index];
+        match = formatter.call(self, val);
+
+        // now we need to remove `args[index]` since it's inlined in the `format`
+        args.splice(index, 1);
+        index--;
+      }
+      return match;
+    });
+
+    // apply env-specific formatting (colors, etc.)
+    exports.formatArgs.call(self, args);
+
+    var logFn = debug.log || exports.log || console.log.bind(console);
+    logFn.apply(self, args);
+  }
+
+  debug.namespace = namespace;
+  debug.enabled = exports.enabled(namespace);
+  debug.useColors = exports.useColors();
+  debug.color = selectColor(namespace);
+  debug.destroy = destroy;
+
+  // env-specific initialization logic for debug instances
+  if ('function' === typeof exports.init) {
+    exports.init(debug);
+  }
+
+  exports.instances.push(debug);
+
+  return debug;
+}
+
+function destroy () {
+  var index = exports.instances.indexOf(this);
+  if (index !== -1) {
+    exports.instances.splice(index, 1);
+    return true;
+  } else {
+    return false;
+  }
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+  exports.save(namespaces);
+
+  exports.names = [];
+  exports.skips = [];
+
+  var i;
+  var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+  var len = split.length;
+
+  for (i = 0; i < len; i++) {
+    if (!split[i]) continue; // ignore empty strings
+    namespaces = split[i].replace(/\*/g, '.*?');
+    if (namespaces[0] === '-') {
+      exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+    } else {
+      exports.names.push(new RegExp('^' + namespaces + '$'));
+    }
+  }
+
+  for (i = 0; i < exports.instances.length; i++) {
+    var instance = exports.instances[i];
+    instance.enabled = exports.enabled(instance.namespace);
+  }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+  exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+  if (name[name.length - 1] === '*') {
+    return true;
+  }
+  var i, len;
+  for (i = 0, len = exports.skips.length; i < len; i++) {
+    if (exports.skips[i].test(name)) {
+      return false;
+    }
+  }
+  for (i = 0, len = exports.names.length; i < len; i++) {
+    if (exports.names[i].test(name)) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+  if (val instanceof Error) return val.stack || val.message;
+  return val;
+}

goTorrentWebUI/node_modules/superagent/node_modules/debug/src/index.js

@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process === 'undefined' || process.type === 'renderer') {
+  module.exports = require('./browser.js');
+} else {
+  module.exports = require('./node.js');
+}

goTorrentWebUI/node_modules/superagent/node_modules/debug/src/node.js

@@ -0,0 +1,186 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [ 6, 2, 3, 4, 5, 1 ];
+
+try {
+  var supportsColor = require('supports-color');
+  if (supportsColor && supportsColor.level >= 2) {
+    exports.colors = [
+      20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68,
+      69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134,
+      135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171,
+      172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204,
+      205, 206, 207, 208, 209, 214, 215, 220, 221
+    ];
+  }
+} catch (err) {
+  // swallow - we only care if `supports-color` is available; it doesn't have to be.
+}
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ *   $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+  return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+  // camel-case
+  var prop = key
+    .substring(6)
+    .toLowerCase()
+    .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+  // coerce string value into JS value
+  var val = process.env[key];
+  if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+  else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+  else if (val === 'null') val = null;
+  else val = Number(val);
+
+  obj[prop] = val;
+  return obj;
+}, {});
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+  return 'colors' in exports.inspectOpts
+    ? Boolean(exports.inspectOpts.colors)
+    : tty.isatty(process.stderr.fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts)
+    .split('\n').map(function(str) {
+      return str.trim()
+    }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var name = this.namespace;
+  var useColors = this.useColors;
+
+  if (useColors) {
+    var c = this.color;
+    var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c);
+    var prefix = '  ' + colorCode + ';1m' + name + ' ' + '\u001b[0m';
+
+    args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+    args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+  } else {
+    args[0] = getDate() + name + ' ' + args[0];
+  }
+}
+
+function getDate() {
+  if (exports.inspectOpts.hideDate) {
+    return '';
+  } else {
+    return new Date().toISOString() + ' ';
+  }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to stderr.
+ */
+
+function log() {
+  return process.stderr.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  if (null == namespaces) {
+    // If you set a process.env field to null or undefined, it gets cast to the
+    // string 'null' or 'undefined'. Just delete instead.
+    delete process.env.DEBUG;
+  } else {
+    process.env.DEBUG = namespaces;
+  }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  return process.env.DEBUG;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+  debug.inspectOpts = {};
+
+  var keys = Object.keys(exports.inspectOpts);
+  for (var i = 0; i < keys.length; i++) {
+    debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+  }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());

goTorrentWebUI/node_modules/superagent/node_modules/delayed-stream/.npmignore

@@ -0,0 +1 @@
+test

goTorrentWebUI/node_modules/superagent/node_modules/delayed-stream/License

@@ -0,0 +1,19 @@
+Copyright (c) 2011 Debuggable Limited <felix@debuggable.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

goTorrentWebUI/node_modules/superagent/node_modules/delayed-stream/Makefile

@@ -0,0 +1,7 @@
+SHELL := /bin/bash
+
+test:
+	@./test/run.js
+
+.PHONY: test
+

goTorrentWebUI/node_modules/superagent/node_modules/delayed-stream/Readme.md

@@ -0,0 +1,141 @@
+# delayed-stream
+
+Buffers events from a stream until you are ready to handle them.
+
+## Installation
+
+``` bash
+npm install delayed-stream
+```
+
+## Usage
+
+The following example shows how to write a http echo server that delays its
+response by 1000 ms.
+
+``` javascript
+var DelayedStream = require('delayed-stream');
+var http = require('http');
+
+http.createServer(function(req, res) {
+  var delayed = DelayedStream.create(req);
+
+  setTimeout(function() {
+    res.writeHead(200);
+    delayed.pipe(res);
+  }, 1000);
+});
+```
+
+If you are not using `Stream#pipe`, you can also manually release the buffered
+events by calling `delayedStream.resume()`:
+
+``` javascript
+var delayed = DelayedStream.create(req);
+
+setTimeout(function() {
+  // Emit all buffered events and resume underlaying source
+  delayed.resume();
+}, 1000);
+```
+
+## Implementation
+
+In order to use this meta stream properly, here are a few things you should
+know about the implementation.
+
+### Event Buffering / Proxying
+
+All events of the `source` stream are hijacked by overwriting the `source.emit`
+method. Until node implements a catch-all event listener, this is the only way.
+
+However, delayed-stream still continues to emit all events it captures on the
+`source`, regardless of whether you have released the delayed stream yet or
+not.
+
+Upon creation, delayed-stream captures all `source` events and stores them in
+an internal event buffer. Once `delayedStream.release()` is called, all
+buffered events are emitted on the `delayedStream`, and the event buffer is
+cleared. After that, delayed-stream merely acts as a proxy for the underlaying
+source.
+
+### Error handling
+
+Error events on `source` are buffered / proxied just like any other events.
+However, `delayedStream.create` attaches a no-op `'error'` listener to the
+`source`. This way you only have to handle errors on the `delayedStream`
+object, rather than in two places.
+
+### Buffer limits
+
+delayed-stream provides a `maxDataSize` property that can be used to limit
+the amount of data being buffered. In order to protect you from bad `source`
+streams that don't react to `source.pause()`, this feature is enabled by
+default.
+
+## API
+
+### DelayedStream.create(source, [options])
+
+Returns a new `delayedStream`. Available options are:
+
+* `pauseStream`
+* `maxDataSize`
+
+The description for those properties can be found below.
+
+### delayedStream.source
+
+The `source` stream managed by this object. This is useful if you are
+passing your `delayedStream` around, and you still want to access properties
+on the `source` object.
+
+### delayedStream.pauseStream = true
+
+Whether to pause the underlaying `source` when calling
+`DelayedStream.create()`. Modifying this property afterwards has no effect.
+
+### delayedStream.maxDataSize = 1024 * 1024
+
+The amount of data to buffer before emitting an `error`.
+
+If the underlaying source is emitting `Buffer` objects, the `maxDataSize`
+refers to bytes.
+
+If the underlaying source is emitting JavaScript strings, the size refers to
+characters.
+
+If you know what you are doing, you can set this property to `Infinity` to
+disable this feature. You can also modify this property during runtime.
+
+### delayedStream.dataSize = 0
+
+The amount of data buffered so far.
+
+### delayedStream.readable
+
+An ECMA5 getter that returns the value of `source.readable`.
+
+### delayedStream.resume()
+
+If the `delayedStream` has not been released so far, `delayedStream.release()`
+is called.
+
+In either case, `source.resume()` is called.
+
+### delayedStream.pause()
+
+Calls `source.pause()`.
+
+### delayedStream.pipe(dest)
+
+Calls `delayedStream.resume()` and then proxies the arguments to `source.pipe`.
+
+### delayedStream.release()
+
+Emits and clears all events that have been buffered up so far. This does not
+resume the underlaying source, use `delayedStream.resume()` instead.
+
+## License
+
+delayed-stream is licensed under the MIT license.

goTorrentWebUI/node_modules/superagent/node_modules/delayed-stream/lib/delayed_stream.js

@@ -0,0 +1,107 @@
+var Stream = require('stream').Stream;
+var util = require('util');
+
+module.exports = DelayedStream;
+function DelayedStream() {
+  this.source = null;
+  this.dataSize = 0;
+  this.maxDataSize = 1024 * 1024;
+  this.pauseStream = true;
+
+  this._maxDataSizeExceeded = false;
+  this._released = false;
+  this._bufferedEvents = [];
+}
+util.inherits(DelayedStream, Stream);
+
+DelayedStream.create = function(source, options) {
+  var delayedStream = new this();
+
+  options = options || {};
+  for (var option in options) {
+    delayedStream[option] = options[option];
+  }
+
+  delayedStream.source = source;
+
+  var realEmit = source.emit;
+  source.emit = function() {
+    delayedStream._handleEmit(arguments);
+    return realEmit.apply(source, arguments);
+  };
+
+  source.on('error', function() {});
+  if (delayedStream.pauseStream) {
+    source.pause();
+  }
+
+  return delayedStream;
+};
+
+Object.defineProperty(DelayedStream.prototype, 'readable', {
+  configurable: true,
+  enumerable: true,
+  get: function() {
+    return this.source.readable;
+  }
+});
+
+DelayedStream.prototype.setEncoding = function() {
+  return this.source.setEncoding.apply(this.source, arguments);
+};
+
+DelayedStream.prototype.resume = function() {
+  if (!this._released) {
+    this.release();
+  }
+
+  this.source.resume();
+};
+
+DelayedStream.prototype.pause = function() {
+  this.source.pause();
+};
+
+DelayedStream.prototype.release = function() {
+  this._released = true;
+
+  this._bufferedEvents.forEach(function(args) {
+    this.emit.apply(this, args);
+  }.bind(this));
+  this._bufferedEvents = [];
+};
+
+DelayedStream.prototype.pipe = function() {
+  var r = Stream.prototype.pipe.apply(this, arguments);
+  this.resume();
+  return r;
+};
+
+DelayedStream.prototype._handleEmit = function(args) {
+  if (this._released) {
+    this.emit.apply(this, args);
+    return;
+  }
+
+  if (args[0] === 'data') {
+    this.dataSize += args[1].length;
+    this._checkIfMaxDataSizeExceeded();
+  }
+
+  this._bufferedEvents.push(args);
+};
+
+DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() {
+  if (this._maxDataSizeExceeded) {
+    return;
+  }
+
+  if (this.dataSize <= this.maxDataSize) {
+    return;
+  }
+
+  this._maxDataSizeExceeded = true;
+  var message =
+    'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'
+  this.emit('error', new Error(message));
+};

goTorrentWebUI/node_modules/superagent/node_modules/delayed-stream/package.json

@@ -0,0 +1,65 @@
+{
+  "_args": [
+    [
+      "delayed-stream@1.0.0",
+      "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project"
+    ]
+  ],
+  "_from": "delayed-stream@1.0.0",
+  "_id": "delayed-stream@1.0.0",
+  "_inBundle": false,
+  "_integrity": "sha1-3zrhmayt+31ECqrgsp4icrJOxhk=",
+  "_location": "/superagent/delayed-stream",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "delayed-stream@1.0.0",
+    "name": "delayed-stream",
+    "escapedName": "delayed-stream",
+    "rawSpec": "1.0.0",
+    "saveSpec": null,
+    "fetchSpec": "1.0.0"
+  },
+  "_requiredBy": [
+    "/superagent/combined-stream"
+  ],
+  "_resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz",
+  "_spec": "1.0.0",
+  "_where": "C:\\Users\\deranjer\\go\\src\\github.com\\deranjer\\goTorrent\\torrent-project",
+  "author": {
+    "name": "Felix Geisendörfer",
+    "email": "felix@debuggable.com",
+    "url": "http://debuggable.com/"
+  },
+  "bugs": {
+    "url": "https://github.com/felixge/node-delayed-stream/issues"
+  },
+  "contributors": [
+    {
+      "name": "Mike Atkins",
+      "email": "apeherder@gmail.com"
+    }
+  ],
+  "dependencies": {},
+  "description": "Buffers events from a stream until you are ready to handle them.",
+  "devDependencies": {
+    "fake": "0.2.0",
+    "far": "0.0.1"
+  },
+  "engines": {
+    "node": ">=0.4.0"
+  },
+  "homepage": "https://github.com/felixge/node-delayed-stream",
+  "license": "MIT",
+  "main": "./lib/delayed_stream",
+  "name": "delayed-stream",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/felixge/node-delayed-stream.git"
+  },
+  "scripts": {
+    "test": "make test"
+  },
+  "version": "1.0.0"
+}

goTorrentWebUI/node_modules/superagent/node_modules/extend/.eslintrc

@@ -0,0 +1,17 @@
+{
+	"root": true,
+
+	"extends": "@ljharb",
+
+	"rules": {
+		"complexity": [2, 15],
+		"eqeqeq": [2, "allow-null"],
+		"func-name-matching": [1],
+		"max-depth": [1, 4],
+		"max-statements": [2, 26],
+		"no-extra-parens": [1],
+		"no-magic-numbers": [0],
+		"no-restricted-syntax": [2, "BreakStatement", "ContinueStatement", "DebuggerStatement", "LabeledStatement", "WithStatement"],
+		"sort-keys": [0],
+	}
+}

goTorrentWebUI/node_modules/superagent/node_modules/extend/.jscs.json

@@ -0,0 +1,175 @@
+{
+	"es3": true,
+
+	"additionalRules": [],
+
+	"requireSemicolons": true,
+
+	"disallowMultipleSpaces": true,
+
+	"disallowIdentifierNames": [],
+
+	"requireCurlyBraces": {
+		"allExcept": [],
+		"keywords": ["if", "else", "for", "while", "do", "try", "catch"]
+	},
+
+	"requireSpaceAfterKeywords": ["if", "else", "for", "while", "do", "switch", "return", "try", "catch", "function"],
+
+	"disallowSpaceAfterKeywords": [],
+
+	"disallowSpaceBeforeComma": true,
+	"disallowSpaceAfterComma": false,
+	"disallowSpaceBeforeSemicolon": true,
+
+	"disallowNodeTypes": [
+		"DebuggerStatement",
+		"LabeledStatement",
+		"SwitchCase",
+		"SwitchStatement",
+		"WithStatement"
+	],
+
+	"requireObjectKeysOnNewLine": { "allExcept": ["sameLine"] },
+
+	"requireSpacesInAnonymousFunctionExpression": { "beforeOpeningRoundBrace": true, "beforeOpeningCurlyBrace": true },
+	"requireSpacesInNamedFunctionExpression": { "beforeOpeningCurlyBrace": true },
+	"disallowSpacesInNamedFunctionExpression": { "beforeOpeningRoundBrace": true },
+	"requireSpacesInFunctionDeclaration": { "beforeOpeningCurlyBrace": true },
+	"disallowSpacesInFunctionDeclaration": { "beforeOpeningRoundBrace": true },
+
+	"requireSpaceBetweenArguments": true,
+
+	"disallowSpacesInsideParentheses": true,
+
+	"disallowSpacesInsideArrayBrackets": true,
+
+	"disallowQuotedKeysInObjects": { "allExcept": ["reserved"] },
+
+	"disallowSpaceAfterObjectKeys": true,
+
+	"requireCommaBeforeLineBreak": true,
+
+	"disallowSpaceAfterPrefixUnaryOperators": ["++", "--", "+", "-", "~", "!"],
+	"requireSpaceAfterPrefixUnaryOperators": [],
+
+	"disallowSpaceBeforePostfixUnaryOperators": ["++", "--"],
+	"requireSpaceBeforePostfixUnaryOperators": [],
+
+	"disallowSpaceBeforeBinaryOperators": [],
+	"requireSpaceBeforeBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="],
+
+	"requireSpaceAfterBinaryOperators": ["+", "-", "/", "*", "=", "==", "===", "!=", "!=="],
+	"disallowSpaceAfterBinaryOperators": [],
+
+	"disallowImplicitTypeConversion": ["binary", "string"],
+
+	"disallowKeywords": ["with", "eval"],
+
+	"requireKeywordsOnNewLine": [],
+	"disallowKeywordsOnNewLine": ["else"],
+
+	"requireLineFeedAtFileEnd": true,
+
+	"disallowTrailingWhitespace": true,
+
+	"disallowTrailingComma": true,
+
+	"excludeFiles": ["node_modules/**", "vendor/**"],
+
+	"disallowMultipleLineStrings": true,
+
+	"requireDotNotation": { "allExcept": ["keywords"] },
+
+	"requireParenthesesAroundIIFE": true,
+
+	"validateLineBreaks": "LF",
+
+	"validateQuoteMarks": {
+		"escape": true,
+		"mark": "'"
+	},
+
+	"disallowOperatorBeforeLineBreak": [],
+
+	"requireSpaceBeforeKeywords": [
+		"do",
+		"for",
+		"if",
+		"else",
+		"switch",
+		"case",
+		"try",
+		"catch",
+		"finally",
+		"while",
+		"with",
+		"return"
+	],
+
+	"validateAlignedFunctionParameters": {
+		"lineBreakAfterOpeningBraces": true,
+		"lineBreakBeforeClosingBraces": true
+	},
+
+	"requirePaddingNewLinesBeforeExport": true,
+
+	"validateNewlineAfterArrayElements": {
+		"maximum": 6
+	},
+
+	"requirePaddingNewLinesAfterUseStrict": true,
+
+	"disallowArrowFunctions": true,
+
+	"disallowMultiLineTernary": true,
+
+	"validateOrderInObjectKeys": false,
+
+	"disallowIdenticalDestructuringNames": true,
+
+	"disallowNestedTernaries": { "maxLevel": 1 },
+
+	"requireSpaceAfterComma": { "allExcept": ["trailing"] },
+	"requireAlignedMultilineParams": false,
+
+	"requireSpacesInGenerator": {
+		"afterStar": true
+	},
+
+	"disallowSpacesInGenerator": {
+		"beforeStar": true
+	},
+
+	"disallowVar": false,
+
+	"requireArrayDestructuring": false,
+
+	"requireEnhancedObjectLiterals": false,
+
+	"requireObjectDestructuring": false,
+
+	"requireEarlyReturn": false,
+
+	"requireCapitalizedConstructorsNew": {
+		"allExcept": ["Function", "String", "Object", "Symbol", "Number", "Date", "RegExp", "Error", "Boolean", "Array"]
+	},
+
+	"requireImportAlphabetized": false,
+
+    "requireSpaceBeforeObjectValues": true,
+    "requireSpaceBeforeDestructuredValues": true,
+
+	"disallowSpacesInsideTemplateStringPlaceholders": true,
+
+    "disallowArrayDestructuringReturn": false,
+
+    "requireNewlineBeforeSingleStatementsInIf": false,
+
+	"disallowUnusedVariables": true,
+
+	"requireSpacesInsideImportedObjectBraces": true,
+
+	"requireUseStrict": true
+}
+

goTorrentWebUI/node_modules/superagent/node_modules/extend/.npmignore

@@ -0,0 +1 @@
+test

goTorrentWebUI/node_modules/superagent/node_modules/extend/.travis.yml

@@ -0,0 +1,179 @@
+language: node_js
+os:
+ - linux
+node_js:
+  - "7.9"
+  - "6.10"
+  - "5.12"
+  - "4.8"
+  - "iojs-v3.3"
+  - "iojs-v2.5"
+  - "iojs-v1.8"
+  - "0.12"
+  - "0.10"
+  - "0.8"
+before_install:
+  - 'if [ "${TRAVIS_NODE_VERSION}" = "0.6" ]; then npm install -g npm@1.3 ; elif [ "${TRAVIS_NODE_VERSION}" != "0.9" ]; then case "$(npm --version)" in 1.*) npm install -g npm@1.4.28 ;; 2.*) npm install -g npm@2 ;; esac ; fi'
+  - 'if [ "${TRAVIS_NODE_VERSION}" != "0.6" ] && [ "${TRAVIS_NODE_VERSION}" != "0.9" ]; then npm install -g npm; fi'
+install:
+  - 'if [ "${TRAVIS_NODE_VERSION}" = "0.6" ]; then nvm install 0.8 && npm install -g npm@1.3 && npm install -g npm@1.4.28 && npm install -g npm@2 && npm install && nvm use "${TRAVIS_NODE_VERSION}"; else npm install; fi;'
+script:
+  - 'if [ -n "${PRETEST-}" ]; then npm run pretest ; fi'
+  - 'if [ -n "${POSTTEST-}" ]; then npm run posttest ; fi'
+  - 'if [ -n "${COVERAGE-}" ]; then npm run coverage ; fi'
+  - 'if [ -n "${TEST-}" ]; then npm run tests-only ; fi'
+sudo: false
+env:
+  - TEST=true
+matrix:
+  fast_finish: true
+  include:
+    - node_js: "node"
+      env: PRETEST=true
+    - node_js: "node"
+      env: COVERAGE=true
+    - node_js: "7.8"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.7"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.6"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.5"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.4"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.3"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.2"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.1"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "7.0"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.9"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.8"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.7"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.6"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.5"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.4"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.3"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.2"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.1"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "6.0"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.11"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.10"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.9"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.8"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.7"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.6"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.5"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.4"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.3"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.2"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.1"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "5.0"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.7"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.6"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.5"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.4"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.3"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.2"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.1"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "4.0"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v3.2"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v3.1"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v3.0"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v2.4"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v2.3"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v2.2"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v2.1"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v2.0"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.7"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.6"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.5"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.4"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.3"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.2"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.1"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "iojs-v1.0"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "0.11"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "0.9"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "0.6"
+      env: TEST=true ALLOW_FAILURE=true
+    - node_js: "0.4"
+      env: TEST=true ALLOW_FAILURE=true
+    ##- node_js: "7"
+      #env: TEST=true
+      #os: osx
+    #- node_js: "6"
+      #env: TEST=true
+      #os: osx
+    #- node_js: "5"
+      #env: TEST=true
+      #os: osx
+    #- node_js: "4"
+      #env: TEST=true
+      #os: osx
+    #- node_js: "iojs"
+      #env: TEST=true
+      #os: osx
+    #- node_js: "0.12"
+      #env: TEST=true
+      #os: osx
+    #- node_js: "0.10"
+      #env: TEST=true
+      #os: osx
+    #- node_js: "0.8"
+      #env: TEST=true
+      #os: osx
+  allow_failures:
+    - os: osx
+    - env: TEST=true ALLOW_FAILURE=true

goTorrentWebUI/node_modules/superagent/node_modules/extend/CHANGELOG.md

@@ -0,0 +1,77 @@
+3.0.1 / 2017-04-27
+==================
+  * [Fix] deep extending should work with a non-object (#46)
+  * [Dev Deps] update `tape`, `eslint`, `@ljharb/eslint-config`
+  * [Tests] up to `node` `v7.9`, `v6.10`, `v4.8`; improve matrix
+  * [Docs] Switch from vb.teelaun.ch to versionbadg.es for the npm version badge SVG.
+  * [Docs] Add example to readme (#34)
+
+3.0.0 / 2015-07-01
+==================
+  * [Possible breaking change] Use global "strict" directive (#32)
+  * [Tests] `int` is an ES3 reserved word
+  * [Tests] Test up to `io.js` `v2.3`
+  * [Tests] Add `npm run eslint`
+  * [Dev Deps] Update `covert`, `jscs`
+
+2.0.1 / 2015-04-25
+==================
+  * Use an inline `isArray` check, for ES3 browsers. (#27)
+  * Some old browsers fail when an identifier is `toString`
+  * Test latest `node` and `io.js` versions on `travis-ci`; speed up builds
+  * Add license info to package.json (#25)
+  * Update `tape`, `jscs`
+  * Adding a CHANGELOG
+
+2.0.0 / 2014-10-01
+==================
+  * Increase code coverage to 100%; run code coverage as part of tests
+  * Add `npm run lint`; Run linter as part of tests
+  * Remove nodeType and setInterval checks in isPlainObject
+  * Updating `tape`, `jscs`, `covert`
+  * General style and README cleanup
+
+1.3.0 / 2014-06-20
+==================
+  * Add component.json for browser support (#18)
+  * Use SVG for badges in README (#16)
+  * Updating `tape`, `covert`
+  * Updating travis-ci to work with multiple node versions
+  * Fix `deep === false` bug (returning target as {}) (#14)
+  * Fixing constructor checks in isPlainObject
+  * Adding additional test coverage
+  * Adding `npm run coverage`
+  * Add LICENSE (#13)
+  * Adding a warning about `false`, per #11
+  * General style and whitespace cleanup
+
+1.2.1 / 2013-09-14
+==================
+  * Fixing hasOwnProperty bugs that would only have shown up in specific browsers. Fixes #8
+  * Updating `tape`
+
+1.2.0 / 2013-09-02
+==================
+  * Updating the README: add badges
+  * Adding a missing variable reference.
+  * Using `tape` instead of `buster` for tests; add more tests (#7)
+  * Adding node 0.10 to Travis CI (#6)
+  * Enabling "npm test" and cleaning up package.json (#5)
+  * Add Travis CI.
+
+1.1.3 / 2012-12-06
+==================
+  * Added unit tests.
+  * Ensure extend function is named. (Looks nicer in a stack trace.)
+  * README cleanup.
+
+1.1.1 / 2012-11-07
+==================
+  * README cleanup.
+  * Added installation instructions.
+  * Added a missing semicolon
+
+1.0.0 / 2012-04-08
+==================
+  * Initial commit
+

goTorrentWebUI/node_modules/superagent/node_modules/extend/LICENSE

@@ -0,0 +1,23 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Stefan Thomas
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+

goTorrentWebUI/node_modules/superagent/node_modules/extend/README.md

@@ -0,0 +1,81 @@
+[![Build Status][travis-svg]][travis-url]
+[![dependency status][deps-svg]][deps-url]
+[![dev dependency status][dev-deps-svg]][dev-deps-url]
+
+# extend() for Node.js <sup>[![Version Badge][npm-version-png]][npm-url]</sup>
+
+`node-extend` is a port of the classic extend() method from jQuery. It behaves as you expect. It is simple, tried and true.
+
+Notes:
+
+* Since Node.js >= 4,
+  [`Object.assign`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/assign)
+  now offers the same functionality natively (but without the "deep copy" option).
+  See [ECMAScript 2015 (ES6) in Node.js](https://nodejs.org/en/docs/es6).
+* Some native implementations of `Object.assign` in both Node.js and many
+  browsers (since NPM modules are for the browser too) may not be fully
+  spec-compliant.
+  Check [`object.assign`](https://www.npmjs.com/package/object.assign) module for
+  a compliant candidate.
+
+## Installation
+
+This package is available on [npm][npm-url] as: `extend`
+
+``` sh
+npm install extend
+```
+
+## Usage
+
+**Syntax:** extend **(** [`deep`], `target`, `object1`, [`objectN`] **)**
+
+*Extend one object with one or more others, returning the modified object.*
+
+**Example:**
+
+``` js
+var extend = require('extend');
+extend(targetObject, object1, object2);
+```
+
+Keep in mind that the target object will be modified, and will be returned from extend().
+
+If a boolean true is specified as the first argument, extend performs a deep copy, recursively copying any objects it finds. Otherwise, the copy will share structure with the original object(s).
+Undefined properties are not copied. However, properties inherited from the object's prototype will be copied over.
+Warning: passing `false` as the first argument is not supported.
+
+### Arguments
+
+* `deep` *Boolean* (optional)
+If set, the merge becomes recursive (i.e. deep copy).
+* `target`	*Object*
+The object to extend.
+* `object1`	*Object*
+The object that will be merged into the first.
+* `objectN` *Object* (Optional)
+More objects to merge into the first.
+
+## License
+
+`node-extend` is licensed under the [MIT License][mit-license-url].
+
+## Acknowledgements
+
+All credit to the jQuery authors for perfecting this amazing utility.
+
+Ported to Node.js by [Stefan Thomas][github-justmoon] with contributions by [Jonathan Buchanan][github-insin] and [Jordan Harband][github-ljharb].
+
+[travis-svg]: https://travis-ci.org/justmoon/node-extend.svg
+[travis-url]: https://travis-ci.org/justmoon/node-extend
+[npm-url]: https://npmjs.org/package/extend
+[mit-license-url]: http://opensource.org/licenses/MIT
+[github-justmoon]: https://github.com/justmoon
+[github-insin]: https://github.com/insin
+[github-ljharb]: https://github.com/ljharb
+[npm-version-png]: http://versionbadg.es/justmoon/node-extend.svg
+[deps-svg]: https://david-dm.org/justmoon/node-extend.svg
+[deps-url]: https://david-dm.org/justmoon/node-extend
+[dev-deps-svg]: https://david-dm.org/justmoon/node-extend/dev-status.svg
+[dev-deps-url]: https://david-dm.org/justmoon/node-extend#info=devDependencies
+

goTorrentWebUI/node_modules/superagent/node_modules/extend/component.json

@@ -0,0 +1,32 @@
+{
+	"name": "extend",
+	"author": "Stefan Thomas <justmoon@members.fsf.org> (http://www.justmoon.net)",
+	"version": "3.0.0",
+	"description": "Port of jQuery.extend for node.js and the browser.",
+	"scripts": [
+		"index.js"
+	],
+	"contributors": [
+		{
+			"name": "Jordan Harband",
+			"url": "https://github.com/ljharb"
+		}
+	],
+	"keywords": [
+		"extend",
+		"clone",
+		"merge"
+	],
+	"repository" : {
+		"type": "git",
+		"url": "https://github.com/justmoon/node-extend.git"
+	},
+	"dependencies": {
+	},
+	"devDependencies": {
+		"tape" : "~3.0.0",
+		"covert": "~0.4.0",
+		"jscs": "~1.6.2"
+	}
+}
+

goTorrentWebUI/node_modules/superagent/node_modules/extend/index.js

@@ -0,0 +1,86 @@
+'use strict';
+
+var hasOwn = Object.prototype.hasOwnProperty;
+var toStr = Object.prototype.toString;
+
+var isArray = function isArray(arr) {
+	if (typeof Array.isArray === 'function') {
+		return Array.isArray(arr);
+	}
+
+	return toStr.call(arr) === '[object Array]';
+};
+
+var isPlainObject = function isPlainObject(obj) {
+	if (!obj || toStr.call(obj) !== '[object Object]') {
+		return false;
+	}
+
+	var hasOwnConstructor = hasOwn.call(obj, 'constructor');
+	var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf');
+	// Not own constructor property must be Object
+	if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) {
+		return false;
+	}
+
+	// Own properties are enumerated firstly, so to speed up,
+	// if last one is own, then all properties are own.
+	var key;
+	for (key in obj) { /**/ }
+
+	return typeof key === 'undefined' || hasOwn.call(obj, key);
+};
+
+module.exports = function extend() {
+	var options, name, src, copy, copyIsArray, clone;
+	var target = arguments[0];
+	var i = 1;
+	var length = arguments.length;
+	var deep = false;
+
+	// Handle a deep copy situation
+	if (typeof target === 'boolean') {
+		deep = target;
+		target = arguments[1] || {};
+		// skip the boolean and the target
+		i = 2;
+	}
+	if (target == null || (typeof target !== 'object' && typeof target !== 'function')) {
+		target = {};
+	}
+
+	for (; i < length; ++i) {
+		options = arguments[i];
+		// Only deal with non-null/undefined values
+		if (options != null) {
+			// Extend the base object
+			for (name in options) {
+				src = target[name];
+				copy = options[name];
+
+				// Prevent never-ending loop
+				if (target !== copy) {
+					// Recurse if we're merging plain objects or arrays
+					if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) {
+						if (copyIsArray) {
+							copyIsArray = false;
+							clone = src && isArray(src) ? src : [];
+						} else {
+							clone = src && isPlainObject(src) ? src : {};
+						}
+
+						// Never move original objects, clone them
+						target[name] = extend(deep, clone, copy);
+
+					// Don't bring in undefined values
+					} else if (typeof copy !== 'undefined') {
+						target[name] = copy;
+					}
+				}
+			}
+		}
+	}
+
+	// Return the modified object
+	return target;
+};